In halogen displacement reactions, a halogen element can be generated by oxidizing its anions with a halogen element that lies above it in the periodic table. However, elemental chlorine can be prepared using a number of methods. One technique involves reacting sodium chloride and sulfuric acid with manganese(IV) oxide. Balance the following equation representing the reaction: NaCl + H2SO4 + MnO2 Na,SO4 + MnSO4 + H₂O + Cl, ローロ

In halogen displacement reactions, a halogen element can be generated by oxidizing its anions with a halogen element that lies above it in the periodic table. However, elemental chlorine can be prepared using a number of methods. One technique involves reacting sodium chloride and sulfuric acid with manganese(IV) oxide. Balance the following equation representing the reaction: NaCl + H2SO4 + MnO2 Na,SO4 + MnSO4 + H₂O + Cl, ローロ

Chemistry

10th Edition

ISBN:9781305957404

Author:Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCoste

Publisher:Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCoste

Chapter3: Stoichiometry

Section: Chapter Questions

Problem 100E: Iron oxide ores, commonly a mixture of FeO and Fe2O3, are given the general formula Fe3O4. They...

See similar textbooks

Similar questions

Nitric acid is produced commercially by the Ostwald process, represented by the following equations: 4NH3(g)+5O24NO(g)+6H2O(g)2NO(g)+O2(g)2NO2(g)3NO2(g)+H2O(l)2HNO3(aq)+NO(g) What mass of NH3 must be used to produce 1.0 106 kg HNO3 by the Ostwald process? Assume 100% yield in each reaction, and assume that the NO produced in the third step is not recycled.
Write a balanced equation for (a) the combustion (reaction with oxygen gas) of glucose, C6H12O6, to give carbon dioxide and water. (b) the reaction between xenon tetrafluoride gas and water to give xenon, oxygen, and hydrogen fluoride gases. (c) the reaction between aluminum and iron(III) oxide to give aluminum oxide and iron. (d) the formation of ammonia gas from its elements. (e) the reaction between sodium chloride, sulfur dioxide gas, steam, and oxygen to give sodium sulfate and hydrogen chloride gas.
Iron oxide ores, commonly a mixture of FeO and Fe2O3, are given the general formula Fe3O4. They yield elemental iron when heated to a very high temperature with either carbon monoxide or elemental hydrogen. Balance the following equations for these processes: Fe3O4(s)+H2(g)Fe(s)+H2O(g)Fe3O4(s)+CO(g)Fe(s)+CO2(g)
4.22 Generally, an excess of O2 is needed for the reaction Sn+O2SnO2 . What is the minimum number of moles of oxygen required to oxidize 7.3 moles of tin?
3.14 A number of compounds are used in cement, and reactions among them occur when water is added. In one, CaO reacts with Al2O3 and water to form Ca3Al2(OH)12. Write a bal- anced chemical equation for this process.
Azurite is a copper-containing mineral that often forms beautiful crystals. Its formula is Cu3(CO3)2(OH)2. Write balanced equation for the reaction of this mineral with hydrochloric acid.
Phosphoric acid, H3PO4, can be prepared by the reaction of phosphorus(V) oxide, P4O10, with water. 14P4O10(s)+32H2O(l)H3PO4(aq);H=96.2kJ What is H for the reaction involving 1 mol of P4O10? P4O10(s)+6H2O(l)4H3PO4(aq)
Balance each of the following equations, and then write the net ionic equation. Show states for all reactants and products (s, . g, aq). (a) the reaction of sodium hydroxide and iron(II) chloride to give iron(II) hydroxide and sodium chloride (b) the reaction of barium chloride with sodium carbonate to give barium carbonate and sodium chloride (c) the reaction of ammonia with phosphoric acid