Click the "draw structure" button to launch the drawing utility. What ketone is prepared by the following reaction sequence? OEt [1] NaOEt [2] CH3CH2CH2Br [3] NaOEt [4] C6H5CH₂I [5] H3O+, A CHE CH2CH2CH3 view structure

Click the "draw structure" button to launch the drawing utility. What ketone is prepared by the following reaction sequence? OEt [1] NaOEt [2] CH3CH2CH2Br [3] NaOEt [4] C6H5CH₂I [5] H3O+, A CHE CH2CH2CH3 view structure

Organic Chemistry

9th Edition

ISBN:9781305080485

Author:John E. McMurry

Publisher:John E. McMurry

Chapter3: Organic Compounds: Alkanes And Their Stereochemistry

Section3.SE: Something Extra

Problem 38AP: Give IUPAC names for the following compounds:

See similar textbooks

Related questions

Q: Fix this for me

A: Note: Here lone pair of nitrogen is also involved in the reaction but I have not shown it because…

Q: A chemist adds 1.05 L of a 2.20 mol/L silver nitrate (AgNOs) solution to a reaction flask. Calculate…

A: Given, Volume of silver nitrate solution added ( Volume ) = 1.05 LConcentration of silver nitrate…

Q: Question 3 Please predict the products for each of the following reactions: ABC 1.03 2. H₂O NaNH, 10…

A: Step 1: Step 2: Step 3: Step 4:

Q: Excess cortisol is actively binding to its receptors on the hypothalamus. The negative feedback…

A: The question is asking about the negative feedback mechanism of the endocrine system when there is…

Q: A chemist is studying the following equilibirum, which has the given equilibrium constant at a…

A: Equilibrium constant is defined as the ratio of partial pressure of products to the partial pressure…

Q: What functional groups does the following molecule have? Select all that apply. Remember that any…

A: In organic chemistry, an amide, also known as an organic amide or a carboxamide, is a compound with…

Q: show how for molecule C11H1402 the following fragments may be obtained given the mass spec highest…

A: The objective of the question is to understand how the given fragments can be obtained from the…

Q: Help solve 2.

Q: Pls help me solve the following question and explain it making sure its correct!!

Q: The ESI mass spectrum of the protein transferrin gave a regular series of peaks, with the most…

A: Step 1: reason for regular series of peaks observed in the ESI mass spectrum Step 2:calculating the…

Q: Predict the product for the following reaction. To preview the image MeO. CHO heat + MeO MeO. ± OA…

A: Step 1: Step 2: It the the cyclo-addition reaction of pericyclic. Step 3: Step 4:

Q: Calculate the pH of a solution of 0.0005 M sodium actate (NaAc) at 25 °C.

A: Step 1:To calculate the pH of a solution of sodium acetate (NaAc), we need to understand that sodium…

Q: I 3. All radioactive decay processes follow first-order kine - ics. What does this mean? What…

A: The statement that all radioactive decay processes follow first-order kinetics means that the rate…

Q: A 1.211 g of benzoic acid (CH§ COOH) was ignited in pure oxygen gas and the heat released from the…

A: Here's a step-by-step explanation:1. **Understanding the System**: We have benzoic acid (C6H5COOH)…

Q: Which statements describe electron transport chain events? Two electrons pass between cytochromes…

A: Each statement relates to aspects of cellular respiration, but not all of them describe events…

Q: Q5. Predict the major product of the following reaction. MeO CO₂Me 1) NaOH, H₂O at 50 °C 2) H3O+ B…

A: The nucleophile OH- attacks the carbonyl carbon to form a tetrahedral intermediate and finally, the…

Q: None

A: Step 1: Step 2: Step 3: Step 4:

Q: What is the full arrow pushing mechanism?

