Concept explainers
(a)
Interpretation:
For the given reaction it should be identified that whether it is exergonic or endergonic and also that whether it produces phosphate which later release energy by giving phosphate group.
Concept Introduction:
Exergonic: The reaction is considered as exergonic if energy released since the reactants loses its energy making the free energy more negative hence making it spontaneous reaction.
Endergonic: The reaction is considered as endergonic if it needs more energy means that activation energy is much higher making the reaction non spontaneous.
Favorable Reaction: They release free energy which in turn used to do work. The products will have lower energy than reactants of the reaction shows that stable products are obtained hence the value of
The tendency for reaction proceed toward product side before reaching equilibrium will increases as more amount of free energy released.
(b)
Interpretation:
For the given reaction it should be identified that whether it is exergonic or endergonic and also that whether it produces phosphate which later release energy by giving phosphate group.
.
Concept Introduction:
Exergonic: The reaction is considered as exergonic if energy released since the reactants loses its energy making the free energy more negative hence making it spontaneous reaction.
Endergonic: The reaction is considered as endergonic if it needs more energy means that activation energy is much higher making the reaction non spontaneous.
Favorable Reaction: They release free energy which in turn used to do work. The products will have lower energy than reactants of the reaction shows that stable products are obtained hence the value of
The tendency for reaction proceed toward product side before reaching equilibrium will increases as more amount of free energy released.
(c)
Interpretation:
For the given reaction it should be identified that whether it is exergonic or endergonic and also that whether it produces phosphate which later release energy by giving phosphate group.
Concept Introduction:
Exergonic: The reaction is considered as exergonic if energy released since the reactants loses its energy making the free energy more negative hence making it spontaneous reaction.
Endergonic: The reaction is considered as endergonic if it needs more energy means that activation energy is much higher making the reaction non spontaneous.
Favorable Reaction: They release free energy which in turn used to do work. The products will have lower energy than reactants of the reaction shows that stable products are obtained hence the value of
The tendency for reaction proceed toward product side before reaching equilibrium will increases as more amount of free energy released.
Want to see the full answer?
Check out a sample textbook solutionChapter 21 Solutions
Fundamentals of General, Organic, and Biological Chemistry (8th Edition)
- How many acetyl CoA molecules are produced in one cycle of beta oxidation? How many cycles would it take to catabolize a stearic acid molecule (a fatty acid, [18:0]) into acetyl Co A units? a)How many acetyl CoA molecules would be produced? b) How many reduced nucleotides would be produced? c) If a molecule of glucose produces a net 32 ATP when completely catabolized, which do you think will produce more energy, one molecule of glucose or one molecule of stearic acid? Justify your answer.arrow_forwardFor myristic acid, C 13H 27CO 2H: (a) How many molecules of acetyl CoA are formed from complete β-oxidation? (b) How many cycles of β-oxidation are needed for complete oxidation?arrow_forwardTo oxidize the fatty acid molecule shown below, what enzyme(s) are needed in addition to the enzymes needed for beta - oxidation? A) 2,4- dienoyl-CoA reductase only B) enoyl-CoA isomerase only C) both enoyl-CoA isomerase and 2,4- dienoyl-CoA reductase D) No additional enzymes are needed besides the normal ones for beta - oxidation. CH3(CH2)3-CH=CH-(CH2)3-C-0° поarrow_forward
