Concept explainers
Interpretation:
The enthalpy change for the reaction on molar basis is to be determined.
Concept introduction:
Heat absorbed or released in the reaction is given by the expression as follows:
Here,
Specific heat is the heat required to increase the temperature of
Heat absorbed or released in the reaction is calculated by the expression as follows:
Here,
Heat capacity is defined as the heat required to increase the temperature of a body by
Concentration (molarity) of a solution is given by the expression as follows:
Here,
Want to see the full answer?
Check out a sample textbook solutionChapter 5 Solutions
Chemistry
- In a coffee-cup calorimeter, 150.0 mL of 0.50 M HCI is added to 50.0 mL of 1.00 M NaOH to make 200.0 g solution at an initial temperature of 48.2C. If the enthalpy of neutralization for the reaction between a strong acid and a strong base is 56 kJ/mol, calculate the final temperature of the calorimeter contents. Assume the specific heat capacity of the solution is 4.184 J/g C and assume no heat Joss to the surroundings.arrow_forwardA 50-mL solution of a dilute AgNO3 solution is added to 100 mL of a base solution in a coffee-cup calorimeter. As Ag2O(s) precipitates, the temperature of the solution increases from 23.78 C to 25.19 C. Assuming that the mixture has the same specific heat as water and a mass of 150 g, calculate the heat q. Is the precipitation reaction exothermic or endothermic?arrow_forwardGasohol, a mixture of gasoline and ethanol, C2H5OH, is used as automobile fuel. The alcohol releases energy in a combustion reaction with O2. C2H5OH(l)+3O2(g)2CO2(g)+3H2O(l) If 0.115 g ethanol evolves 3.62 kJ when burned at constant pressure, calculate the combustion enthalpy for ethanol.arrow_forward
- An industrial process for manufacturing sulfuric acid, H2SO4, uses hydrogen sulfide, H2S, from the purification of natural gas. In the first step of this process, the hydrogen sulfide is burned to obtain sulfur dioxide, SO2. 2H2S(g)+3O2(g)2H2O(l)+2SO2(g);H=1124kJ The density of sulfur dioxide at 25C and 1.00 atm is 2.62 g/L, and the molar heat capacity is 30.2 J/(mol C). (a) How much heat would be evolved in producing 1.00 L of SO2 at 25C and 1.00 atm? (b) Suppose heat from this reaction is used to heat 1.00 L of the SO2 from 25C to 500C for its use in the next step of the process. What percentage of the heat evolved is required for this?arrow_forwardWhen solid iron burns in oxygen gas (at constant pressure) to produce Fe2O3(s), 1651 kJ of heat is released for every 4 mol of iron burned. How much heat is released when 10.3 g Fe2O3(s) is produced (at constant pressure)? What additional information would you need to calculate the heat released to produce this much Fe2O3(s) if you burned iron in ozone gas, O3(g), instead of O2(g)?arrow_forwardA 21.3-mL sample of 0.977 M NaOH is mixed with 29.5 mL of 0.918 M HCl in a coffee-cup calorimeter (see Section 6.6 of your text for a description of a coffee-cup calorimeter). The enthalpy of the reaction, written with the lowest whole-number coefficients, is 55.8 kJ. Both solutions are at 19.6C prior to mixing and reacting. What is the final temperature of the reaction mixture? When solving this problem, assume that no heat is lost from the calorimeter to the surroundings, the density of all solutions is 1.00 g/mL, the specific heat of all solutions is the same as that of water, and volumes are additive.arrow_forward
- Give the definition of the standard enthalpy of formation for a substance. Write separate reactions for the formation of NaCl, H2O , C6H12O6, and PbSO4 that have H values equal to Hf for each compound.arrow_forwardConsider the reaction 2HCl(aq)+Ba(OH)2(aq)BaCl2(aq)+2H2O(l)H=118KJ Calculate the heat when 100.0 rnL of 0.500 M HCl is mixed with 300.0 mL of 0.100 M Ba(OH)2 Assuming that the temperature of both solutions was initially 25.0C and that the final mixture has a mass of 400.0 g and a specific heat capacity of 4.18 J/C g, calculate the final temperature of the mixture.arrow_forward9.41 Under what conditions does the enthalpy change equal the heat of a process?arrow_forward
- A 0.470-g sample of magnesium reacts with 200 g dilute HCl in a coffee-cup calorimeter to form MgCl2(aq) and H2(g). The temperature increases by 10.9 C as the magnesium reacts. Assume that the mixture has the same specific heat as water and a mass of 200 g. (a) Calculate the enthalpy change for the reaction. Is the process exothermic or endothermic? (b) Write the chemical equation and evaluate H.arrow_forwardUnder what circumstances is the heat of a process equal to the enthalpy change for the process?arrow_forwardThe enthalpy change for the following reaction is 393.5 kJ. C(s,graphite)+O2(g)CO2(g) (a) Is energy released from or absorbed by the system in this reaction? (b) What quantities of reactants and products are assumed? (c) Predict the enthalpy change observed when 3.00 g carbon burns in an excess of oxygen.arrow_forward
- Chemistry & Chemical ReactivityChemistryISBN:9781337399074Author:John C. Kotz, Paul M. Treichel, John Townsend, David TreichelPublisher:Cengage LearningChemistry by OpenStax (2015-05-04)ChemistryISBN:9781938168390Author:Klaus Theopold, Richard H Langley, Paul Flowers, William R. Robinson, Mark BlaserPublisher:OpenStaxChemistry: An Atoms First ApproachChemistryISBN:9781305079243Author:Steven S. Zumdahl, Susan A. ZumdahlPublisher:Cengage Learning
- Chemistry: The Molecular ScienceChemistryISBN:9781285199047Author:John W. Moore, Conrad L. StanitskiPublisher:Cengage LearningChemistry: Principles and PracticeChemistryISBN:9780534420123Author:Daniel L. Reger, Scott R. Goode, David W. Ball, Edward MercerPublisher:Cengage LearningGeneral Chemistry - Standalone book (MindTap Cour...ChemistryISBN:9781305580343Author:Steven D. Gammon, Ebbing, Darrell Ebbing, Steven D., Darrell; Gammon, Darrell Ebbing; Steven D. Gammon, Darrell D.; Gammon, Ebbing; Steven D. Gammon; DarrellPublisher:Cengage Learning