Q: Draw the products of this halogenation reaction. Use a dash or wedge bond to indicate the…

A: Organic reactions can be defined as the reactions in which organic reactants react with each other…

Q: A solution has [H+] = 4.2 x 103 M. The [OH] in this solution is O 4.2 x 10-11 M O 3.7 x 10-13 M O…

A: Answer:Product of hydrogen ion concentration and hydroxide ion concentration is always equal to the…

Q: Naming and Drawing Organic Molecules = Numbering the main chain of branched alkanes For each organic…

A: Step 1: Step 2: select the longest chain and give the number Step 3: Step 4:

Q: Please correct answer and don't use hend raiting

A: Let's discuss the mechanism of the reaction:Answer:The starting material is:

Q: Please correct answer and don't use hend raiting

A: Here's why:Aniline (C6H5NH2) is a derivative of benzene with an amino group (-NH2) attached to the…

Q: b. VS: Assign configurations (R or S) to all stereocenters in the products. Unlike NaBH4, reductions…

A: Approach to solving the question: Detailed explanation: Examples: Key references:

Q: Question 13 Identify the product (or multiple products) for each of the following reactions: A B C D…

Q: A logical retrosynthesis involves the disconnection of which indicated bond? (select two options) 0…

A: Ethers (R-O-R') can be prepared by treating alcohol (R-OH) with an alkyl halide (R'-X). During the…

Q: A. For the following reaction, give a full curved-arrow pushing mechanism for formation of BOTH…

A: The objective of the question is find out the mechanism of both the product formation and mention…

Q: Fix this for me

Q: The common substrate for all adrenal steroids is: Question 17 options:…

A: The question is asking for the common substrate used in the production of all adrenal steroids.…

Q: F NO2 + NaOCH2CH3

A: Given reaction:Sodium ethoxide (NaOCH2CH3) with p-fluoro nitrobenzene (1-fluoro-4-nitrobenzene)We…

Q: Question 17 Identify the product (or multiple products) for each of the following reactions: A B C D…

A: Step 1: Step 2: Step 3: Step 4:

Q: What is the product? Br CN 1. NaOEt 2. DIBAL 3. H3O+

A: NaOEt is a strong base,DIBAL-H is a reducing agent.H3O+ is acidic water workup.

Q: H3CO -LL F CH3Cl AICI3

A: The aromatic electrophilic substitution reaction is a reaction in which an electrophile replaces the…

Q: O Naming and Drawing Organic Molecules Numbering the main chain of branched alkanes each organic…

A: For the numbering of the carbon chain, the longest carbon chain is considered as te skeleton. And…

Q: ← Draw the products of the reaction shown below. Ignore inorganic byproducts. CH3(O)CI AICI 3…

A: This is a Friedel-Crafts reaction. In this reaction, a coupling reaction which involves an…

Q: Predict the major product of the following process. 1) LDA 2) 3) H₂O+ OH OH ?

A: Step 1: Step 2:Mechanism Step 3: Step 4:

Q: c) Draw the structure of each of the following complexes. Clearly show the stereocentre of central…

A: Structure of complex compound:A complex compound is a molecular structure with a central atom…

Q: d Spectroscopic Notation

A: Excited states to which the p state can make downward transitions.The selection rule: Δl=±1

Q: Draw the major product of the following reaction. CH3 C(CH3)3 HNO3 H2SO4

A: The given reaction is an example of the nitration of benzene. It is an electrophilic aromatic…

Q: 2 Cr(s) + 3 Pb²⁺(aq) ⟶ 3 Pb(s) + 2 Cr³⁺(aq), what is the value of n in the Nernst equation?

