Ethyl butyrate, CH3CH2CH2CO2CH2CH3CH3CH2CH2CO2CH2CH3, is an artificial fruit flavor commonly used in the food industry for such flavors as orange and pineapple.  Its fragrance and taste are often associated with fresh orange juice, and thus it is most commonly used as orange flavoring. It can be produced by the reaction of butanoic acid with ethanol in the presence of an acid catalyst (H+H+): CH3CH2CH2CO2H(l)+CH2CH3OH(l)H+⟶CH3CH2CH2CO2CH2CH3(l)+H2O(l) Part A Given 7.30 gg of butanoic acid and excess ethanol, how many grams of ethyl butyrate would be synthesized, assuming a complete 100%% yield? Express your answer in grams to three significant figures.   Part B A chemist ran the reaction and obtained 5.95 gg  of ethyl butyrate. What was the percent yield? Express your answer as a percent to three significant figures.   Part C The chemist discovers a more efficient catalyst that can produce ethyl butyrate with a 78.0%% yield. How many grams would be produced from 7.30 gg of butanoic acid and excess ethanol? Express your answer in grams to three significant figures.

IUPAC and Common name for the organic compound CH3CH(OH)CH2CH3

7) Draw the lactone formed by the following hydroxy carboxylic acid (Hint: Esterification reaction takes place.). سلل ОН OH

Which one of the following compounds does not have a secondary carbon? cydopentane butane 2-mathylbutane propane ethyl chloride C Which one of the following compounds does not have hydrogen bonding? triethylamine ethanol water diethylamine methanol A C What is the correct IUPAC name of the following compound? 3,3-dibromo-2-sec-butoxy-5-chloro-4ethylhexane B) 4,4 dibromo-2-chloro-3-ethyl-5-isobutaxcyhexane Br Br C) 3,3-dibromo-4-(chloroethyl)-2-isobutoxyhexane D) 4,4-dibromo-5-sec-butoxy-2-chloro-3-ethylhexane E) 3,3-dibromo-5-chloro-4-ethyl-2-isobutoxyhexane Rank the following compounds accordingly: " What is the correct order of decreasing ACIDITY of the following compounds? ( -- FCHCHNH HI ICHŁCOH на E strongest>_ >_>_>_weakest -What is the correct order of decreasing BASICITY of the following compounds?; CHSO,Na NaCl CH,CH,NHNa C CHONA CH0O,Na strongest >_>_>_>_weakest

During the purification step of banana oil, pentane is separates from the desired product by distillation. Explain why this is possible.

Explain the reaction of aldehydes and ketones with nitrogen ?

compound given  are a common organic solvent. From the pair of compounds, select the solvent with the greater solubility in water.

What is the similarity between cyclohexanol and cyclohexanone.

What is the percentage of HCl in the solution if the molarity is 0.268398000?  Assume the density of the solution is 1.00 g/mL.

when propyl ethanoate reacts with water in the presence of an acid catalyst, provide the IUPAC of the alcohol formed