Concept explainers
(a)
Interpretation:
The given observation that
Concept introduction:
A complex ion is formed when a metal ion reacts with a Lewis base in solution. This reaction is defined in terms of
The Metal ion which is positively charged functions as a Lewis acid. Lewis base or the ligand has one or more lone pairs of electrons. For example, Cu2+, which is a highly charged and small metal ion having a significant tendency to function as Lewis acids, consequently exhibiting the greatest affinity to form complex ions.
The development of a complexion is a stepwise procedure, and every step has its equilibrium constant. When two of the equations are added together, the equilibrium constants multiply.
(b)
Interpretation:
In the given observation the reason by which Agl will dissolve in an aqueous solution of sodium thiosulfate should be determined in terms of complex-ion formation.
Concept introduction:
A complex ion is formed when a metal ion reacts with a Lewis base in solution. This reaction is defined in terms of chemical equilibrium. A complexion comprises of a ligand and a metal ion as a result of an interaction of Lewis acid-base.
The Metal ion which is positively charged functions as a Lewis acid. Lewis base or the ligand has one or more lone pairs of electrons. For example, Cu2+, which is a highly charged and small metal ion having a significant tendency to function as Lewis acids, consequently exhibiting the greatest affinity to form complex ions.
The development of a complexion is a stepwise procedure, and every step has its equilibrium constant. When two of the equations are added together, the equilibrium constants multiply.
Trending nowThis is a popular solution!
Chapter 24 Solutions
GENERAL CHEMISTRY(LL)-W/MASTERINGCHEM.
- Two different compounds are known with the formula Pd(py)2Cl2, but there is only one compound with the formula Zn(py)2Cl2. The symbol py is for pyridine, a mono-dentate ligand. Explain the differences in the Pd and Zncompounds.arrow_forwarda. In the absorption spectrum of the complex ion Cr(NCS)63, there is a band corresponding to the absorption of a photon of light with an energy of 1.75 104 cm-1. Given 1 cm1 = 1.986 1023 J, what is the wavelength of this photon? b. The CrNC bond angle in Cr(NCS)63 is predicted to be 180. What is the hybridization of the N atom in the Ncs- ligand when a Lewis acid-base reaction occurs between Cr3+ and NCs- that would give a 180 CrNC bond angle? Cr(NCS)63 undergoes substitution by ethylenediamine (en) according to the equation Cr(NCS)63+2enCr(NCS)2(en)2++4NCS Does Cr(NCS)2(en)2+ exhibit geometric isomerism? Does Cr(NCS)2(en)2+ exhibit optical isomerism?arrow_forwardThe transition metals form a class of compounds called metal carbonyls, an example of which is the tetrahedral complex Ni(CO)4. Given the following thermodynamic data (at 298 K): (a) Calculate the equilibrium constant for the formation of Ni(CO)4(g) from nickel metal and CO gas. (b) Is the reaction of Ni(s) and CO(g) product- or reactant-favored at equilibrium? (c) Is the reaction more or less product-favored at higher temperatures? How could this reaction be used in the purification of nickel metal?arrow_forward
- has a crystal field splitting energy, o, of 2.60102 kJ/mol. What is the wavelength responsible for this energy?arrow_forwardFour different octahedral chromium coordination compounds exist that all have the same oxidation state for chromium and have H2O and Cl as the ligands and counterions. When 1 mole of each of the four compounds is dissolved in water, how many moles of silver chloride will precipitate upon addition of excess AgNO3?arrow_forwardThe ferrate ion, FeO42, is such a powerful oxidizing agent that in acidic solution, aqueous ammonia is reduced to elemental nitrogen along with the formation of the iron(III) ion. a. What is the oxidation state of iron in FeO42, and what is the electron configuration of iron in this polyatornic ion? b. lf 25.0 mL of a 0.243 M FeO42 solution is allowed to react with 55.0 mL of 1.45 M aqueous ammonia, what volume of nitrogen gas can form at 25C and 1.50 atm?arrow_forward
- Chemistry: An Atoms First ApproachChemistryISBN:9781305079243Author:Steven S. Zumdahl, Susan A. ZumdahlPublisher:Cengage LearningChemistryChemistryISBN:9781305957404Author:Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCostePublisher:Cengage Learning
- Chemistry: The Molecular ScienceChemistryISBN:9781285199047Author:John W. Moore, Conrad L. StanitskiPublisher:Cengage LearningChemistry & Chemical ReactivityChemistryISBN:9781337399074Author:John C. Kotz, Paul M. Treichel, John Townsend, David TreichelPublisher:Cengage LearningChemistry & Chemical ReactivityChemistryISBN:9781133949640Author:John C. Kotz, Paul M. Treichel, John Townsend, David TreichelPublisher:Cengage Learning