Concept explainers
Interpretation: The value of
Concept Introduction:
A chemical compound can be formed by either ionic bond or covalent bond between bonded atoms. The ionic compound is formed by opposite charge ions; cations and anions. The covalent compound is formed by sharing of electrons between bonded atoms.
Lattice energy can be defined as the energy released if the component ions were brought together from infinity to form the compound or the energy required to break the compound into its respective ions.
Trending nowThis is a popular solution!
Chapter 13 Solutions
Chemical Principles
- The enthalpy change for the following reaction is 393.5 kJ. C(s,graphite)+O2(g)CO2(g) (a) Is energy released from or absorbed by the system in this reaction? (b) What quantities of reactants and products are assumed? (c) Predict the enthalpy change observed when 3.00 g carbon burns in an excess of oxygen.arrow_forwardGive the definition of the standard enthalpy of formation for a substance. Write separate reactions for the formation of NaCl, H2O , C6H12O6, and PbSO4 that have H values equal to Hf for each compound.arrow_forwardA 0.470-g sample of magnesium reacts with 200 g dilute HCl in a coffee-cup calorimeter to form MgCl2(aq) and H2(g). The temperature increases by 10.9 C as the magnesium reacts. Assume that the mixture has the same specific heat as water and a mass of 200 g. (a) Calculate the enthalpy change for the reaction. Is the process exothermic or endothermic? (b) Write the chemical equation and evaluate H.arrow_forward
- In a coffee-cup calorimeter, 150.0 mL of 0.50 M HCI is added to 50.0 mL of 1.00 M NaOH to make 200.0 g solution at an initial temperature of 48.2C. If the enthalpy of neutralization for the reaction between a strong acid and a strong base is 56 kJ/mol, calculate the final temperature of the calorimeter contents. Assume the specific heat capacity of the solution is 4.184 J/g C and assume no heat Joss to the surroundings.arrow_forwardIs the following reaction the appropriate one to use in determining the enthalpy of formation of methane, CH4(g)? Why or why not? C(g)+4H(g)CH4(g)arrow_forwardUnder what circumstances is the heat of a process equal to the enthalpy change for the process?arrow_forward
- Gasohol, a mixture of gasoline and ethanol, C2H5OH, is used as automobile fuel. The alcohol releases energy in a combustion reaction with O2. C2H5OH(l)+3O2(g)2CO2(g)+3H2O(l) If 0.115 g ethanol evolves 3.62 kJ when burned at constant pressure, calculate the combustion enthalpy for ethanol.arrow_forwardGiven: 2Cu2O(s) + O2(g) 4CuO(s)H = 288 kJ Cu2O(s) CuO(s) + CuO(s)H = 11kJ Calculate the standard enthalpy of formation (Ht) for CuO(s).arrow_forwardAt 298 K, the standard enthalpies of formation for C2H2(g) and C6H6(l) are 227 kJ/mol and 49 kJ/mol, respectively. a. Calculate H for C6H6(l)3C2H2(g) b. Both acetylene (C2H2) and benzene (C6H6) can be used as fuels. Which compound would liberate more energy per gram when combusted in air?arrow_forward
- One step in the manufacturing of sulfuric acid is the conversion of SO2(g) to SO3(g). The thermochemical equation for this process is SO2(g)+12O2(g)SO3(g)H=98.9kJ The second step combines the SO3 with H2O to make H2SO4. (a) Calculate the enthalpy change that accompanies the reaction to make 1.00 kg SO3(g). (b) Is heat absorbed or released in this process?arrow_forwardCalculate H for the reaction N2H4(l)+O2(g)N2(g)+2H2O(l) given the following data: Equation H(KJ) 2NH3(g)+3N2O(g)4N2(g)+3H2O(l) 1010 N2O(g)+3H2(g)N2H4(l)+H2O(l) 317 2NH3(g)+12O2(g)N2H4(l)+H2O(l) 143 H2(g)+12O2(g)H2O(l) 286arrow_forwardThe process of dissolving ammonium nitrate, NH4NO3, in water is an endothermic process. What is the sign of q? If you were to add some ammonium nitrate to water in a flask, would you expect the flask to feel warm or cool?arrow_forward
- Chemistry: Principles and ReactionsChemistryISBN:9781305079373Author:William L. Masterton, Cecile N. HurleyPublisher:Cengage LearningGeneral Chemistry - Standalone book (MindTap Cour...ChemistryISBN:9781305580343Author:Steven D. Gammon, Ebbing, Darrell Ebbing, Steven D., Darrell; Gammon, Darrell Ebbing; Steven D. Gammon, Darrell D.; Gammon, Ebbing; Steven D. Gammon; DarrellPublisher:Cengage LearningChemistryChemistryISBN:9781305957404Author:Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCostePublisher:Cengage Learning
- Chemistry: Principles and PracticeChemistryISBN:9780534420123Author:Daniel L. Reger, Scott R. Goode, David W. Ball, Edward MercerPublisher:Cengage LearningChemistry: The Molecular ScienceChemistryISBN:9781285199047Author:John W. Moore, Conrad L. StanitskiPublisher:Cengage Learning