Problem 1RQ: Characterize a system at chemical equilibrium with respect to each of the following a. the rates of... Problem 2RQ: What is the law of mass action? Is it true that the value of K depends on the amounts of reactants... Problem 3RQ Problem 4RQ Problem 5RQ Problem 6RQ: Distinguish between the terms equilibrium constant and reaction quotient. When Q = K, what does this... Problem 7RQ: Summarize the steps for solving equilibrium problems (see the beginning of Section 12-6). In... Problem 8RQ Problem 9RQ: What is Le Chteliers principle? Consider the reaction 2NOCI(g)2NO(g)+Cl2(g) If this reaction is at... Problem 10RQ Problem 1ALQ: Consider an equilibrium mixture of four chemicals (A, B, C, and D, all gases) reacting in a closed... Problem 2ALQ: The boxes shown below represent a set of initial conditions for the reaction: Draw a quantitative... Problem 3ALQ: For the reactionH2(g)+I2(g)2HI(g), consider two possibilities: (a) you mix 0.5 mole of each... Problem 4ALQ Problem 5ALQ: Consider the reaction A(g)+2B(g)C(g)+D(g) in a 1.0-L rigid flask. Answer the following questions for... Problem 6ALQ: Consider the reactionA(g)+B(g)C(g)+D(g). A friend asks the following: I know we have been told that... Problem 7ALQ Problem 8ALQ Problem 9ALQ Problem 10Q Problem 11Q: Consider the following reaction: H2O(g)+CO(g)H2(g)+CO2(g) Amounts of H2O, CO, H2, and CO2 are put... Problem 12Q Problem 13Q: Suppose a reaction has the equilibrium constant K = 1.3 108. What does the magnitude of this... Problem 14Q Problem 15Q: Consider the following reaction at some temperature: H2O(g)+CO(g)H2(g)+CO2(g)K=2.0 Some molecules of... Problem 16Q Problem 17Q Problem 18Q Problem 19Q: For a typical equilibrium problem, the value of K and the initial reaction conditions are given for... Problem 20Q Problem 21E: Write the equilibrium expression (K) for each of the following gas-phase reactions. a.... Problem 22E: Write the equilibrium expression (Kp) for each reaction in Exercise 21. Problem 23E Problem 24E: For the reaction H2(g)+Br2(g)2HBr(g) Kp = 3.5 104 at 1495 K. What is the value of Kp for the... Problem 25E Problem 26E: At high temperatures, elemental nitrogen and oxygen react with each other to form nitrogen monoxide:... Problem 27E: At a particular temperature, a 3.0-L flask contains 2.4 moles of Cl2, l.0 mole of NOCI, and 4.5 103... Problem 28E: At a particular temperature a 2.00-L flask at equilibrium contains 2.80 104 mole of N2, 2.50 105... Problem 29E Problem 30E Problem 31E Problem 32E Problem 33E Problem 34E: Write expressions for Kp for the following reactions. a. 2Fe(S)+32O2(g)Fe2O3(S) b.... Problem 35E Problem 36E Problem 37E Problem 38E: In a study of the reaction 3Fe(s)+4H2O(g)Fe3O4(s)+4H2(g) at 1200 K it was observed that when the... Problem 39E: The equilibrium constant is 0.0900 at 25C for the reaction H2O(g)+Cl2O(g)2HOCl(g) For which of the... Problem 40E: The equilibrium constant is 0.0900 at 25C for the reaction H2O(g)+Cl2O(g)2HOCl(g) For which of the... Problem 41E: At 900c, Kp = 1.04 for the reaction CaCO3(s)CaO(s)+CO2(g) At a low temperature, dry ice (solid CO2),... Problem 42E: Ethyl acetate is synthesized in a nonreacting solvent (not water) according to the following... Problem 43E: For the reaction 2H2O(g)2H2(g)+O2(g) K = 2.4 103 at a given temperature. At equilibrium in a 2.0-L... Problem 44E: The reaction 2NO(g)+Br2(g)2NOBr(g) has Kp = 109 at 25C. If the equilibrium partial pressure of Br2... Problem 45E: A 1.00-L flask was filled with 2.00 moles of gaseous SO2 and 2.00 moles of gaseous NO2 and heated.... Problem 46E Problem 47E Problem 48E Problem 49E Problem 50E: Nitrogen gas (N2) reacts with hydrogen gas (H2) to form ammonia (NH3). At 200C in a closed... Problem 51E Problem 52E Problem 53E Problem 54E: At 25c, K = 0.090 for the reaction H2O(g)+Cl2O(g)2HOCI(g) Calculate the concentrations of all... Problem 55E Problem 56E Problem 57E Problem 58E: At o particular temperature, K = 4 .0 107 for the reaction N2O4(g)2NO2(g) In an experiment, 1.0... Problem 59E Problem 60E: Lexan is a plastic used to make compact discs, eyeglass lenses, and bulletproof glass. One of the... Problem 61E: At 25C, Kp. = 2.9 103 for the reaction NH4OCONH2(s)2NH3(g)+CO2(g) In an experiment carried out