Chemistry: A Molecular Approach
3rd Edition
ISBN: 9780321809247
Author: Nivaldo J. Tro
Publisher: Prentice Hall
expand_more
expand_more
format_list_bulleted
Concept explainers
Textbook Question
Chapter 9, Problem 83E
Hydrogen, a potential future fuel, canbeproducedfromcarbon(from coal) and steam by this reaction:
C(s) + 2 H2O(g)→H2(g)+ CO2(g)
Use average bond energies to calculate ΔHrxn for the reaction.
Expert Solution & Answer
Want to see the full answer?
Check out a sample textbook solutionChapter 9 Solutions
Chemistry: A Molecular Approach
Ch. 9 - Prob. 1SAQCh. 9 - Q2. Which set of elements is arranged in order of...Ch. 9 - Q3. Which is the correct Lewis structure for...Ch. 9 - Q4. Which compound is likely to have an incomplete...Ch. 9 - Q5. Which compound has the highest magnitude of...Ch. 9 - Prob. 6SAQCh. 9 - Prob. 7SAQCh. 9 - Prob. 8SAQCh. 9 - Prob. 9SAQCh. 9 - Prob. 10SAQ
Ch. 9 - Q11. Determine the formal charge of nitrogen in...Ch. 9 - Q12. A Lewis structure for the acetate ion is...Ch. 9 - Q13. Use formal charge to choose the best Lewis...Ch. 9 - Prob. 14SAQCh. 9 - Prob. 15SAQCh. 9 - Prob. 1ECh. 9 - Prob. 2ECh. 9 - Prob. 3ECh. 9 - Prob. 4ECh. 9 - 5. Describe the octet rule in the Lewis model.
Ch. 9 - 6. According to the Lewis model, what is a...Ch. 9 - 7. How do you draw an ionic Lewis structure?
Ch. 9 - 8. How can Lewis structures be used to determine...Ch. 9 - Prob. 9ECh. 9 - Prob. 10ECh. 9 - Prob. 11ECh. 9 - Prob. 12ECh. 9 - Prob. 13ECh. 9 - Prob. 14ECh. 9 - 15. In a covalent Lewis structure, what is the...Ch. 9 - Prob. 16ECh. 9 - 17. How does the Lewis model for covalent bonding...Ch. 9 - 18. How does the Lewis model for covalent bonding...Ch. 9 - 19. What is electronegativity? What are the...Ch. 9 - Prob. 20ECh. 9 - 21. Explain percent ionic character of a bond. Do...Ch. 9 - 22. What is a dipole moment?
Ch. 9 - Prob. 23ECh. 9 - Prob. 24ECh. 9 - Prob. 25ECh. 9 - 26. What are resonance structures? What is a...Ch. 9 - 27. Do resonance structures always contribute...Ch. 9 - 28. What is formal charge? How is formal charge...Ch. 9 - 29. Why does the octet rule have exceptions? List...Ch. 9 - 30. Which elements can have expanded octets? Which...Ch. 9 - Prob. 31ECh. 9 - Prob. 32ECh. 9 - 33. What is the electron sea model for bonding in...Ch. 9 - Prob. 34ECh. 9 - 35. Write the electron configuration for N. Then...Ch. 9 - 36. Write the electron configuration for Ne. Then...Ch. 9 - 37. Write the Lewis symbol for each atom or...Ch. 9 - 38. Write the Lewis symbol for each atom or...Ch. 9 - 39. Write the Lewis symbols for the ions in each...Ch. 9 - 40. Write the Lewis symbols for the ions in each...Ch. 9 - 41. Use Lewis symbols to determine the formula for...Ch. 9 - 42. Use Lewis symbols to determine the formula for...Ch. 9 - 43. Explain the trend in the lattice energies of...Ch. 9 - 44. Rubidium iodide has a lattice energy of –617...Ch. 9 - Prob. 45ECh. 9 - 46. Arrange these compounds in order of increasing...Ch. 9 - 47. Use the Born–Haber cycle and data from...Ch. 9 - 48. Use the Born–Haber cycle and data from...Ch. 9 - 49. Use covalent Lewis structures to explain why...Ch. 9 - 50. Use covalent Lewis structures to explain why...Ch. 9 - 51. Write the Lewis structure for each...Ch. 9 - Prob. 52ECh. 9 - 53. Write the Lewis structure for each...Ch. 9 - 54. Write the Lewis structure for each...Ch. 9 - 55. Determine if a bond between each pair of atoms...Ch. 9 - 56. Determine if a bond between each pair of atoms...Ch. 9 - 57. Draw the Lewis structure for CO with an arrow...Ch. 9 - 58. Draw the Lewis structure for BrF with an arrow...Ch. 