Calculate the net ATP yield per fatty acid after complete oxidation. Show your solution using a table of pathways, reducing equivalents, and ATP
Q: Phosphocreatine (G0ʹ = -43.1 kJ/mol) has a higher phosphoryl group transfer potential than ATP…
A: Hi! Since you have posted multiple questions and have not mentioned which to answer, we shall answer…
Q: draw the full equation for this triacylglycerol undergoing saponification, using KOH.
A: In the process of saponification, triglycerides are reacted with sodium or potassium hydroxide to…
Q: Assuming that the human body has 4 X 10" cells and that ATP is being used at a rate of 10° ATP per…
A: ATP (adenosine triphosphate) is the biomolecule that is considered the energy currency of the cells.…
Q: Myristoleic acid is a monounsaturated fatty acid found in small amounts in a variety of foods.…
A: Myristoleic acid would undergo beta-oxidation for its catabolism.
Q: Calculate the number of ATPS generated by the complete metabolic oxidation of tripalmitin…
A: Tripalmitin is a triglyceride derived from the fatty acid palmitic acid.
Q: rounds of beta-oxidation are needed to oxidize the fatty acid
A:
Q: Amylose n + Water → Amylosen-1 + Glucose (See attached image of chemical reaction for the…
A: Starch is made up of monomers of glucose in the form of amylose and amylopectin. Amylose is a…
Q: Less energetic electrons. Why are electrons carried by FADH2FADH2 not as energy rich as those…
A: Nicotinamide adenine dinucleotide is a cofactor central to metabolism. It is found in all living…
Q: Glycerophospholipids Phosphatidylethanolamine 1. classify the fatty acids as essential or…
A: Multiple questions asked.I will answer first question, as allowed by guidelines. Essential fatty…
Q: Comparing stearate to palmitate, concerning beta oxidation, how many more ATP will be formed from…
A: After each cycle of beta oxidation, the fatty acid gets reduced by 2 Carbons and the end products…
Q: The oxidation of 1 mol of glucose supplies enough metabolic energy to form 36 mol of ATP. Oxidation…
A: Let's see molar mass of glucose (C6H12O6) and tristearin (C57H116O6): Molar mass of C6H12O6 =…
Q: What is the function of glyceraldehyde 3-phosphate dehydrogenase? Is it because of -> The…
A: Glycolysis is the first step by which glucose is broken down by the body to release energy.…
Q: ACTIVITY-1. Which of the following is NOT a monosaccharide? Explain your reasoning. A C D но. ÇH2OH…
A: Monosaccharides are carbohydrates. Carbohydrates are macromolecules which are made up of carbon,…
Q: Calculate the number of ATPS produced from the complete oxidation of a TAG containing two caproic…
A:
Q: Sugar to Glycolysis Madeupose-5 Phosphate (a 5 carbon aldose) is fed into glycolysis after a…
A: Glycolysis is a metabolic pathway and an anaerobic energy source that has evolved in nearly all…
Q: Phosphorylated compounds with a high hydrolysis rate have a high phosphoryl group transfer…
A: Because phosphorus is thermodynamically unstable and kinetically stable, it is an important molecule…
Q: Arsinate binds to reduced thio groups such as those found in cystiene residues in proteins, lipoate…
A: Arsenic poisoning is a medical condition that occurs when the level of arsenic in the body is too…
Q: Glycolysis Two of these per glucose CHOH PH HO OH АТР glyceraldehyde-3-phosphate dehydrogenase ADP…
A: Glycolysis is a pathway in carbohydrate metabolism that involves the breakdown of glucose to provide…
Q: 1. Put together the sequence of components (numbers) that form the glycolysis pathway and the linked…
A: Glycolysis is a catabolic pathway where glucose is converted to pyruvate. The pyruvate formed in…
Q: Creatine phosphate has a standard state free energy of hydrolysis of -43.1 kJ/mol. The given…
A: Gibbs free energy (G) of a system is the usable energy present in the system. For a reaction, free…
Q: Dinitrophenol (DNP) is an uncoupler that was used until 1938 as a drug to lose weight. It has the…
A: Dinitrophenol is an organic chemical compound which has a lot of use in industries, and during the…
Q: Consider MYRISTIC ACID CH3-(CH2)12 - COOH C. How many cycles of ß- oxidation are needed for complete…
A: It is given that, Myristic acid CH3 - (CH2)12 - COOH. How many cycles of beta-oxidation are needed…
Q: Phosphorylation of phosphatidylinositol yieldsa) Phosphatidylinositol 4, 5-biphosphateb)…
A: Phosphoinositides involve only a little fraction of cellular Phospholipids and their importance in…
Q: You can use ribose (R) as a fuel for “burning” to CO2 and generating ATP after phosphorylation to…
