Explain why each of the following is an incorrect IUPAC name. Write the correct IUPAC name for the compound. a. 1,3-Dimethylbutane b. 4-Methylpentane c. 2,2-Diethylbutane d. 2-Ethyl-3-methylpentane e. 2-Propylpentane f. 2,2-Diethylheptane g. 2,2-Dimethylcyclopropane h. l-Ethyl-5-methylcyclohexane

Explain why each of the following is an incorrect IUPAC name. Write the correct IUPAC name for the compound. a. 1,3-Dimethylbutane b. 4-Methylpentane c. 2,2-Diethylbutane d. 2-Ethyl-3-methylpentane e. 2-Propylpentane f. 2,2-Diethylheptane g. 2,2-Dimethylcyclopropane h. l-Ethyl-5-methylcyclohexane

World of Chemistry, 3rd edition

3rd Edition

ISBN:9781133109655

Author:Steven S. Zumdahl, Susan L. Zumdahl, Donald J. DeCoste

Publisher:Steven S. Zumdahl, Susan L. Zumdahl, Donald J. DeCoste

Chapter20: Organic Chemistry

Section: Chapter Questions

Problem 2STP

See similar textbooks

Related questions

Q: Explain why each name is incorrect, and then write a correct name. (a) 2-Ethyl-1-propene (b)…

A: a) The structure which can be drawn by the name 2-Ethyl-1-propene is as shown below. Hence from the…

Q: Convert the structure to IUPAC name or IUPAC name to structure, as appropriate. Structure IUPAC Name…

Q: Draw condensed formulas for the following compounds:(a) 3-ethyl-3-methyloctane; (b)…

A: The condensed structural formulas for the given compounds has to be drawn. Since, you are asked for…

Q: CH3 HCCH,CH,CHCH3

Q: Each of the following IUPAC names is incorrect. Explain why it is incorrect and give the correct…

A: Rules for naming the organic compound is as follows; Select the longest continuous carbon chain.…

Q: 6. Draw the condensed structural diagram and then the line structural formula for each of the…

A: Condensed formula of compound indicates the no. of different atoms present in the molecule. Line…

Q: Provide the IUPAC name the compound CH3(CH2)4-C=C-CH2CH=CH(CH2)7CH3. Parent name: Locants: IUPAC…

A: Given compound is :

Q: Draw the structure of each alkane and cycloalkane from the given incorrect name. Then, give the…

A: Given: 3-ethyl-1,4-dimethylcycloheptane

Q: Which compound has the highest melting point? A. Decane B. 2,2,3,3-tetramethylbutane C.…

A: The normal alkane has the highest boiling point.Boiling point of alkane increases with molar mass.

Q: The IUPAC name for the molecule above is A: 4-ethylhexane B: 1-hexylethane C: 3-propylpentane D:…

A: To write the IUPAC name of the below compound.

Q: (b) Draw structures corresponding to the following IUPAC names. (a) 3,4-Dimethylnonane (c)…

Q: Which compound is a saturated hydrocarbon? a. 3-hexyne b. 2-butene c. 2-methylpentane d.…

A: A hydrocarbon is an organic compound whose only constituents are carbon and hydrogen. They are…

Q: What is the IUPAC name of the following compound? a. 2-isopropyl-5-methylpentane b.…

A: The compound given is,

Q: What is the IUPAC name for the compound shown here? A) 3-ethyl-4-methylpentane B)…

A: IUPAC nomenclature is a naming given to chemical compounds based on certain rules that are given by…

Q: For each, draw a structural diagram (line, condensed or complete) 9. 2-methyl-l-pentene 10. 2-butene…

A: Since we only answer up to 3 sub-parts, we’ll answer the first 3. Please resubmit the question and…

Q: What is the IUPAC name of this molecule? a. 1-chloropentane b. 2-chloro-1-ethylethane c.…

A: IUPAC is nomenclature in organic chemistry. It is a method of naming organic chemical compounds. It…

Q: Which of the following is a CORRECT name according to the IUPAC rules? a. 2-ethyl-2-methylpentane…

A: ->In IUPAC naming first of all we see longest carbon chain.

Q: 46. What is the IUPAC name of the compound shown in the figure? A. Methylhexene B. 4-methylhexene C.…

A: The IUPAC Naming is done in such a way that substituent attached on the parent chain gets lowest…

Q: The following compound name is an incorrect IUPAC name: "2,3-diethylheptane" What is the proper…

A: First we have to know that why 2,3-diethylheptane is incorrect IUPAC name. Because, here…

Q: Of the compounds listed here, which one is not a constitutional isomer of the other three? A)…

A: Constitutional isomers are those which have same molecular formula but different structure and…

Q: Compounds used as reference standards for octane ratings of 100 and 0, respectively, are a.…

A: Octane number is a rating of fuel (usually gasoline) that indicates its anti-knocking capacity on…

Q: Select the incorrect statement(s) regarding the boiling points of alkanes. Boiling point increases…

A: Alkanes are a category of organic compounds and contain carbon and hydrogen atoms only that are…

Q: How do structures of these IUPAC names look like? 2-Propoxy-1-(2-propoxyethoxy)propane Please…

Q: Create the molecule that corresponds to butane.