- Draw the products of the reaction of xylulose-5-phosphate and erythrose-4-phosphate catalyzed by transketolase in the pentose phosphate pathway. Provide the structure in the protonation state found in physiological conditions. H H H OH FO HO-H H-OH H OPO3²- Q transketolase Draw glyceraldehyde-3- phosphate H H- H H H O OH OH OPO3²- Draw fructose-6- phosphate Q I Iarrow_forward(i) Consider a preparation that contains all the enzymes and cofactors necessary for fatty acid biosynthesis from acetyl-CoA and malonyl-CoA. If [2-H] acetyl-CoA labeled with deuterium, the heavy isotope of hydrogen and excess of unlabeled malonyl-CoA are added as substrates, where will you find these labeled deuterium atoms in a molecule of palmitate synthesized? Explain. S-COA (ii) Describe the steps involved in the synthesis of palmitic acid starting from acetyl-CoA and malonyl-CoA.arrow_forwardThe complete oxidation of palmitoyl-CoA to carbon dioxide and water is presented by the overall equation: Palmitoyl-CoA + 23O2 + 108Pi + 108 ATP + 23H2O → CoA + 16 CO2 + 108 ATP + 23H2O Water is also produced in the reaction ADP + Pi → ATP + H2O But not included as a product in the overall equation. Why?arrow_forward
- Hemp oil contains eicosenoic acid (20:149) as its primary monounsaturated fatty acid. Let's consider the conversion of a molecule of eicosenoic acid to ẞ-hydroxybutyrate. What are the ẞ-oxidation products and how many ATP are required during activation for one molecule of lignoceric acid? Given the following, how many molecules of 8-hydroxybutyrate can be produced? 2 CoA CoA NADH NAD+ H+ OH B-hydroxybutyrate Based on the total NADH and FADH2 available after converting lignoceric acid into 8-hydroxybutyrate, what is the typical yield of ATP that can be produced in the liver? Don't forget to include any ATP required for activation steps.arrow_forwardIn order for fatty acids to enter the mitochondria to be catabolized via β-oxidation, they must first be reacted with coenzyme A (reaction ①). Use the equations below to answer parts a-c. ① Fatty Acid + CoA → Fatty Acid—CoA ΔG = ??? ② ATP → AMP + PPi ΔG = ─45.6 kJ/mol ③ PPi → 2 Pi ΔG = ─19.2 kJ/mol ④ Fatty Acid + ATP + CoA → FA—CoA + AMP + 2 Pi ΔG = ─34 kJ/mol a) Calculate ΔG for reaction 1. b) Suppose the formation of the fatty acid--CoA proceeded via the reaction of ATP to ADP instead of AMP. Calculate ΔG for reaction 5. ① Fatty Acid + CoA → Fatty Acid—CoA ΔG = from part a ② ATP → ADP + Pi ΔG = ─30.5 kJ/mol ⑤ Fatty Acid + ATP + CoA → FA—CoA + ADP + Pi ΔG = ??? kJ c) So why does the…arrow_forwardSynthesis of the activated form of acetate (acetyl-CoA) is carried out in an ATP-dependent process:(a) The ΔG′° for hydrolysis of acetyl-CoA to acetate and CoA is −32.2 kJ/mol and that for hydrolysis of ATP to AMP and PPi is −30.5 kJ/mol. Calculate ΔG′° for the ATPdependent synthesis of acetyl-CoA.(b) Almost all cells contain the enzyme inorganic pyrophosphatase, which catalyzes the hydrolysis of PPi to Pi. What effect does the presence of this enzyme have on the synthesis of acetyl-CoA? Explain.arrow_forward
- Citrate synthase catalyzes the reaction Oxaloacetate + acetyl-CoA →citrate + HS-CoA The standard free energy change for the reaction is −31.5 kJ · mol−1. (a) Calculate the equilibrium constant for this reaction at 37°C. (b) Would you expect this reaction to serve as a control point for its pathway (the citric acid cycle)?arrow_forwardAcetyl CoA + 2H* + 2e = pyruvate + COASH E = -0.48 V Ubiquinone + 2H* + 2e = Ubiquinol E" = +0.04 V Consider the redox rxn wherein a pair of e passes from pyruvate to ubiquinone. Calculate the change in standard Gibbs free energy (kJ/mol). Report answer to two decimal places.arrow_forwardSome bacteria use the citric acid cycle intermediate, a-ketoglutarate, plus acetyl-CoA, as the starting point for lysine biosynthesis. The first part of this biosynthetic pathway uses the same chemical strategy found in the citric acid cycle. Propose a four-step pathway for the conversion of a-ketoglutarate to 2-oxoadipate. Draw the three missing intermediates, and indicate the chemistry involved in each reaction. Include any cofactors that you think might be required for specific steps.arrow_forward
- BiochemistryBiochemistryISBN:9781319114671Author:Lubert Stryer, Jeremy M. Berg, John L. Tymoczko, Gregory J. Gatto Jr.Publisher:W. H. FreemanLehninger Principles of BiochemistryBiochemistryISBN:9781464126116Author:David L. Nelson, Michael M. CoxPublisher:W. H. FreemanFundamentals of Biochemistry: Life at the Molecul...BiochemistryISBN:9781118918401Author:Donald Voet, Judith G. Voet, Charlotte W. PrattPublisher:WILEY
- BiochemistryBiochemistryISBN:9781305961135Author:Mary K. Campbell, Shawn O. Farrell, Owen M. McDougalPublisher:Cengage LearningBiochemistryBiochemistryISBN:9781305577206Author:Reginald H. Garrett, Charles M. GrishamPublisher:Cengage LearningFundamentals of General, Organic, and Biological ...BiochemistryISBN:9780134015187Author:John E. McMurry, David S. Ballantine, Carl A. Hoeger, Virginia E. PetersonPublisher:PEARSON