Biology: Life on Earth with Physiology (11th Edition)
11th Edition
ISBN: 9780133923001
Author: Gerald Audesirk, Teresa Audesirk, Bruce E. Byers
Publisher: PEARSON
expand_more
expand_more
format_list_bulleted
Concept explainers
Textbook Question
Chapter 3, Problem 1FIB
In organic molecules made of chains of subunits, each subunit is called a(n) _____, and the chains are called _____. Carbohydrates consisting of long chains of sugars are called_____. These sugar chains can be broken down by _____ reactions. Three types of carbohydrates consisting of long glucose chains are _____, _____, and
Expert Solution & Answer
Want to see the full answer?
Check out a sample textbook solutionStudents have asked these similar questions
When two carbohydrates bond, they do so through a reaction called
This produce a molecule called a_____. A molecule comprising numerous carbohydrates is called a______.
linoleic acid
polyunsaturated
weaker
higher
more
stearic acid
similar
stronger
saturated
lower
less
When the carbohydrate maltose is digested into two glucose monosaccharide sugars (by maltase in the human small intestine), the resulting glucose monomers are properly defined as:
the catalysts
the substrates
the enzymes
the reactants
the products
Chapter 3 Solutions
Biology: Life on Earth with Physiology (11th Edition)
Ch. 3.1 - define organic molecules and explain why carbon is...Ch. 3.1 - which of these is/are polar molecules? (you may...Ch. 3.1 - explain why functional groups are important in...Ch. 3.1 - name and describe the properties of seven...Ch. 3.2 - define organic molecules and explain why carbon is...Ch. 3.3 - describe the major types of carbohydrates?Ch. 3.3 - A 19-year old 6' 2' male weighing 297 pounds comes...Ch. 3.3 - Describe hydrolysis of this molecule.Ch. 3.3 - provide examples of each type of carbohydrate and...Ch. 3.4 - Infectious prions such as those that cause mad cow...
Ch. 3.4 - describe protein subunits and how proteins are...Ch. 3.4 - Look up the rest of the amino acids and. based on...Ch. 3.4 - explain the four levels of protein structure and...Ch. 3.4 - Why do many proteins, when heated excessively....Ch. 3.4 - list several functions of proteins and provide...Ch. 3.4 - describe the properties of Intrinsically...Ch. 3.5 - Puzzling Proteins All cells use DNA as a blueprint...Ch. 3.5 - describe the general structure of nucleotides?Ch. 3.5 - Why a Perm Is (Temporarily) Permanent?Ch. 3.5 - list three different functions of nucleotides?Ch. 3.5 - explain how nucleic acids are synthesized?Ch. 3.5 - give two examples of nucleic acids and their...Ch. 3.6 - Prob. 1CSRCh. 3.6 - FIGURE 3-22 Synthesis of a triglyceride...Ch. 3.6 - compare and contrast the structure and synthesis...Ch. 3.6 - An obese 55-year-old woman consults her physician...Ch. 3.6 - What kind of reaction breaks this molecule apart?Ch. 3.6 - why are steroid hormones able to diffuse through...Ch. 3.6 - describe the functions of fats, oils, and waxes?Ch. 3.6 - Why are steroid hormones able to diffuse through...Ch. 3.6 - Prob. 3CYLCh. 3 - Based on their structure, sketch and explain how...Ch. 3 - In organic molecules made of chains of subunits,...Ch. 3 - Polar molecules a. dissolve in lipids. b. are...Ch. 3 - Prob. 1RQCh. 3 - Prob. 2ACCh. 3 - Prob. 2FIBCh. 3 - Prob. 2MCCh. 3 - List the four principal classes of biological...Ch. 3 - Prob. 3ACCh. 3 - Prob. 3FIBCh. 3 - Prob. 3MCCh. 3 - Prob. 3RQCh. 3 - Prob. 4FIBCh. 3 - Which of the following is not composed of...Ch. 3 - Prob. 4RQCh. 3 - Fill in the following with the appropriate type of...Ch. 3 - Prob. 5MCCh. 3 - Prob. 5RQCh. 3 - Describe the synthesis of a protein from amino...Ch. 3 - Where in nature do we find cellulose? Where do we...
