Ethyl butyrate, CH3CH2CH2CO2CH2CH3, is an artificial fruit flavor commonly used in the food industry for such flavors as orange and pineapple. Its fragrance and taste are often associated with fresh orange juice, and thus it is most commonly used as orange flavoring.It can be produced by the reaction of butanoic acid with ethanol in the presence of an acid catalyst (H+): CH3CH2CH2CO2H(l)+CH2CH3OH(l)H+⟶CH3CH2CH2CO2CH2CH3(l)+H2O(l) Given 8.50 g of butanoic acid and excess ethanol, how many

Research which level or levels of government are responsible for regulations about arsenic

Which one of the following compounds does not have a secondary carbon? cydopentane butane 2-mathylbutane propane ethyl chloride C Which one of the following compounds does not have hydrogen bonding? triethylamine ethanol water diethylamine methanol A C What is the correct IUPAC name of the following compound? 3,3-dibromo-2-sec-butoxy-5-chloro-4ethylhexane B) 4,4 dibromo-2-chloro-3-ethyl-5-isobutaxcyhexane Br Br C) 3,3-dibromo-4-(chloroethyl)-2-isobutoxyhexane D) 4,4-dibromo-5-sec-butoxy-2-chloro-3-ethylhexane E) 3,3-dibromo-5-chloro-4-ethyl-2-isobutoxyhexane Rank the following compounds accordingly: " What is the correct order of decreasing ACIDITY of the following compounds? ( -- FCHCHNH HI ICHŁCOH на E strongest>_ >_>_>_weakest -What is the correct order of decreasing BASICITY of the following compounds?; CHSO,Na NaCl CH,CH,NHNa C CHONA CH0O,Na strongest >_>_>_>_weakest

A therapeutic agent (1) can react with sodium hydroxide to produce two new water soluble products. MeO a) (1) COOH Ph Boil with dilute NaOH solution Product A+ Product B Draw the structures of the two products generated from the reaction.

Q1) What colors are the various forms of polyphenols when they are protonated vs deprotonated? Q2) How does the equilibrium shift when HCl is added to the equilibrium reaction? Q3) Chemically speaking, what causes the color change when sodium hydroxide (NaOH) is added to the system?

c) rite in the reagent(s) over the arrow. a) C6H5N₂+ b) C6H5C=N H3C- An OH H₂C → benzene H3C benzylamine CI CH3

What aldehyde is needed to prepare the carboxylic acid by an oxidation reaction?

Phenylethanol can be oxidised to phenylethanal or phenylethanoic acid, depending on the reagents used (both the alcohol and the aldehyde are of interest for their antimicrobial properties, while the acid is used to treat type II hyperammonemia): A (a) (b) (c) CoH,CH,CHO phenylethanal B C6H5CH₂CH₂OHC₂H₂CH₂CO₂H phenylethanol Suggest reagents (shown as A and B in the scheme above) that could be used to carry out the oxidation of the alcohol to the aldehyde and the acid, respectively. C6H5CH₂- Suggest two other syntheses of phenylethanoic acid, in each case indicating the starting materials and other reagents required, but not giving details of mechanism. One of your proposed syntheses must start with a compound which only contains seven carbon atoms (the acid product contains eight carbon atoms). phenylethanoic acid Phenylethanal can be converted to a hydrate in the presence of aqueous acid, though the position of equilibrium is very far to the left: H H+/H₂O OH C6H5CH₂-C-H OH Explain why…

compound given  are a common organic solvent. From the pair of compounds, select the solvent with the greater solubility in water.

What products are formed when cyclopentanol is oxidized with K2Cr2O7?