Concept explainers
(a)
Interpretation:
The products formed when the given ester is treated with H2O and
Concept Introduction:
Alcohols are the organic compounds with general chemical formula of R-OH whereas carboxylic acids are the organic molecules with R-COOH as general chemical formula.
(b)
Interpretation:
The products formed when the given ester is treated with H2O and
Concept Introduction:
Functional groups are the groups of atoms or atoms which are bonded with parent carbon chain in the organic molecule and are responsible for the physical and chemical properties of the compound. In organic chemistry, there are different functional groups such as carboxylic acid, alcohol, ester or amide.
Alcohols are the organic compounds with general chemical formula of R-OH whereas carboxylic acids are the organic molecules with R-COOH as general chemical formula.
(c)
Interpretation:
The products formed when the given ester is treated with H2O and
Concept Introduction:
Organic compounds are the compounds which are mainly composed C and H atoms. The branch of chemistry that deals with preparation, reactions, and properties of organic compounds. The molecular formula of organic compound represents the number of bonded atoms with their atomic symbols.
Functional groups are the groups of atoms or atoms which are bonded with parent carbon chain in the organic molecule and are responsible for the physical and chemical properties of the compound. In organic chemistry, there are different functional groups such as carboxylic acid, alcohol, ester or amide.
Alcohols are the organic compounds with general chemical formula of R-OH whereas carboxylic acids are the organic molecules with R-COOH as general chemical formula.
Want to see the full answer?
Check out a sample textbook solutionChapter 17 Solutions
General, Organic, and Biological Chemistry - 4th edition
- Give the name of a carboxylic acid or carboxylate salt used in each of the following ways: a.As a soap b.As a general food preservative used to pickle vegetables c.As a preservative used in soft drinks d.As a treatment of athletes foot e.As a mold inhibitor used in bread. f.As a food additive noted for its pH buffering abilityarrow_forwardList the following compounds in order of increasing water solubility: a.ethoxyethane b.propanoic acid c.pentane d.1 butanolarrow_forwardWhy is it safe for us to consume foods like vinegar that contain acetic acids?arrow_forward
- Saponification product of butylpropanoate is: Propanol and Sodium butanoate Butanol and sodium propanoate Butanol and Propanoic acid Butanoic acid and Propanoic acidarrow_forwardSafrole is a naturally occurring acetal isolated from sassafras plants. Once used as a common food additive in root beer and other beverages, it is now banned because it is carcinogenic. What compounds are formed when safrole is hydrolyzed with aqueous acid? safrolearrow_forwardWhat happens to phenol when: a) it reacts with Tollen's reagent? b) it undergoes esterification? c) it undergoes hydrolysis of esters?arrow_forward
- What product is formed when benzene is treated with each organic halide in the presence of AlCl3?arrow_forwardGive the products formed when Benzaldehyde and Benzoic Acid are treated with the given reagents. - NH2OHarrow_forwardWhat products are formed when each compound is treated with aqueous acid?arrow_forward
- Draw the pyrrole that would form in each of the following reactions. a) b) COOEt NH3 Ph cat HCI, heat NH2 cat HCI, heat c) 2 equiv NH2arrow_forwardWhat products are formed when each ester is hydrolyzed with water and H 2SO 4?arrow_forwardEthyl butyrate, CH3CH2CH2CO2CH2CH3, is an artificial fruit flavor commonly used in the food industry for such flavors as orange and pineapple. Its fragrance and taste are often associated with fresh orange juice, and thus it is most commonly used as orange flavoring.It can be produced by the reaction of butanoic acid with ethanol in the presence of an acid catalyst (H+): CH3CH2CH2CO2H(l)+CH2CH3OH(l)H+⟶CH3CH2CH2CO2CH2CH3(l)+H2O(l). The chemist discovers a more efficient catalyst that can produce ethyl butyrate with a 78.0% yield. How many grams would be produced from 8.50 gof butanoic acid and excess ethanol? Express your answer in grams to three significant figures.arrow_forward
- Introduction to General, Organic and BiochemistryChemistryISBN:9781285869759Author:Frederick A. Bettelheim, William H. Brown, Mary K. Campbell, Shawn O. Farrell, Omar TorresPublisher:Cengage LearningChemistry for Today: General, Organic, and Bioche...ChemistryISBN:9781305960060Author:Spencer L. Seager, Michael R. Slabaugh, Maren S. HansenPublisher:Cengage Learning