A: Butane is an alkane. The general molecular formula of alkane is CnH2n+2. Here, n is the number of…

Q: A student gave a molecule the following incorrect name: 2-ethyl-3-methyl-5-propylhexane. What is the…

A: Answer

Q: Give the IUPAC name for the following compound: Multiple Choice R2,3-dimethylhexane…

A: The IUPAC name of the compound can be written on the basis of the main carbon chain, functional…

Q: Answer the following questions. a) b.P for the n- heptane more than 2,4-dimetylpentane. b)…

A: NOTE: please note according to our policy , we can only answer first three subparts of a question.…

Q: Which of the following alkane names is correct/possible? A) 1,2-dimethylhexane B) 1-methylnonane C)…

A: According to nomenclature, (A), (B),(C)&(D) all alkane names are correct and possible.

Q: How do structures of these IUPAC names look like? e) 2-Propoxy-1-(2-propoxyethoxy)propane

Q: B. Draw the Structural formula for the given hydrocarbons. 1.) Decane 2.) 2- Pentene 3.) 3- Hexyne

A: Structural formula:

Q: What is the correct IUPAC name for the compound below? A) 2,2,4-trimethylpentane B)…

Q: What is the correct IUPAC name of the organic compound produced in the largest amount when 1-butene…

A: The solution is given below -

Q: Applying the IUPAC nomenclature system, the parent chain of this alkane is: O nonane O heptane O…

A: Organic compounds can be defined as the compounds that are made up of carbon and hydrogen atoms.

Q: Which hydrocarbon will have highest boiling point ? a, isohexane b. 3-methylhexane c.n-heptane od.…

A: There are three factors that determine the boiling point of hydrocarbons:- a) The greater the…

Q: How do structures of these IUPAC names look like? d) 4-Mercapto-3-methylthiopentene

A: A question based on nomenclature that is to be accomplished.

Q: What is the correct IUPAC name for the following compound CH3-CH(CH3)-CH(C2H5)-CH2-CH(CH3)-CH3?…

A: Basic Rule to write IUPAC Name (1) Select the longest chain (2) Numbering start from those side…

Q: Name the following using correct IUPAC nomenclature: A) isopentane B) 2-methylpentane CH3CH2CCH3 C)…

A: The compound given is,

Q: 1. For each of the following IUPAC names, draw a structural diagram. (a) 2-methylpentane (b) octane…

Q: CH3 CH CH2 CH CH3 H3C H2C-CH3

A: Rule of IUPAC- 1) Longest chain as parent chain. 2) Numbering start from those side where more prior…

Q: A student gave a molecule the following incorrect name: 2-ethyl-3-methyl-5- propylhexane. What is…

A: Incorect name: 2-ethyl-3-methyl-5-propylhexane. Correct IUPAC name of the molecule =?

Q: Draw the structure for the given IUPAC naming (3S)-1-chloro-3-methyl hexane

A: We have given the IUPAC name of compound as follow (3S)-1-chloro-3-methyl hexane And the…

Q: For each, draw a structural diagram (ine, conderised or complele) IUPAC Name Condensed Formula…

Q: How many total covalent bonds are present in the compound? (Please refer to the first image…

A: Covalent bond: Covalent bond is formed due to sharing of electrons IUPAC rules: 1. Choose the…

Q: Select one: a. Ethylbenzene O b. 1,2-Dimethylbenzene c. 1,4-Dimethylbenzene d. Methylbenzene

A: * Isomer have same molecular formula , but different properties * ethylbenzene, 1,2 dimettlbenzene,…

Q: Draw the structure corresponding to following IUPAC name. 3-ethyl-2-methylhexane

A: Given, 3-ethyl-2-methylhexane

Q: Draw both condensed and line structures corresponding to the following IUPAC names:(a)…

A: Bond line structure is the one in which covalent are represented with line for each level of bond…

Q: Do saturated and unsaturated hydrocarbons show similar observable positive results in all tests?

A: Hydrocarbons are compounds of hydrogen and carbons. These are classified into two types on the basis…

Q: Show the Condensed structural formula for each compound and then give the correct name A.…

A: In the condensed structural formula we do not write the line of the single bonds and all the…

Q: The IUPAC name 4-hexylhexane is incorrect. What should be the correct name? o 3-propylnonane…

A: The systematic naming of organic compound is given by IUPAC. The naming of organic compound is done…

Q: Choose the correct IUPAC name for the following compound 2-butane 1-butene 2-butyne 2-butene…

A: The IUPAC name of the compound can be written on the basis of the number of carbon atoms in the main…

Concept explainers

Alkanes and Cycloalkanes

Alkanes are saturated organic compounds which are made up of C and H atoms. Alkanes have the general formula of CnH2n+2. Alkane contains sp3 hybridized carbon atoms with four sigmas (σ) bonds & every hydrogen atom is connected with one of the carbon atoms. The size of the alkane could be determined by the number of carbon atoms located in it.

