Write the balanced chemical equations for the following reactions: 1. Aqueous aluminum nitrate reacts with aqueous sodium hydroxide to formaqueous aluminum hydroxide and aqueous sodium nitrate.2 Iron reacts with sulfuric acid to produce iron (III) sulfate and hydrogen gas.

The chemical equation (balanced) for the first reaction is shown below, Al(NO3)3(aq) + NaOH(aq)…

Answered: Write the balanced chemical equations…

Science

Chemistry

Write the balanced chemical equations for the following reactions:

Chemistry: Matter and Change

1st Edition

ISBN:9780078746376

Author:Dinah Zike, Laurel Dingrando, Nicholas Hainen, Cheryl Wistrom

Publisher:Dinah Zike, Laurel Dingrando, Nicholas Hainen, Cheryl Wistrom

Chapter9: Chemical Reactions

Section9.3: Reactions In Aqueous Solutions

Problem 46PP

See similar textbooks

Related questions

Q: Write balanced chemical equation based on the following description: Solid sulfur and oxygen gas…

A: Balance equation for The given description is given below.

Q: Write a balanced chemical equation for the reaction that occurswhen (a) titanium metal reacts with…

Q: Sodium metal (Na(s)) reacts exothermically with water to produce a basic solution of sodium…

A: A chemical equation is defined as the symbolic representation of the chemical reaction which is…

Q: Predict the reactants or products of the following reactions, and balance the equations.

A: Balanced chemical equation; balance chemical equation can be defined as the reaction in which number…

Q: Aqueous solutions of magnesium nitrate and sodium phosphate are mixed together, forming solid…

A: According to the Law of conservation of mass " all atoms of different elements must be equal on both…

Q: Balance the following equation by algebraic method. Fe O2 Fe,O LL.

Q: Write a balanced chemical equation based on the following description: butanoic acid, C,H;COOH(I)…

A: completely

Q: Write the correct net ionic equation for the reaction of potassium carbonate with copper(II)…

A: The reaction between Potassium carbonate and copper(II) chloride can be given as below,

Q: Hydrogen gas and aqueous sodium hydroxide (NaOH) are produced by the reaction of solid sodium and…

A: Given: Formation of aqueous sodium hydroxide and hydrogen gas from solid sodium and liquid water To…

Q: Balance the following chemical equation (if necessary): C,H,,(g) + 0,(g) → H¸O(g) + CO,(g)

A: Given chemical equation, C5H10(g) + O2(g) → H2O(g) + CO2(g)

Q: Write a balanced chemical equation based on the following description: solid C,HO is burned with…

A: Given: Solid C4H10O is burned with oxygen gas to produce gaseous carbon dioxide and water vapor.

Q: Metals react with oxygen to give oxides with the general formula MxOy. Write a balanced chemical…

Q: What would be the net ionic equation?

Q: Write a balanced chemical equation based on the following description: tin metal reacts with oxygen…

A: A reaction is said to be balanced if there are equal number of atoms on both sides of the reaction.…

Q: Write the balanced chemical equation for the chemical reaction that occurs when Sulfuric Acid is…

A: Precipitate does not dissolve in water so precipitate can not make ions.

Q: When AgNO3 (aq) reacts with K3PO4 (aq), what will be the chemical formula of the precipitate?

A: Given :- AgNO3(aq) + K3PO4(aq) → To determine :- The chemical formula of precipitate formed in…

Q: Complete and balance the following combustion reaction . Assume that each hydrocarbon is converted…

Q: Write the balanced chemical equation for the reaction shown. = NO, = NO balanced equation:

A: Given, Form the picture, it is clear that 8NO and 4O2 is in the left side and 8NO2 in the right…

Q: is the gray powdered zinc metal reacts with purple iodine to give a white compound a physical…

Q: Write a balanced chemical equation for reaction.Gaseous carbon monoxide reacts with hydrogen gas to…

Q: I. Write balanced equations for the following reactions a. Cr(OH), + Br, Cro, + Br- НСООН + Mnо, со,…

A: We have to balance all given reaction as they are redox reaction, so we have to identify oxidising…

Q: What is the oxidation state of N in NO?