Knowledge Booster
Learn more about
Need a deep-dive on the concept behind this application? Look no further. Learn more about this topic, biology and related others by exploring similar questions and additional content below.Similar questions
- The symbol for the fatty acid below is ________________: ________________, n-____________________. CH3(CH2)2(CH=CHCH2)2(CH2)4COOH (This is a multiple blank question, e.g. for 12:1, n-3 you would enter 12, 1, and 3.)arrow_forwardConsider a hypothetical amino acid whose side chain forms a hydrogen bond with the oxygen atom of a water molecule. Based on this information, which of the following statements is correct? The side chain of the amino acid is hydrophobic. The side chain of the amino acid is negatively charged. It is not possible to determine if the amino acid is positively charged, negatively charged, or hydrophobic. The side chain of the amino acid is positively charged.arrow_forwardFats have the most potential energy of all the biomolecules because they have the most ___________________ atoms associated with ___________________ atoms. Your answer should consist of the first blank word with a comma and a space between them. For example: black, whitearrow_forward
- Which of the following names best describes the molecule? A. Pentose B. α-glucose C. β-fructose D. L-sugar E. ketosearrow_forwardCells can store energy as starches (long polymer forms of carbohydrates, or sugars) and fats. If you isolate the starch stored by a cell, you would find that a lot of the mass of the isolated starch is actually water. However, if you isolate the fat stored by a cell you would find that very little of the mass of the fat is water. Explain this difference based on the structures or properties of the starch and fat moleculesarrow_forwardLactose is a disaccharide made of a glucose and a galactose bonded together. Lactose is found in milk yet does not taste sweet because our taste receptors do not sense lactose. Our taste receptors do sense galactose and glucose. How can a mug of warm milk taste sweet, without adding sugar? [Select the best answer.] The activation energy required for the hydrolysis of lactose into glucose and galactose is supplied by heating the milk. The milk proteins are denatured by the heat. The reaction is endergonic so the heat is the energy required for the reaction to occur. The lactose has less free energy than the glucose and galactose.arrow_forward
- Let us say that the four major classes of biomolecules (Carbohydrates, Proteins, Nucleic Acids, and Lipids) are in the form of food, which one of the four do you think will give you the most energy? Why?arrow_forwardWhich of the following molecules is likely to have the most potential energy? A molecule of glucose A molecule of ATP A molecule of ADP A polysaccharidearrow_forwardAmong the simplest_ , those called_, are glucose (an_) and _(a _).arrow_forward
- Describe two conditions when it is more advantageous to use carbohydrates as a metabolic fuel rather than lipids, and explain why . Why might lipids be more advantageous under the opposite condition?arrow_forwardDixie Bee wanted to make JELL-O shots for her next party, but felt guilty about encouraging her guests to consume alcohol. She tried to compensate for the toxicity of the alcohol by adding pieces of healthy fresh pineapple to the shots, but when she did, the JELL-O never solidified. What happened? Hint: JELL-O is mainly sugar and a gelatinous mixture of proteins.arrow_forwardMatch each type of molecule with its description. _________ chain of amino acids _________ energy carrier _________ glycerol, fatty acids, _________ phosphate _________ chain of nucleotides _________ one or more sugar units a. carbohydrate b. phospholipid c. protein d. DNA e. ATParrow_forward
arrow_back_ios
SEE MORE QUESTIONS
arrow_forward_ios
Recommended textbooks for you
- Human Biology (MindTap Course List)BiologyISBN:9781305112100Author:Cecie Starr, Beverly McMillanPublisher:Cengage LearningBiology Today and Tomorrow without Physiology (Mi...BiologyISBN:9781305117396Author:Cecie Starr, Christine Evers, Lisa StarrPublisher:Cengage LearningConcepts of BiologyBiologyISBN:9781938168116Author:Samantha Fowler, Rebecca Roush, James WisePublisher:OpenStax College
Human Biology (MindTap Course List)
Biology
ISBN:9781305112100
Author:Cecie Starr, Beverly McMillan
Publisher:Cengage Learning
Biology Today and Tomorrow without Physiology (Mi...
Biology
ISBN:9781305117396
Author:Cecie Starr, Christine Evers, Lisa Starr
Publisher:Cengage Learning
Concepts of Biology
Biology
ISBN:9781938168116
Author:Samantha Fowler, Rebecca Roush, James Wise
Publisher:OpenStax College
Macromolecules | Classes and Functions; Author: 2 Minute Classroom;https://www.youtube.com/watch?v=V5hhrDFo8Vk;License: Standard youtube license