Concept explainers
10.101 Fluorine reacts with liquid water to form gaseous hydrogen fluoride and oxygen. (a) Write a balanced chemical equation for this reaction. (b) Use tabulated data to determine the free energy change for the reaction and comment on its spontaneity. (c) Use tabulated data to calculate the enthalpy change of the reaction. (d) Determine how much heat flows and in what direction when 34.5 g of fluorine gas is bubbled through excess water.
Interpretation:
Fluorine reacts with liquid water to form HF and Oxygen gas. The feasibility of this reaction can be identified by using free energy change. The free energy change, enthalpy change and entropy change can be calculated by using standard data.
Concept introduction: The free energy change of the reaction
If the sign of the free energy change is negative, it indicates that the reaction is spontaneous.
Answer to Problem 10.101PAE
Solution: a) The balanced equation is
b)
c)
d) The amount of heat produced by 34.5 g of F2 = 233 kJ
Given: From the standard data −
Explanation of Solution
a)
The balanced chemical equation of the given reaction is as follows.
b) From the standard data −
c)
From the standard data −
d)
From the balanced equation, 2 mols
Therefore, the amount of heat produced by 34.5 g of Fluorine
The reaction is non-spontaneous as the sign of the free energy change is negative. The enthalpy change is negative and indicates that the reaction is an exothermic reaction.
Want to see more full solutions like this?
Chapter 10 Solutions
Bundle: Chemistry for Engineering Students, 3rd, Loose-Leaf + OWLv2 with QuickPrep 24-Months Printed Access Card
- 9.47 If 14.8 kJ of heat is given off when 1.6 g of HCl condenses from vapor to liquid, what is Hcond for this substance?arrow_forwardWould the amount of heat absorbed by the dissolution in Example 5.6 appear greater, lesser, or remain the same if the heat capacity of the calorimeter were taken into account? Explain your answer.arrow_forwardHow much heat is produced by combustion of 125 g of methanol under standard state conditions?arrow_forward
- n Section 10.7, two characteristics of enthalpy changes for reactions are listed. What are these characteristics? Explain why these characteristics are true.arrow_forwardUnder what circumstances is the heat of a process equal to the enthalpy change for the process?arrow_forwardThe reaction SO3(g)+H2O(l)H2SO4(aq) is the last step in the commercial production of sulfuric acid. The enthalpy change for this reaction is 227 kJ. In designing a sulfuric acid plant, is it necessary to provide for heating or cooling of the reaction mixture? Explain.arrow_forward
- Given the following reactions, N2H4(l)+O2(g)N2(g)+2H2O(g)H=534.2kJ H2(g)+12 O2(g)H2O(g)H=241.8kJ Calculate the heat of formation of hydrazine.arrow_forwardDoes the standard enthalpy of formation of H2O(g) differ from H for the reaction 2H2(g)+O2(g)2H2O(g)?arrow_forwardGiven the following thermochemical equations: 4B(s)+3O2(g)2B2O3(s)H=2543.8kJ H2(g)+12 O2(g)H2O(g)H=241.8kJ B2H6(s)+3O2B2O3(s)+3H2O(g)H=2032.9kJ Calculate H for the decomposition of B2H6 into its elements.arrow_forward
- ChemistryChemistryISBN:9781305957404Author:Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCostePublisher:Cengage LearningChemistry: An Atoms First ApproachChemistryISBN:9781305079243Author:Steven S. Zumdahl, Susan A. ZumdahlPublisher:Cengage Learning
- Chemistry for Engineering StudentsChemistryISBN:9781337398909Author:Lawrence S. Brown, Tom HolmePublisher:Cengage LearningChemistry: Matter and ChangeChemistryISBN:9780078746376Author:Dinah Zike, Laurel Dingrando, Nicholas Hainen, Cheryl WistromPublisher:Glencoe/McGraw-Hill School Pub CoPhysical ChemistryChemistryISBN:9781133958437Author:Ball, David W. (david Warren), BAER, TomasPublisher:Wadsworth Cengage Learning,