at... Problem 62E: A sample of solid ammonium chloride was placed in an evacuated container and then heated so that it... Problem 63E Problem 64E: Predict the shift in the equilibrium position that will occur for each of the following reactions... Problem 65E: An important reaction in the commercial production of hydrogen is CO(g)+H2O(g)H2(g)+CO2(g) How will... Problem 66E: What will happen to the number of moles of SO3 in equilibrium with SO2 and O2 in the reaction... Problem 67E Problem 68E: Hydrogen for use in ammonia production is produced by the reaction... Problem 69E: Old-fashioned smelling salts consist of ammonium carbonate, (NH4)2CO3. The reaction for the... Problem 70E: Ammonia is produced by the Haber process, in which nitrogen and hydrogen are reacted directly using... Problem 71AE Problem 72AE: Given the following equilibrium constants at 427C,... Problem 73AE: Consider the decomposition of the compound C5H6O3 as follows: C5H6O3(g)C2H6(g)+3CO(g) When a 5.63-g... Problem 74AE Problem 75AE: The gas arsine, AsH3, decomposes as follows: 2AsH3(g)2As(s)+3H2(g) In an experiment at a certain... Problem 76AE: At a certain temperature, K = 9.1 10-4 for the reaction FeSCN2+(aq)Fe3+(aq)+SCN(aq) Calculate the... Problem 77AE: At a certain temperature, K = 1.1 l03 for the reaction Fe3+(aq)+SCN(aq)FeSCN2+(aq) Calculate the... Problem 78AE Problem 79AE: At 25C, gaseous SO2Cl2 decomposes to SO2(g) and Cl2(g) to the extent that 12.5% of the original... Problem 80AE: For the following reaction at a certain temperature H2(g)+F2(g)2HF(g) it is found that the... Problem 81AE Problem 82AE: Consider the reaction Fe3+(aq)+SCN(aq)FeSCN2+(aq) How will the equilibrium position shift if a.... Problem 83AE: Chromium(VI) forms two different oxyanions, the orange dichromate ion, Cr2O72 , and the yellow... Problem 84AE Problem 85AE Problem 86AE: For the reaction below, Kp = 1.16 at 800C. CaCO3(s)CaO(s)+CO2(g) If a 20.0-g sample of CaCO3 is put... Problem 87AE: Many sugars undergo a process called mutarotation, in which the sugar molecules interconvert between... Problem 88AE: Peptide decomposition is one of the key processes of digestion, where a peptide bond is broken into... Problem 89AE: The creation of shells by mollusk species is a fascinating process. By utilizing the Ca2+ in their... Problem 90AE: Methanol, a common laboratory solvent, poses a threat of blindness or death if consumed in... Problem 91CWP Problem 92CWP Problem 93CWP Problem 94CWP Problem 95CWP Problem 96CWP Problem 97CWP: Consider the following exothermic reaction at equilibrium: N2(g)+2H2(g)2NH3(g) Predict how the... Problem 98CWP: For the following endothermic reaction at equilibrium: 2SO3(g)2SO2(g)+O2(g) which of the following... Problem 99CP Problem 100CP: A 4.72-g sample of methanol (CH3OH) was placed in an otherwise empty 1.00-L flask and heated to... Problem 101CP: At 35C, K = 1.6 105 for the reaction 2NOCl(g)2NO(g)+Cl2(g) If 2.0 moles of NO and 1.0 mole of Cl2... Problem 102CP: Nitric oxide and bromine at initial partial pressures of 98.4 and 41.3 torr, respectively, were... Problem 103CP: At 25C. Kp = 5.3 105 for the reaction N2(g)+3H2(g)2NH3(g) When a certain partial pressure of NH3(g)... Problem 104CP Problem 105CP: The partial pressures of an equilibrium mixture of N2O4(g) and NO2(g) are PN2O4=0.34 atm and... Problem 106CP: At 125C, KP = 0.25 for the reaction 2NaHCO3(s)Na2CO3(s)+CO2(g)+H2O(g) A 1.00-L flask containing 10.0... Problem 107CP: A mixture of N2, H2, and NH3 is at equilibrium [according to the equationN2(g)+3H2(g)2NH3(g)] as... Problem 108CP Problem 109CP Problem 110CP Problem 111CP Problem 112CP: A sample of N2O4(g) is placed in an empty cylinder at 25c. After equilibrium is reached the total... Problem 113CP: A sample of gaseous nitrosyl bromide (NOBr) was placed in a container tiued with a frictionless,... Problem 114CP Problem 115IP: For the reaction NH3(g)+H2S(g)NH4HS(s) K = 400. at 35.0C. If 2.00 moles each of NH3, H2S, and NH4HS... Problem 116IP Problem 117IP: In a solution with carbon tetrachloride as the solvent, the compound VCl4. undergoes dimerization:... Problem 118IP Problem 119MP: A gaseous material XY(g) dissociates to some extent to produce X(g) and Y(g): XY(g)X(g)+Y(g) A... format_list_bulleted