A 2.50 g sample of powdered zinc is added to 100.0 ml.L of a 2.00 M aqueous solution of hydrobromic acid in a calorimeter. The total heat capacity of the calorimeter and solution is 448 J/K. The observed increase in temperature is 21.1 K at a constant pressure of one bar. Calculate the standard enthalpy of reaction using these data. Zn(s) + 2 HBr(aq) ZnBr, (aq) + H,(g) AHan = kJ/mol

A 2.50 g sample of powdered zinc is added to 100.0 ml.L of a 2.00 M aqueous solution of hydrobromic acid in a calorimeter. The total heat capacity of the calorimeter and solution is 448 J/K. The observed increase in temperature is 21.1 K at a constant pressure of one bar. Calculate the standard enthalpy of reaction using these data. Zn(s) + 2 HBr(aq) ZnBr, (aq) + H,(g) AHan = kJ/mol

Chemistry: The Molecular Science

5th Edition

ISBN:9781285199047

Author:John W. Moore, Conrad L. Stanitski

Publisher:John W. Moore, Conrad L. Stanitski

Chapter4: Energy And Chemical Reactions

Section4.8: Measuring Reaction Enthalpies: Calorimetry

Problem 4.17E

See similar textbooks

Similar questions

You did an experiment in which you found that 59.8 J was required to raise the temperature of 25.0 g of ethylene glycol (a compound used as antifreeze in automobile engines) by 1.00 K. Calculate the specific heat capacity of ethylene glycol from these data.
Gasohol, a mixture of gasoline and ethanol, C2H5OH, is used as automobile fuel. The alcohol releases energy in a combustion reaction with O2. C2H5OH(l)+3O2(g)2CO2(g)+3H2O(l) If 0.115 g ethanol evolves 3.62 kJ when burned at constant pressure, calculate the combustion enthalpy for ethanol.
Under what circumstances is the heat of a process equal to the enthalpy change for the process?
In a coffee-cup calorimeter, 150.0 mL of 0.50 M HCI is added to 50.0 mL of 1.00 M NaOH to make 200.0 g solution at an initial temperature of 48.2C. If the enthalpy of neutralization for the reaction between a strong acid and a strong base is 56 kJ/mol, calculate the final temperature of the calorimeter contents. Assume the specific heat capacity of the solution is 4.184 J/g C and assume no heat Joss to the surroundings.
The enthalpy change for the following reaction is 393.5 kJ. C(s,graphite)+O2(g)CO2(g) (a) Is energy released from or absorbed by the system in this reaction? (b) What quantities of reactants and products are assumed? (c) Predict the enthalpy change observed when 3.00 g carbon burns in an excess of oxygen.
In a coffee-cup calorimeter, 50.0 mL of 0.100 M AgNO3 and 50.0 mL of 0.100 M HCl are mixed to yield the following reaction: Ag+(aq)+Cl(aq)AgCl(s) The two solutions were initially at 22.60C, and the final temperature is 23.40C Calculate the heat that accompanies this reaction in kJ/mol of AgCl formed. Assume that the combined solution has a mass of 100.0 g and a specific heat capacity of 4.18J/Cg.
White phosphorus, P4, ignites in air to produce P4O10. When 3.56 g P4 is burned, 85.8 kJ of thermal energy is evolved at constant pressure. Calculate the combustion enthalpy of P4.