Q: Write balanced equations for each of the following types of reactions:

A: Since you have asked multiple question, we will solve the first question for you.If you want any…

Q: Change the following word equations to chemical equations and then balance it. Write the…

A: (4) When cuprous Chloride treated with oxygen then cuprous Chlorate is formed. The Balanced Chemical…

Q: The Hall process for the production of aluminum involves the reaction of aluminum oxide with…

A: Ore is defined as the mineral from which metal can be extracted economically. Major ore of aluminum…

Q: Complete and balance the molecular equation for the reaction of aqueous sodium sulfate, Na, SO,, and…

A: Write the balanced molecular equation Split electrolytes to ions to get the total ionic equation…

Q: The reaction between a strong base and strong acids yields what products?

A: The reaction between a strong acid and a strong base results in the formation of neutral salt with…

Q: Write a balanced chemical equation based on the following description: Solid sulfur and oxygen gas…

Q: Write the chemical equation

Q: 7. The major component of Gasoline is Octane (C,H,9) which is mixed with oxygen in the cylinders of…

A: when compound is burned with help of oxygen and form carbon dioxide and water and amount of energy.

Q: Solid calcium chloride is formed by the reaction of chlorine gas and solid calcium . Write a…

A: Given: Formation of solid calcium chloride from solid calcium and chlorine gas To find: Balanced…

Q: What is the balance chemical equation of Na + S8 --> Na2S

Q: Write balanced equations for the following reactions

A: (d) Oxidaion state of Ca (s) is 0 and V in VO43- is +5 Balanced Reduction half cell will be obtained…

Q: Write a balanced chemical equation based on the following description:solid C₄H₁₀O is burned with…

A: Given reaction is shown below,C₄H₁₀O is burned with oxygen gas to produce gaseous carbon dioxide and…

Q: For each pair, write a balanced chemical equation with states of matter describing the reaction that…

A: 1)Here one atom of X combines with 2 atoms of Y forming XY2 molecules.All atoms and molecules are…

Q: 2 g of aluminium metal is mixed with 11.5 g of sulphuric acid, H2SO4 to form aluminium sulphate and…

A: Metals react with acid to form salt and release hydrogen gas. A balanced equation is the equation in…

Q: Balance the following chemical equation (if necessary):

Q: Write the complete balanced equation for the combustion of barium metal. And state which substance…

A: Combustion reaction can be described as a chemical reaction in which the substance reacts with…

Q: Write the word equation for the following chemical equation

A: A chemical reaction involves the conversion of reactants into products. Chemical equations are used…

Q: Write a balanced chemical equation based on the following description: liquid C₇H₈O is burned with…

A: Balanced reaction is a chemical reaction in which number of atoms for each element in the reaction…

Q: Which of the these is a balanced chemical equation?

A: The correct answer is Option C - is correct. C. 2CO(g) + O2(g) gives to 2CO2(g) Both side…

Q: Write a balanced chemical equation for the reaction. Solid Magnesium Oxide is produced by heating…

A: We can write the balanced equation by making each elements equal in product side and reactant side .…

Q: The combustion of ammonia (NH3) in oxygen produces nitrogen (N2) and water. Find a balanced chemical…

A: To find the balanced chemical equation for the combustion reaction of ammonia in oxygen produces…

Q: Magnesium metal (Mg(s)) burns brightly in oxygen gas (O2(g)) to produce a whitish-grey powder,…

A: Balanced chemical equation is defined as a chemical equation in which the product and reactant sides…

Q: Balance the following chemical equations:

Q: Balance the following chemical reactions

A: The Chemical reaction follows the law of conservation of mass. According to the law of conservation…

Q: Write a balanced chemical equation based on the following description: solid cesium reacts with…

A: A chemical equation is written to represent a chemical reaction in short hand form. It is basically…

Q: hydrogen reacts with chlorine to form gaseous hydrogen chloride. Write a balanced chemical equation…

A: Given: Hydrogen reacts with chlorine to form gaseous hydrogen chloride.