A: Ribose is a pentose sugar that consists of five carbons. It is metabolises by pentose phosphate…
Q: Energy production pathway in targeted by drugs in the malignant (cancerous) cells to control an X…
A: The oxidative phosphorylation is the process by which the electron transport chain in the inner…
Q: intracellular concentration of P. The increase in P, concentration would drive the unfavorable…
A: ATP+ HOH -------> ADP+ Pi ∆G = -7 kcal/mol Glucose + Pi –------> glucose 6 phosphate + ADP…
Q: Please state if the statements are true or false. 1. A pyranose is a sugar in Haworth projection…
A: Haworth projection: This was designed by Sir Norman Haworth. The cyclic structure of…
Q: Explain what is meant by the term, “high energy compound”. Name a thioester molecule that is…
A: “Since you have asked multiple questions, we will solve the first question for you. If you want any…
Q: Sodium fluoroacetate (FH2CCOO- Na+) is highly toxic. Patients with fluoroacetate poisoning…
A: Fluoroacetate is poisonous to animals and humans as it inhibits some of the prime enzyme required in…
Q: 1. Draw the products that would be produced from phospholipase C cleavage of a glycerophospholipid…
A: Phospholipases are lipolytic enzymes that hydrolyze phospholipids at specific ester bonds. They are…
Q: The molar absorption coefficient of cytochrome P450. an enzyme involved in the breakdown of harmful…
A: The Beer-Lambert law is a relationship between the attenuation of light through a substance and the…
Q: (i) Why do many reactions in metabolism include the formation or the breakdown of adenosine…
A: Metabolism metabolism is a process of reactions involving the breakdown of food to generate chemical…
Q: P3D.2 In biological cells, the energy released by the oxidation of foods is stored in adenosine…
A: The values provided in the questions are: T = 310 K H (enthalpy change) = -20 kJ.mol-1 G = - 31…
Q: What information do the Δ G°’ data given in Table 15.1 provide about the relative rates of…
A: Δ G°’ is the free energy change for a reaction under standard conditions. Biochemical reactions…
Q: catalytic function of C25
A: Protease is one of several enzymes that hydrolyze the proteins. They cut the peptide bond which…
Q: ter reading the “Using spectrophotometers to study a Catechol Oxidase Reaction section, copy into…
A: Catechol Oxidase reaction is the process or reaction known to cause browning of the fruits when the…
Q: Applying: Which of the following commonly acts as the precursor for the synthesis of vitamin C…
A: Carbohydrates are compounds formed of monosaccharides as building blocks, which range from simple…
Q: QUESTI Supposed you want to use phosphoglucomutase to breakdown glycogen. You found out that this…
A: The enzymes can be classified into various categories based on their functions.
Q: (a) Write down the reaction of phosphatidylcholine (PC) cleaved by PLA2. Suppose the two acyl groups…
A: Phospholipids are degraded by phospholipases that cleaves the phosphodiester bonds. Phosphatidyl…
Q: Pathway Trace of Doom!!!!!!!! Make Squalene (remember this is a cytosolic event) Starting material:…
A:
Q: 9. TCA cycle and electromotive force-Consider the following reaction: malate + NAD22 oxaloacetate +…
A: For a reactionaA + bB ↔ cC + dD ∆G=∆G0+RT ln[C]c[D]d[A]a[B]bhere ∆G is te gibbs free energy∆G0 is…
Q: a. Write the products obtained from one cycle of beta oxidation. b. How many cycles of beta…
A: Beta oxidation is oxidation of fatty acid at beta carbon. It is divided into three stages:…
Q: 70 gram lactose working under aerobic conditions. First calculate the total amount of energy units…
A: Lactose is the diasaccharide and it is converted to monosaccharide by the enzyme lactase into…
Q: Starting: Fructose-6- phosphate Ending: Citrate How many NADH and FADH are produced between these…
A: Cellular respiration is a catabolic pathway of the process of metabolism, where a series of chemical…
Q: Why does ATP hydrolysis release so much energy? O Hydrolysis increases entropy through a gain in the…
A: ATP hydrolysis is a catabolic process in which the high-energy compound Adenosine triphosphate…
Q: Fat/Sugar/Ethanol Comparison: How many ATP are produced from the COMPLETE oxidation of 6 molecules…
A: Ethanol is a product of the bi-carbon alkane ethane and is classified as an alcohol. Ethanol is a…
Glycerophospholipids Phosphatidylethanolamine
2. Calculate the net ATP yield per fatty acid after complete oxidation. Show your solution using a table of pathways, reducing equivalents, and ATP
Trending now
This is a popular solution!
