Formulate the products obtained by reacting p-toluidine with a sulfonate mixture. Indicate the majority if necessary.

Draw the structural formula of the principal organic product formed when benzonitrile is treated with CH3MgBr followed by work-up with dilute acid.

What is the structure of the compound formed when 5-nitro-2-furaldehyde reacts with 4-cyanophenyl hydrazine hydrochloride?

Ethyl butyrate, CH3CH2CH2CO2CH2CH3CH3CH2CH2CO2CH2CH3, is an artificial fruit flavor commonly used in the food industry for such flavors as orange and pineapple.  Its fragrance and taste are often associated with fresh orange juice, and thus it is most commonly used as orange flavoring. It can be produced by the reaction of butanoic acid with ethanol in the presence of an acid catalyst (H+H+): CH3CH2CH2CO2H(l)+CH2CH3OH(l)H+⟶CH3CH2CH2CO2CH2CH3(l)+H2O(l) Part A Given 7.30 gg of butanoic acid and excess ethanol, how many grams of ethyl butyrate would be synthesized, assuming a complete 100%% yield? Express your answer in grams to three significant figures.   Part B A chemist ran the reaction and obtained 5.95 gg  of ethyl butyrate. What was the percent yield? Express your answer as a percent to three significant figures.   Part C The chemist discovers a more efficient catalyst that can produce ethyl butyrate with a 78.0%% yield. How many grams would be produced from 7.30 gg of…

Ethyl butyrate, CH3CH2CH2CO2CH2CH3CH3CH2CH2CO2CH2CH3, is an artificial fruit flavor commonly used in the food industry for such flavors as orange and pineapple.  Its fragrance and taste are often associated with fresh orange juice, and thus it is most commonly used as orange flavoring. It can be produced by the reaction of butanoic acid with ethanol in the presence of an acid catalyst (H+H+): CH3CH2CH2CO2H(l)+CH2CH3OH(l)H+⟶CH3CH2CH2CO2CH2CH3(l)+H2O(l) Given 8.45 gg of butanoic acid and excess ethanol, how many grams of ethyl butyrate would be synthesized, assuming a complete 100%% yield? Express your answer in grams to three significant figures.   A chemist ran the reaction and obtained 5.50 gg  of ethyl butyrate. What was the percent yield? Express your answer as a percent to three significant figures.   The chemist discovers a more efficient catalyst that can produce ethyl butyrate with a 78.0%% yield. How many grams would be produced from 8.45 gg of butanoic acid and excess…

Describe how 3-methyl-1-phenyl-3-pentanol can be prepared from benzene. You can use any inorganic reagents and solvents, and any organic reagents provided they contain no more than two carbons.

how to synthesize 3 - phenyl-2-butanone from the reactants given? į -0

help

The oxidation of 3-methylbutanal with potassium permanganate in an acid medium produces compound A and the reduction of cyclohexanone with NaBH4 produces compound B. Indicate the CORRECT alternative: a) A reacts rapidly with water to produce a carboxylic acid. b) Reaction of B with methylamine produces an amide. c) Reaction of A with an acyl chloride produces an ester. d) B reacts with HCN to produce a cyanohydrin. e) The reaction of A and B in an acid medium produces cyclohexyl 3-methylbutanoate.

The substance provided can be prepared by a nucleophilic addition reaction between an aldehydeor ketone and nucleophile. Identify the reactants from which it was prepared. If the substance is an acetal, identify the carbonyl compound and the alcohol; if it is an imine or enamine, identify the carbonyl compound and the amine.