Q: Write a balanced chemical equation for the complete combustion of pentene, C7H14.In combustion,…

A: The balanced chemical equation for the complete combustion of pentene has to be given.

Concept explainers

States of Matter

The substance that constitutes everything in the universe is known as matter. Matter comprises atoms which in turn are composed of electrons, protons, and neutrons. Different atoms combine together to give rise to molecules that act as a foundation for all kinds of substances. There are five states of matter based on their energies of attraction, namely solid, liquid, gases, plasma, and BEC (Bose-Einstein condensates).

Chemical Reactions and Equations

When a chemical species is transformed into another chemical species it is said to have undergone a chemical reaction. It consists of breaking existing bonds and forming new bonds by changing the position of electrons. These reactions are best explained using a chemical equation.

Question

Write the balanced chemical equations for the following reactions:

1. Aqueous aluminum nitrate reacts with aqueous sodium hydroxide to form
aqueous aluminum hydroxide and aqueous sodium nitrate.
2 Iron reacts with sulfuric acid to produce iron (III) sulfate and hydrogen gas.

Expert Solution

This question has been solved!

Explore an expertly crafted, step-by-step solution for a thorough understanding of key concepts.

SEE SOLUTION Check out a sample Q&A here

Step 1

VIEW

Step 2

VIEW

Step by step

Solved in 2 steps

SEE SOLUTION Check out a sample Q&A here

Knowledge Booster

Learn more about

Need a deep-dive on the concept behind this application? Look no further. Learn more about this topic, chemistry and related others by exploring similar questions and additional content below.

Similar questions

Many over-the-counter antacid tablets are now formulated using calcium carbonate as the active ingredient, which enables such tablets to also be used as dietary calcium supplements. As an antacid for gastric hyperacidity, calcium carbonate reacts by combining with hydrochloric acid found in the stomach, producing a solution of calcium chloride, converting the stomach acid to water, and releasing carbon dioxide gas (which the person suffering from stomach problems may feel as a “burp”). Write the unbalanced chemical equation for this process.
Many cereals are made with high moisture content so that the cereal can be formed into various shapes before it is dried. A cereal product containing 58% H2O by mass is produced at the rate of 1000. kg/h. What mass of water must be evaporated per hour if the final product contains only 20.% water?
Consider the iron alloy described in Question 19. Suppose it is desired to prepare 1.00 kg of this alloy, what mass of each component would be necessary?
Bacterial digestion is an economical method of sewage treatment. The reaction is an intermediate step in the conversion of the nitrogen in organic compounds into nitrate ions. What mass of bacterial tissue is produced in a treatment plant for every 1.0 104 kg of wastewater containing 3.0% NH4+ ions by mass? Assume that 95% of the ammonium ions are consumed by the bacteria.
Many cereals are made with high moisture content so that the cereal can be formed into various shapes before it is dried. A cereal product containing 58% H2O by mass is produced at the rate of 1000. kg/h. What mass of water must be evaporated per hour if the final product contains only 20.% water?
Silicon is produced for the chemical and electronics industries by the following reactions. Give the balanced equation for each reaction. a. SiO2(s)+C(s)Si(s)+CO(g) b. Silicon tetrachloride is reacted with very pure magnesium, producing silicon and magnesium chloride. c. Na2SiF6(s)+Na(s)Si(s)+NaF(s)
A 2.5624-g sample of a pure solid alkali metal chloride is dissolved in water and treated with excess silver nitrate. The resulting precipitate, filtered and dried, weighs 3.03707 g. What was the percent by mass of chloride ion in the original compound? What is the identity of the salt?
3.88 One Step in the enrichment of uranium for use in nuclear power plants involves the reaction of UO2 with hydro- fluoric acid (HF) solution. The products are solid UF4 and water. Write a balanced chemical equation for this reaction.