9 - 59. Write the Lewis structure for each molecule or...Ch. 9 - 60. Write the Lewis structure for each molecule or...Ch. 9 - 61. Write the Lewis structure for each molecule or...Ch. 9 - 62. Write the Lewis structure for each molecule or...Ch. 9 - 63. Write a Lewis structure that obeys the octet...Ch. 9 - 64. Write a Lewis structure that obeys the octet...Ch. 9 - 65. Use formal charge to identify the better Lewis...Ch. 9 - 66. Use formal charges to identify the better...Ch. 9 - 67. How important is the resonance structure shown...Ch. 9 - 68. In N2O, nitrogen is the central atom and the...Ch. 9 - 69. Draw the Lewis structure (including resonance...Ch. 9 - 70. Draw the Lewis structure (including resonance...Ch. 9 - 71. What are the formal charges of the atoms shown...Ch. 9 - 72. What are the formal charges of the atoms shown...Ch. 9 - 73. Write the Lewis structure for each molecule...Ch. 9 - 74. Write the Lewis structure for each molecule...Ch. 9 - 75. Write the Lewis structure for each ion....Ch. 9 - 76. Write Lewis structures for each molecule or...Ch. 9 - 77. Write Lewis structures for each molecule or...Ch. 9 - 78. Write Lewis structures for each molecule or...Ch. 9 - 79. Order these compounds in order of increasing...Ch. 9 - 80. Which compound shown here has the stronger...Ch. 9 - 81. Hydrogenation reactions are used to add...Ch. 9 - 82. Ethanol is a possible fuel. Use average bond...Ch. 9 - 83. Hydrogen, a potential future fuel, can be...Ch. 9 - 84. In the Chemistry and the Environment box on...Ch. 9 - 85. Write an appropriate Lewis structure for each...Ch. 9 - 86. Write an appropriate Lewis structure for each...Ch. 9 - 87. Each compound contains both ionic and covalent...Ch. 9 - 88. Each compound contains both ionic and covalent...Ch. 9 - 89. Carbon ring structures are common in organic...Ch. 9 - 90. Amino acids are the building blocks of...Ch. 9 - 91. Formic acid is responsible for the sting of...Ch. 9 - 92. Diazomethane is a highly poisonous, explosive...Ch. 9 - 93. The reaction of Fe2O3(s) with Al(s) to form...Ch. 9 - Prob. 94ECh. 9 - 95. Draw the Lewis structure for nitric acid (the...Ch. 9 - 96. Phosgene (Cl2CO) is a poisonous gas used as a...Ch. 9 - 97. The cyanate ion (OCN–) and the fulminate ion...Ch. 9 - Prob. 98ECh. 9 - Prob. 99ECh. 9 - 100. Use Lewis structures to explain why Br3– and...Ch. 9 - 101. Draw the Lewis structure for HCSNH2. (The...Ch. 9 - 102. Draw the Lewis structure for urea, H2NCONH2,...Ch. 9 - 103. Some theories of aging suggest that free...Ch. 9 - 104. Free radicals are important in many...Ch. 9 - Prob. 105ECh. 9 - 106. Calculate ΔHrxn for the combustion of octane...Ch. 9 - 107. Draw the Lewis structure for each...Ch. 9 - Prob. 108ECh. 9 - Prob. 109ECh. 9 - 110. Calculate for the reaction using the bond...Ch. 9 - Prob. 111ECh. 9 - Prob. 112ECh. 9 - 113. A compound composed of only carbon and...Ch. 9 - Prob. 114ECh. 9 - 115. The main component of acid rain (H2SO4) forms...Ch. 9 - 116. A 0.167-g sample of an unknown acid requires...Ch. 9 - Prob. 117ECh. 9 - Prob. 118ECh. 9 - Prob. 119ECh. 9 - 120. The standard heat of formation of CaBr2 is...Ch. 9 - Prob. 121ECh. 9 - Prob. 122ECh. 9 - Prob. 123ECh. 9 - Prob. 124ECh. 9 - Prob. 125ECh. 9 - 126. Which statement is true of an endothermic...Ch. 9 - Prob. 127ECh. 9 - Prob. 128ECh. 9 - Prob. 129E
Knowledge Booster
Learn more about
Need a deep-dive on the concept behind this application? Look no further. Learn more about this topic, chemistry and related others by exploring similar questions and additional content below.Similar questions