Step by step
Solved in 3 steps with 8 images
- Glycerophospholipids Phosphatidylethanolamine 1. classify the fatty acids as essential or non-essential and also as saturated, monounsaturated, or polyunsaturated. 2. Calculate the net ATP yield per fatty acid after complete oxidation. Show your solution using a table of pathways, reducing equivalents, and ATP 3. In case the cell is in a state requiring large amount of ATP to support energy-requiring reactions/pathways, assuming that you have 1 mole of each of the said lipids are catabolized and complete oxidized, will the total net ATP yield from these two lipids be higher or lower than the sum of the net ATPs generated from each fatty acid components? Justify your answer in biochemical terms and using 5 sentences or less.Glycerophospholipids Phosphatidylethanolamine 3. In case the cell is in a state requiring large amount of ATP to support energy-requiring reactions/pathways, assuming that you have 1 mole of each of the said lipids are catabolized and complete oxidized, will the total net ATP yield from these two lipids be higher or lower than the sum of the net ATPs generated from each fatty acid components? Justify your answer in biochemical terms and using 5 sentences or less.Arachidonic acid, a 20-C saturated fatty acid. Use only 1 mole:1. How many rounds of beta-oxidation are needed to oxidize the fatty acid, and what is the total ATP yield? Show your solution.
- i. How dihydroxyacetone phosphate is formed from glycerol? Write the chemical reactions. a& ii. What product is formed by the reaction of B-glucose with ATP? OH HO Ho Hexokinase OH ATP OH OH Glucose iii. Why saturated fatty acids haye high melting points than their unsaturated counterparts? naà k7Calculate the ATP yield for the full catabolism of a phospholipid containing ethanolamine, C18:3 Δ9, 12, 15 and oleic acid. Include any ATP “expenses” or “income”. This will be a complex problem—neatly show your work and justify your choices.generation of one less FADH2 molecule. Part C B-oxidation dealls with only saturated fatty acids, but many fatty acids in natural lipids are unsaturated, meaning they contain one or more double bonds. Considering the fatty acid below, calculate the energy yield of its complete oxidation. OH Express your answer using three significant figures. ▸ View Available Hint(s) ΑΣΦ + 0 ? Submit ATP
- Myristoleic acid is a monounsaturated fatty acid found in small amounts in a variety of foods. Calculate the net ATP yield from the complete β-oxidation of myristoleic acid. The formula of myristoleic acid is shown below (it is assumed that the total ATP production is the same for both saturated and unsaturated fatty acids having the same carbon chain length). CH3-(CH2)3-CHCH-(CH2)7-COOH (Given: The oxidation of one NADH yields 2.5 ATP; the oxidation of one FADH2 yields 1.5 ATP; and the oxidation of one acetyl CoA yields 10 ATP. ) Group of answer choices a. 96 ATP b. 92 ATP c. 94 ATP d. 34 ATP e. 36 ATPphosphorylation/dephosphorylation 5. Diagram the cascade that regulates glycogen metabolism. Please use key enzyme names and arrows to show how glycogen phosphorylase and glycogen synthase are inversely activated/deactivated.Palmitoleic acid, 16:1Δ⁹ hexadecaenoic acid, (16 carbon FA with one double bond )is an important fatty acid component of TAGs and cell membranes. Briefly explain the process of beta oxidation of this fatty acid and the number (only) of FADH, NADH and acetyl CoA outcome. What is the total ATP (only number) generated from this fatty acid after beta oxidation.
- canvas.uts.edu.au/courses/26618/quizzes/67363/take Based on the image below, select the correct statement. (b) Glyceraldehyde 3-phosphate (2) DOCH, CH -2P₁ OH -2NAD* oxidation and phosphorylation 1,3-Bisphosphoglycerate (2) first ATP- forming reaction (substrate-level phosphorylation) 2 NADH+H* 2 ADP 2 ATP 3-Phosphoglycerate (2) O 2-Phosphoglycerate (2) second ATP- forming reaction (10 (substrate-level phosphorylation) → 2H₂O Phosphoenolpyruvate (2) -2ADP 2 ATP Pyruvate (2) OH ⒸOCH₂ CH₂-C OH CH₂-CH-C OH O K Payoff phase Oxidative conversion of glyceraldehyde 3-phosphate to pyruvate and the coupled formation of ATP and NADH O-P 6 Glyceraldehyde 3-phosphate dehydrogenase 7 Phospho- glycerate kinase 8 Phospho- glycerate mutase 9 Enolase (10) Pyruvate kinase O Overall, the payoff phase of glycolysis produces ATP but requires ADP Overall, the payoff phase of glycolysis requires ATP but produces ADP The reaction involving the enzyme phosphoglycerate kinase is reversible The conversion of…Adipose tissue cannot resynthesize triacylglycerols from glycerol released during lipolysis (fat breakdown). Why not? Describe the metabolic route that is used to generate a glycerol compound for tri- acylglycerol synthesis.Adipose tissue cannot resynthesize triacylglycerols from glycerol released during lipolysis (fat breakdown). Why not? Describe the metabolic route that is used to generate a glycerol compound for triacylglycerol synthesis.