Ksp for Co(OH)2 at 25°C is 3.3 ×10-16 Using this and data from Appendix 2, calculate the value of ΔGf° for Co(OH)2(s).
Interpretation:
Calculate the standard free energy values
Concept Introduction:
Standard free energy
Solubility of equilibrium (Ksp): Equilibrium constant, the value of
Entropy
Gibbs free energy (G): The thermodynamic quantity to the (
Answer to Problem 10PPB
The respective entropy
Explanation of Solution
To find: To understand and derived the second law thermodynamic entropy
We consider the fallowing entropy equation
The equilibrium chemistry should explained for more details in different type of reactions (like forward and backward reactions), at the same rate constant that is no net reactions is occurring in either directions of reactants and products are constant. The above equation Q=K &
To find: Calculate the entropy values
Let we consider the above chemical equilibrium process
The given statement of values is substitute in above equation (2)
Given the
The standard free energy values
Want to see more full solutions like this?
Chapter 15 Solutions
EBK CHEMISTRY: ATOMS FIRST
- What is meant by the standard free-energy change G for a reaction? What is meant by the standard free energy of formation Gf of a substance?arrow_forwardHow is the sign of q, heat, defined? How does it relate to the total energy of the system?arrow_forwardUse the data in Appendix G to calculate the standard entropy change for H2(g) + CuO(s) H2O() + Cu(s)arrow_forward
- For the reaction NO(g)+NO2(g)N2O3(g) , use tabulated thermodynamic data to calculate H and S. Then use those values to answer the following questions. (a) Is this reaction spontaneous at 25°C? Explain your answer. (b) If the reaction is not spontaneous at 25°C, will it become spontaneous at higher temperatures or lower temperatures? (c) To show that your prediction is accurate, choose a temperature that corresponds to your prediction in part (b) and calculate G . (Assume that both enthalpy and entropy are independent of temperature.)arrow_forwardIs the formation of ozone (O3(g)) from oxygen (O2(g)) spontaneous at room temperature under standard state conditions?arrow_forwardThe combustion of methane can be represented as follows: a. Use the information given above to determine the value of H for the combustion of methane to form CO2(g) and 2H2O(l). b. What is Hf for an element in its standard state? Why is this? Use the figure above to support your answer. c. How does H for the reaction CO2(g) + 2H2O (1) CH4(g) + O2(g) compare to that of the combustion of methane? Why is this?arrow_forward
- From the values for G f given in Appendix 1, calculate G at 25C for each of the reactions in Question 19.arrow_forwardUsing data from Appendix 4, calculate H, S and G for the following reactions that produce acetic acid: Which reaction would you choose as a commercial method for producing acetic acid (CH3CO2H) at standard conditions? What temperature conditions would you choose for the reaction? Assume H and S do not depend on temperature.arrow_forwardA green plant synthesizes glucose by photosynthesis, as shown in the reaction: 6CO2(g) + 6H2O(l) C6H12O6(s) + 6O2(g) Animals use glucose as a source of energy: C6H12O6(s) + 6O2(g) 6CO2(g) + 6HO2(l) If we were to assume that both of these processes occur to the same extent in a cyclic process, what thermodynamic property must have a nonzero value?arrow_forward
- Coal is used as a fuel in some electric-generating plants. Coal is a complex material, but for simplicity we may consider it to be a form of carbon. The energy that can be derived from a fuel is sometimes compared with the enthalpy of the combustion reaction: C(s)+O2(g)CO2(g) Calculate the standard enthalpy change for this reaction at 25C. Actually, only a fraction of the heat from this reaction is available to produce electric energy. In electric generating plants, this reaction is used to generate heat for a steam engine, which turns the generator. Basically the steam engine is a type of heat engine in which steam enters the engine at high temperature (Th), work is done, and the steam then exits at a lower temperature (Tl). The maximum fraction, f, of heat available to produce useful energy depends on the difference between these temperatures (expressed in kelvins), f = (Th Tl)/Th. What is the maximum heat energy available for useful work from the combustion of 1.00 mol of C(s) to CO2(g)? (Assume the value of H calculated at 25C for the heat obtained in the generator.) It is possible to consider more efficient ways to obtain useful energy from a fuel. For example, methane can be burned in a fuel cell to generate electricity directly. The maximum useful energy obtained in these cases is the maximum work, which equals the free-energy change. Calculate the standard free-energy change for the combustion of 1.00 mol of C(s) to CO2(g). Compare this value with the maximum obtained with the heat engine described here.arrow_forwardFor the reaction TiCl2(s) + Cl2(g) TiCl4(), rG = 272.8 kj/mol-txn. Using this value and other data available in Appendix L, calculate the value of fG for TiCl2(s).arrow_forwardUse the values of Hf in Appendix 4 to calculate H for the following reactions. (See Exercise 77 .) a. b. SiCl4(l)+2H2O(l)SiO2(s)+4HCl(aq) c. MgO(s)+H2O(l)Mg(OH)2(s)arrow_forward
- Chemistry: An Atoms First ApproachChemistryISBN:9781305079243Author:Steven S. Zumdahl, Susan A. ZumdahlPublisher:Cengage LearningChemistryChemistryISBN:9781305957404Author:Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCostePublisher:Cengage Learning
- Chemistry: Principles and ReactionsChemistryISBN:9781305079373Author:William L. Masterton, Cecile N. HurleyPublisher:Cengage LearningChemistry & Chemical ReactivityChemistryISBN:9781337399074Author:John C. Kotz, Paul M. Treichel, John Townsend, David TreichelPublisher:Cengage LearningChemistry & Chemical ReactivityChemistryISBN:9781133949640Author:John C. Kotz, Paul M. Treichel, John Townsend, David TreichelPublisher:Cengage Learning