- The bond energy for a CH bond is about 413 kJ/mol in CH4 but 380 kJ/mol in CHBr3. Although these values are relatively close in magnitude, they are different. Explain why they are different. Does the fact that the bond energy is lower in CHBr3, make any sense? Why?arrow_forwardGiven the following data: NO2(g) NO(g) + O(g)H = 233 kJ 2O3(g) 3O2(g)H = 427 kJ NO(g) + O3(g) NO2(g) + O2(g)H = 199 kJ Calculate the bond energy for the O2 bond, that is, calculate H for: O2(g) 2O(g)H = ?arrow_forwardThe thermochemical equation for the burning of methane, the main component of natural gas, is CH4(g)+2O2(g)CO2(g)+2H2O(l)H=890kJ (a) Is this reaction endothermic or exothermic? (b) What quantities of reactants and products are assumed if H = 890 kJ? (c) What is the enthalpy change when 1.00 g methane burns in an excess of oxygen?arrow_forward
- The first step in the preparation of lead from its ore (galena, PbS) consists of roasting the ore. PbS(s)+32O2(g)SO2(g)+PbO(s) Calculate the standard enthalpy change for this reaction, using enthalpies of formation (see Appendix C).arrow_forwardEstimate H for the following reactions using bond energies given in Table 8.5. 3CH2=CH2(g) + 3H2(g) 3CH2CH3(g) The enthalpies of formation for C6H6(g) and C6H12 (g) are 82.9 and 90.3 kJ/mol. respectively. Calculate H for the two reactions using standard enthalpies of formation from Appendix 4. Account for any differences between the results obtained from the two methods.arrow_forwardFor the reaction HgO(s)Hg(l)+12O2(g),H=+90.7kJ: a.What quantity of heat is required to produce 1 mole of mercury by this reaction? b.What quantity of heat is required to produce 1 mole of oxygen gas by this reaction? c.What quantity of heat would be released in the following reaction as written? 2Hg(l) + O2(g) 2HgO(s)arrow_forward
arrow_back_ios
arrow_forward_ios
Recommended textbooks for you
- Chemistry: Matter and ChangeChemistryISBN:9780078746376Author:Dinah Zike, Laurel Dingrando, Nicholas Hainen, Cheryl WistromPublisher:Glencoe/McGraw-Hill School Pub CoChemistry & Chemical ReactivityChemistryISBN:9781337399074Author:John C. Kotz, Paul M. Treichel, John Townsend, David TreichelPublisher:Cengage LearningChemistry & Chemical ReactivityChemistryISBN:9781133949640Author:John C. Kotz, Paul M. Treichel, John Townsend, David TreichelPublisher:Cengage Learning
- ChemistryChemistryISBN:9781305957404Author:Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCostePublisher:Cengage LearningChemistry by OpenStax (2015-05-04)ChemistryISBN:9781938168390Author:Klaus Theopold, Richard H Langley, Paul Flowers, William R. Robinson, Mark BlaserPublisher:OpenStax
Chemistry: Matter and Change
Chemistry
ISBN:9780078746376
Author:Dinah Zike, Laurel Dingrando, Nicholas Hainen, Cheryl Wistrom
Publisher:Glencoe/McGraw-Hill School Pub Co
Chemistry & Chemical Reactivity
Chemistry
ISBN:9781337399074
Author:John C. Kotz, Paul M. Treichel, John Townsend, David Treichel
Publisher:Cengage Learning
Chemistry & Chemical Reactivity
Chemistry
ISBN:9781133949640
Author:John C. Kotz, Paul M. Treichel, John Townsend, David Treichel
Publisher:Cengage Learning
Chemistry
Chemistry
ISBN:9781305957404
Author:Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCoste
Publisher:Cengage Learning
Chemistry by OpenStax (2015-05-04)
Chemistry
ISBN:9781938168390
Author:Klaus Theopold, Richard H Langley, Paul Flowers, William R. Robinson, Mark Blaser
Publisher:OpenStax
Calorimetry Concept, Examples and Thermochemistry | How to Pass Chemistry; Author: Melissa Maribel;https://www.youtube.com/watch?v=nSh29lUGj00;License: Standard YouTube License, CC-BY