A: The objective of the question is to determine the value of 'n' in the Nernst equation for the given…

Q: Draw the mechanism for the following reaction: о CI A few notes: u • You may assume that each…

A: An arrow always depicts from a region of high electron density to low electron density ; that is…

Q: + T fx design a synthesis for the compound using organic reagents no larger than two or three…

A: The objective of the question is to design a synthesis for an unspecified compound using organic…

Q: Question 14 Identify the product (or multiple products) for each of the following reactions: A B C E…

Q: PLs help me solve the given question, explain it, make sure its correct pls thanks

A: Given:…

Q: Stars are surrounded by a white circle of gaseous material called the corona, which can be studied.…

A: The conversion of kinetic energy 4.4×104kJmol=4.4×104kJmol×1000JkJ=4.4×107Jmol

Q: (1) Explain the following polymerization mechanism by showing propagation reactions with the…

A: Step 1:Polymerization Mechanism with catalyst:The way the polymerization mechanism works is similar…

Q: 1. (2 pts) The following reaction involves the hypothetical element Z: * Z2H4(1) + O2(g) → Z2(s) + 2…

A: The given reaction is:[ Z₂H₄(l) + O₂(g) → Z₂(s) + 2 H₂O(l) ]We need to calculate the standard…

Q: Consider the following reaction which has the observed kinetic isotope effect kH kD = 1.5. CY2 Cy2 A…

A: It is hydrogenation reaction where a platinum catalyst facilitates the addition of hydrogen (H)…

Q: Assume that in a similar scenario, the room contains 0.01 atm of gasoline vapors (i.e. 1% by…

A: Given data:The room contains 0.01 atm of gasoline vapors, which means, 1% by pressure or volume,…

Q: dont provide handwriting solution..

A: The objective of the question is to predict the product(s) of the given sequence of reactions…

Concept explainers

Designing a Synthesis

Organic synthesis is a branch of chemical synthesis that involves the planned construction of organic compounds/molecules from smaller units that possess functional groups. Friedrich Wöhler was the first scientist who designed the synthesis of an organic compound, urea from inorganic starting materials silver cyanate with ammonium chloride via a simple, one-step synthesis.

Question

please explain this mechanistically and reasons

Click the "draw structure" button to launch the drawing utility.
What ketone is prepared by the following reaction sequence?
OEt
[1] NaOEt
[2] CH3CH2CH2Br
[3] NaOEt
[4] C6H5CH₂I
[5] H3O+, A
CHE
CH2CH2CH3
view structure

Expert Solution

This question has been solved!

Explore an expertly crafted, step-by-step solution for a thorough understanding of key concepts.

SEE SOLUTION Check out a sample Q&A here

Step 1: Introduction of a reaction

VIEW

Step 2: Mechanism of reaction

VIEW

Solution

VIEW

Step by step

Solved in 3 steps with 2 images

SEE SOLUTION Check out a sample Q&A here

Knowledge Booster

Learn more about

Need a deep-dive on the concept behind this application? Look no further. Learn more about this topic, chemistry and related others by exploring similar questions and additional content below.

