Ethyl butyrate, CH3CH2CH2CO2CH2CH3CH3CH2CH2CO2CH2CH3, is an artificial fruit flavor commonly used in the food industry for such flavors as orange and pineapple.  Its fragrance and taste are often associated with fresh orange juice, and thus it is most commonly used as orange flavoring. It can be produced by the reaction of butanoic acid with ethanol in the presence of an acid catalyst (H+H+): CH3CH2CH2CO2H(l)+CH2CH3OH(l)H+⟶CH3CH2CH2CO2CH2CH3(l)+H2O(l) Part A Given 7.30 gg of butanoic acid and excess ethanol, how many grams of ethyl butyrate would be synthesized, assuming a complete 100%% yield? Express your answer in grams to three significant figures.   Part B A chemist ran the reaction and obtained 5.95 gg  of ethyl butyrate. What was the percent yield? Express your answer as a percent to three significant figures.   Part C The chemist discovers a more efficient catalyst that can produce ethyl butyrate with a 78.0%% yield. How many grams would be produced from 7.30 gg of butanoic acid and excess ethanol? Express your answer in grams to three significant figures.

Q: Provide the IUPAC name of (CH3)3CCH₂CH₂NHCH₂CH3. N-methyl-3-ethyl-1-butanamine…

A: ->Aliphatic amines are named by naming the alkyl group or groups attached to nitrogen and…

Q: Give the structural formula of the ff: 1)  2-hydroxybutanoic acid 2)  m-ethyl benzoic acid 3)…

A:

Q: Briefly describe the preparation of alcohols from ketones, and the preparation of alcohols from…

A: Applying concept of nucleophile addition reaction by grignard reagent on ketone and ester…

Q: For example, does the oxidation ofcyclohexyl methyl ketone form methyl cyclohexanecarboxylate or…

A: Ketones are hard to oxidize as they do not ha a H atom dire tally attached to the carbonyl group.…

Q: 1. Manufacturers of headache remedies routinely claim that their brands are more potent pain…

A: Given that, extra-strength Tylenol uses 600 mg = (600/1000) g = 0.6 g of acetaminophen (C8H9NO2). We…

Q: Indicate the necessary reagent and reaction conditions to distinguish the following compounds. Using…

A:

Q: What is the product formed by the reaction of methanol with CO in the presence of a rhodium…

A: A question based on reactions of alcohol. An alcohol reactant is given whose product on reaction…

Q: Draw and name ethers and heterocyclic ethers, including epoxides. Predict theirrelative boiling…

A: Draw and name ethers and heterocyclic ethers, including epoxides. Predict theirrelative boiling…

Q: Draw the structures for the four carboxylic acids of molecular formula C 5H 10O 2. Give the IUPAC…

A: Carboxylic acid: These are the organic acid with general formula of R-COOH, It contains carboxyl…

Q: Write the reaction, occurring in the liver, that causes theoxidation of methanol. What is the…

A: Alcohols are the organic compounds having -OH as the functional group. The chemical formula of…

Q: Write the structures of the following carboxylic acids and esters:                       a)…

A:

Q: How Aldehydes are oxidized selectively in the presence of other functional groups ?

A: Oxidizing agents are the substances which are capable of oxidizing other species while…

Q: Without any specific reaction conditions, potentially what functional groups could be formed between…

A: There is no reaction between two acids always acid reacts with base . -> Carboxylic acid reacts…

Q: Draw the structures of the following compounds: Ethylcycohexane 2-propanone 2-methyl hexanoic acid…

A:

Q: What is the IUPAC name for CH3CH2CH2CH2OHCH3CH2CH2CH2OH? 5-pentanal pentanal 3-butanol 1-butanol…

A:

Q: What is the IUPAC name for the following compound? O O propanoic anhydride propanoic propanoic…

A: The anhydrides are formed when two carboxylic acids react with each other and lose the water…

Q: What functional group is shown here: CH3CH₂COOH carboxylic acid ether alcohol ketone aldehyde

A:

Q: A molecule of carboxylic acid and alcohol undergo condensation reaction; the product will be: Ester…

A: Answer is explained below.  Esterification reaction occurs which is a condensation reaction means…

Q: Give the reagent and the reaction conditions that would distinguish between the following compounds.…

A:

Q: 6) the preparation of hexyl ethanoate from an acid and an alcohol 7) the hydrolysis of methyl…

A: (6) The reaction in which alcohal and acid react and form Ester

Q: What is the IUPAC name of the following compound? a) ethylmethylpropylamine b)…

A: The important rules for IUPAC nomenclature of organic compounds:-Select the parent chain with the…

Q: Draw the structural formula for the following compounds A) 2,3 -dimethyl-6-phenyloctanal

A:

Q: What is the Chemical Structure of Methyl Salicylate? Explain it clearly.

A: Structure of methyl Salicylate.

Q: The name of this organic compound. H- -C- -CH-COOH O 3,4-diketobutanoic acid O 3-oxobutanal O…

A: The detailed solution is done on white sheets of paper and explanation is done in step 2.

Q: Secondary alcohols are readily oxidized with common oxidizing agents to carboxylic acids Carboxylic…

A: Answers are explained below.

Q: 2-chloro-1-phenylpropane is reacted with ammonia, producing amphetamine, a widely misused stimulant.…

A: Answer:- This question is answered by using the simple concept of writing the chemical equation for…

Q: Write a balanced equation for the oxidation of cyclohexanol to cyclohexanone using acidic dichromate…

A: A balanced chemical equation is that in which the number of the atoms in the reactants side is equal…

Q: When treated with an acid catalyst, 4-hydroxybutanoic acid forms a cyclic ester (a lactone). Draw…

A: We have to predict structure formula of lactone as well as name.

Q: To synthesize the ester called methyl ethanoate, the following alcohol and carboxylic acid can be…

A: Given a product methyl ethanoate and and acid catalyst. Find out the reactant.

Q: The reduction of a carbonyl-containing compound with H2 in the presence of a catalyst produced the…

A: The aldehyde forms primary alcohol on reduction. The general reaction of reduction of an aldehyde…

Q: 2-hydroxy Propenoicanhydride

A:

Q: Draw a structural formula of the principal product formed when ethyl benzoate is treated with…

A: Ester is an organic compound which contains the -COOR group. The name of the given ester is ethyl…

Q: Write the skeletal structures of propanal, acetone and cyclohexanone. What is the major…

A: Forces that hold atoms together within a molecule. Intermolecular forces are forces that exist…

Q: Phenols and carboxylic acids contain an OH group, and carboxylic acids have this group in the form…

A: alcohol (-OH) and acid (-COOH) are different groups and have different chemical properties.…

Q: Why can an acidic organic compound be separated from a neutral (neither basic nor acidic) organic…

A: The separation of acidic organic compounds from neutral ones is a fundamental process in organic…

Q: makes

A: Product of auto oxidation of ethers makes the distillation of ethers dangerous why?

Q: What is/are true regarding the following compound? * СООН IUPAC name is 4-Carboxy-2- pentylbutanoate…

A:

Diol

In chemistry there are so many chemical compounds that have a hydroxyl group but a chemical compound having two hydroxyl groups (-OH) is termed as a diol. It also implies the presence of two alcohols whereas polyols contain two or more than two hydroxyl groups (-OH). Glycol or 1,2-diol is an aliphatic diol that has two alcohol groups on adjacent carbon atoms. In industries, the most commonly used diol is ethylene glycol.