Each of the following IUPAC names is incorrect. Explain why it is incorrect and give the correct IUPAC name.a. 2,2-dimethyl-4-ethylheptaneb. 5-ethyl-2-methylhexanec. 2-methyl-2-isopropylheptaned. 1,5-dimethylcyclohexanee. 1-ethyl-2,6-dimethylcycloheptanef. 5,5,6-trimethyloctaneg. 3-butyl-2,2-dimethylhexaneh. 1,3-dimethylbutane

In organic chemistry the name of any organic compound is given by the IUPAC nomenclature. There are…

Answered: Each of the following IUPAC names is…

World of Chemistry, 3rd edition

3rd Edition

ISBN:9781133109655

Author:Steven S. Zumdahl, Susan L. Zumdahl, Donald J. DeCoste

Publisher:Steven S. Zumdahl, Susan L. Zumdahl, Donald J. DeCoste

Chapter20: Organic Chemistry

Section: Chapter Questions

Problem 2STP

See similar textbooks

Similar questions

Each of the following IUPAC names is incorrect. Explain why it is incorrect and give the correct IUPAC name.a. 2,2-dimethyl-4-ethylheptaneb. 5-ethyl-2-methylhexanec. 2-methyl-2-isopropylheptaned. 1,5-dimethylcyclohexanee. 1-ethyl-2,6-dimethylcycloheptanef. 5,5,6-trimethyloctaneg. 3-butyl-2,2-dimethylhexane
4. Which of the following has isomeric forms?a. C2H3Clb. C2H5Clc. C2HCld. C2H4Cl2 5. Which of the following hydrocarbons always gives the same product when one of its hydrogen atoms is replaced by a chlorine atom.a. Hexaneb. Hex-1-enec. Cyclohexaned. Cyclohexene
The IUPAC name for the compound CH3 - CH2 - CH2 - O - CH2 - CH3 is 2-ethoxyethane. 2-ethoxypropane. 1-ethoxypropane. 1-propoxyethane. ethyl propyl ether.
Draw a structure a. 3,4-dimethylpent-1-yneb.3-methyl-3-ethyl-1-butenec. 3,3-dimethyl-4-decened.1,1-dimethyl-4-ethyl-2,5-cyclohexadienee. 4-ethyl-2,3-dimethyl-2-heptenef. 1-chlorocyclopropeneg. 2,6-dimethyl-2,5-octadieneh. 1-cyclobutyl-3-methyl-1-butynei. 5-bromo-2-chlorotoluene
4. The following names are for actual compounds, but the name given are incorrect. Draw out the structures and give the proper IUPAC name. a. 4-ethylpentane b. 2-ethyl-3-methylpentane c. 2,2-diethylheptane d. 2-propylpentane e. 4,4-diethylbutane
Draw the structure of each alkane and cycloalkane from the given incorrect name. Then, give the IUPAC name for each compound. a. 7-ethyl-3,6-dimethylnonane b. 4-ethyl-3-isopropylheptane c.3-ethyl-1,4-dimethylcycloheptane d. 1-ethyl-3-methyl-5-isopropylcyclohexane
4. The names below are incorrect. A reasonable molecular formula can be written to correspond to the incorrect name. After writing the formula give it a correct IUPAC name, and list the errors in the original name. a 2,2-dimethylcyclobutane b. 2-ethyl-4,4-dimethyl-2-pentene 1-ethyl-5-methyl-3-cyclopentene d. 4-isopropyl-m-xylene c. e. 1,4,7-trimethyl-4,6-heptadien-2-ynyl-benzene Jorination
1. What is the IUPAC name of the compound below? (Please refer to the image attached.) A. Trichloro-1,2,3-propylbenzene B. 2,3,5-Trichlorotoluene C. 1-Propyl-2,3,5-trichlorobenzene D. 1,2,5-Trichloro-3-propylbenzene E. None of the choices 2. Which of the following is a carbonyl containing functional group? I. Aldehyde II. Ketone III. Carboxylic acid IV. Amine A. I,II,III,IV B. I,II,III C. I,II D. I 3. Which of the following functional group contains a hydroxyl group? A. Ester B. Ether C. Aldehyde D. Alcohol
What is the condensed structural formula for 3,3-diethyl-2-methylhexane? A. CH3CH2CH(CH2CH3)CH2(CH3)CH2CH3 B. CH3CH2C(CH2CH3)2CH2(CH3)CH2CH3 C. CH3CH(CH3)C(CH2CH3)2CH2CH2CH3 D. CH3C(CH3)2C(CH2CH3)2CH2CH2CH3
2. Draw structures corresponding to the following IUPAC names. a. 2-Methyl-1,5-hexadiene b. 3-Ethyl-2,2-dimethyl-3-heptene c. 2,3,3-Trimethyl-1,4,6-octatriene d. 3,4-Diisopropyl-2,5-dimethyl-3-hexene e. 3-methyl-1-pentyne f. (Z)-3-methylhex-2-en-4-yne
The correct IUPAC name for the following compound is CH2 H2 H3C. CH3 H2 H3C CH3 a. 2,3,3-trimethyl-1-hexene b. 2,3,3-trimethylhexane c. 4,4,5-trimethylhexane d. 3,4,4-trimethyl-2-hexene
How many mono-chlorinated isomers of C4H10 exist? Name and draw them.

SEE MORE QUESTIONS

Recommended textbooks for you

World of Chemistry, 3rd edition

Chemistry

ISBN:

9781133109655

Author:

Steven S. Zumdahl, Susan L. Zumdahl, Donald J. DeCoste

Publisher:

Brooks / Cole / Cengage Learning

World of Chemistry, 3rd edition

Chemistry

ISBN:

9781133109655

Author:

Steven S. Zumdahl, Susan L. Zumdahl, Donald J. DeCoste

Publisher:

Brooks / Cole / Cengage Learning

SEE MORE TEXTBOOKS