Question

Explain why each of the following is an incorrect IUPAC name. Write the correct IUPAC name for the compound.

a. 1,3-Dimethylbutane

b. 4-Methylpentane

c. 2,2-Diethylbutane

d. 2-Ethyl-3-methylpentane

e. 2-Propylpentane

f. 2,2-Diethylheptane

g. 2,2-Dimethylcyclopropane

h. l-Ethyl-5-methylcyclohexane

Expert Solution

This question has been solved!

Explore an expertly crafted, step-by-step solution for a thorough understanding of key concepts.

This is a popular solution!

SEE SOLUTION Check out a sample Q&A here

Step 1

Step 2

Step 3

Step 4

Trending now

This is a popular solution!

Step by step

Solved in 4 steps with 3 images

SEE SOLUTION Check out a sample Q&A here

Knowledge Booster

Learn more about

Need a deep-dive on the concept behind this application? Look no further. Learn more about this topic, chemistry and related others by exploring similar questions and additional content below.

Similar questions

Each of the following IUPAC names is incorrect. Explain why it is incorrect and give the correct IUPAC name.a. 2,2-dimethyl-4-ethylheptaneb. 5-ethyl-2-methylhexanec. 2-methyl-2-isopropylheptaned. 1,5-dimethylcyclohexanee. 1-ethyl-2,6-dimethylcycloheptanef. 5,5,6-trimethyloctaneg. 3-butyl-2,2-dimethylhexane
1. What is the IUPAC name of the compound below? (Please refer to the image attached.) A. Trichloro-1,2,3-propylbenzene B. 2,3,5-Trichlorotoluene C. 1-Propyl-2,3,5-trichlorobenzene D. 1,2,5-Trichloro-3-propylbenzene E. None of the choices 2. Which of the following is a carbonyl containing functional group? I. Aldehyde II. Ketone III. Carboxylic acid IV. Amine A. I,II,III,IV B. I,II,III C. I,II D. I 3. Which of the following functional group contains a hydroxyl group? A. Ester B. Ether C. Aldehyde D. Alcohol
What is the IUPAC name of the following compound? O A. 2-Ethyl-4-methylpentane O B. 2,4-Dimethylhexane O C. 3,5-Dimethylhexane OD. 1,1,3-Trimethylpentane nich of the llowing statemUs is not true rega ding the p
4. The following names are for actual compounds, but the name given are incorrect. Draw out the structures and give the proper IUPAC name. a. 4-ethylpentane b. 2-ethyl-3-methylpentane c. 2,2-diethylheptane d. 2-propylpentane e. 4,4-diethylbutane
Each of the following IUPAC names is incorrect. Explain why it is incorrect and give the correct IUPAC name. a. 2,2-dimethyl-4-ethylheptane b. 5-ethyl-2-methylhexane c. 2-methyl-2-isopropylheptane d. 1,5-dimethylcyclohexane e. 1-ethyl-2,6-dimethylcycloheptane f. 5,5,6-trimethyloctane g. 3-butyl-2,2-dimethylhexane h. 1,3-dimethylbutane
12. What is the correct IUPAC name of the following compound ? A. 2,3-dimethyl-4-propylhexane. B. 4-ethyl-5,6-dimethylheptane. C. 4-ethyl-2,3-dimethylheptane. D. 3-propyl-4,5-dimethylhexane.
Draw the structure of each alkane and cycloalkane from the given incorrect name. Then, give the IUPAC name for each compound. a. 7-ethyl-3,6-dimethylnonane b. 4-ethyl-3-isopropylheptane c.3-ethyl-1,4-dimethylcycloheptane d. 1-ethyl-3-methyl-5-isopropylcyclohexane
NH2 C1 27. What is the correct IUPAC name for the compound above? a. 2-chloroaniline O b. 1-chloronitrobenzene Oc. 1-nitro-2-chlorobenzene Od. 1-chloro-2-nitrobenzene
What is the IUPAC name for this molecule: 3-ethyl-2-methylpentane 3-ethyl-4-methylpentane 3-isopropylpentane 2-methyl-3-ethylpentane
2. What is the IUPAC name of the following compound? CH3 a. 2,4-dimethylhexane b. 2-ethyl-4-methylpentane c. 2,4-methylhexane d. 3,5-dimethylhexane e. 2,4-octane H3C-CH-CH2-CH–CH2-CH3 ČH3
Choose the correct IUPAC name with its correct functional group. 1. CH3COOCH3 2. C5H11COOH 3. CH3CH2CH2COOH 4. CH3COOH 5.
What is the IUPAC name of this compound ? A. 3-ethyl-2,7,8-trimethylnonane B. 2,6-diisopropyloctane C. 6-ethyl-2-isopropyl-7-methyloctane D. 7-ethyl-2,3,8-trimethylnonane E. 7-isopropyl-2,3-dimethylnonane