Similar questions

Ethyl butyrate, CH3CH2CH2CO2CH2CH3CH3CH2CH2CO2CH2CH3, is an artificial fruit flavor commonly used in the food industry for such flavors as orange and pineapple. Its fragrance and taste are often associated with fresh orange juice, and thus it is most commonly used as orange flavoring. It can be produced by the reaction of butanoic acid with ethanol in the presence of an acid catalyst (H+H+): CH3CH2CH2CO2H(l)+CH2CH3OH(l)H+⟶CH3CH2CH2CO2CH2CH3(l)+H2O(l) Part A Given 7.30 gg of butanoic acid and excess ethanol, how many grams of ethyl butyrate would be synthesized, assuming a complete 100%% yield? Express your answer in grams to three significant figures. Part B A chemist ran the reaction and obtained 5.95 gg of ethyl butyrate. What was the percent yield? Express your answer as a percent to three significant figures. Part C The chemist discovers a more efficient catalyst that can produce ethyl butyrate with a 78.0%% yield. How many grams would be produced from 7.30 gg of…
Ethyl butyrate, CH3CH2CH2CO2CH2CH3CH3CH2CH2CO2CH2CH3, is an artificial fruit flavor commonly used in the food industry for such flavors as orange and pineapple. Its fragrance and taste are often associated with fresh orange juice, and thus it is most commonly used as orange flavoring. It can be produced by the reaction of butanoic acid with ethanol in the presence of an acid catalyst (H+H+): CH3CH2CH2CO2H(l)+CH2CH3OH(l)H+⟶CH3CH2CH2CO2CH2CH3(l)+H2O(l) Given 8.45 gg of butanoic acid and excess ethanol, how many grams of ethyl butyrate would be synthesized, assuming a complete 100%% yield? Express your answer in grams to three significant figures. A chemist ran the reaction and obtained 5.50 gg of ethyl butyrate. What was the percent yield? Express your answer as a percent to three significant figures. The chemist discovers a more efficient catalyst that can produce ethyl butyrate with a 78.0%% yield. How many grams would be produced from 8.45 gg of butanoic acid and excess…
Provide the missing reactants and reagents. a is bis c is d is a e is C of ↑ NHCH3 (R,S)-Methamphetamine
c) rite in the reagent(s) over the arrow. a) C6H5N₂+ b) C6H5C=N H3C- An OH H₂C → benzene H3C benzylamine CI CH3
Click the "draw structure" button to launch the drawing utility. Draw the product formed when the following a.f-unsaturated ketone is treated with [1] (CH,-CH),CuLi; [2] H,O. draw structure .
2. What is the product of the following reaction? کہا NaOH, H₂O A
o Predict the two major organic products of the reaction. (HI behaves as an HX reagent.) H₂C ΤΟ + CH3 H—I CH3 Draw the two major organic products. H₂C H H CH₂ CH₂
Give the main organic product for the following reaction: CH2OH OH H3O* CH3CH2CH2OH OH OH
Ethyl butyrate, CH3CH2CH2CO2CH2CH3, is an artificial fruit flavor commonly used in the food industry for such flavors as orange and pineapple. Its fragrance and taste are often associated with fresh orange juice, and thus it is most commonly used as orange flavoring.It can be produced by the reaction of butanoic acid with ethanol in the presence of an acid catalyst (H+): CH3CH2CH2CO2H(l)+CH2CH3OH(l)H+⟶CH3CH2CH2CO2CH2CH3(l)+H2O(l). The chemist discovers a more efficient catalyst that can produce ethyl butyrate with a 78.0% yield. How many grams would be produced from 8.50 gof butanoic acid and excess ethanol? Express your answer in grams to three significant figures.
Ethyl butyrate, CH3CH2CH2CO2CH2CH3, is an artificial fruit flavor commonly used in the food industry for such flavors as orange and pineapple. Its fragrance and taste are often associated with fresh orange juice, and thus it is most commonly used as orange flavoring.It can be produced by the reaction of butanoic acid with ethanol in the presence of an acid catalyst (H+): CH3CH2CH2CO2H(l)+CH2CH3OH(l)H+⟶CH3CH2CH2CO2CH2CH3(l)+H2O(l) Given 8.50 g of butanoic acid and excess ethanol, how many grams of ethyl butyrate would be synthesized, assuming a complete 100%yield? Express your answer in grams to three significant figures.
Draw the structure of the major products if the given compound (Compound A) reacts with BH3:THF, then, H2O2, NaOH
Ethyl butyrate, CH3CH2CH2CO2CH2CH3, is an artificial fruit flavor commonly used in the food industry for such flavors as orange and pineapple. Its fragrance and taste are often associated with fresh orange juice, and thus it is most commonly used as orange flavoring.It can be produced by the reaction of butanoic acid with ethanol in the presence of an acid catalyst (H+): CH3CH2CH2CO2H(l)+CH2CH3OH(l)H+⟶CH3CH2CH2CO2CH2CH3(l)+H2O(l) a) Given 7.70 g of butanoic acid and excess ethanol, how many grams of ethyl butyrate would be synthesized, assuming a complete 100% yield? b) A chemist ran the reaction and obtained 5.25 g of ethyl butyrate. What was the percent yield? c) The chemist discovers a more efficient catalyst that can produce ethyl butyrate with a 78.0% yield. How many grams would be produced from 7.70 g of butanoic acid and excess ethanol?