What is the IUPAC name of this compound ? A. 3-ethyl-2,7,8-trimethylnonane B. 2,6-diisopropyloctane C 6-ethyl-2-isopropyl-7-methyloctane D. 7-ethyl-2,3,8-trimethylnonane E. 7-isopropyl-2,3-dimethylnonane

What is the IUPAC name of this compound ? A. 3-ethyl-2,7,8-trimethylnonane B. 2,6-diisopropyloctane C 6-ethyl-2-isopropyl-7-methyloctane D. 7-ethyl-2,3,8-trimethylnonane E. 7-isopropyl-2,3-dimethylnonane

World of Chemistry, 3rd edition

3rd Edition

ISBN:9781133109655

Author:Steven S. Zumdahl, Susan L. Zumdahl, Donald J. DeCoste

Publisher:Steven S. Zumdahl, Susan L. Zumdahl, Donald J. DeCoste

Chapter20: Organic Chemistry

Section: Chapter Questions

Problem 25A

See similar textbooks

Related questions

Q: At 25°C the rate constant for the first-order decomposition of a pesticide solution is 6.40 - 10…

Q: b. How many grams of copper(i) sulfide could be produced from 28.0 g of copper(1) chloride reacting…

A: Given :- mass of copper(I)chloride reacting with excess hydrogen sulfide = 28.0 g To calculate :-…

Q: Improve the reaction efficiency of chemicals and pollutants High potential at interface MNBS have…

A: MNB technique is used for waste water treatment.

Q: A city's water supply is contaminated with a toxin at a concentration of 0.63 mg/L. For the water to…

A: We have find out the correct option.

Q: Using net ionic equations and solution stoichiometry, calculate the molarity of the principal…

A: The reaction between NH4OH and H2SO4 is as follows. 2NH4OH + H2SO4 = (NH4)2SO4 + 2H2O Now we have…

Q: 6. Prove that the Is and 2p, orbitals for the H atom are orthogonal. [Remember: when checking if two…

A: Here we are required to show that two wavefunction of hydrogen atom are orthogonal to each other

Q: 50.00 mL of a buffer solution contains 0.280 M HClO and 0.450 M NaClO. If 25.00 mL of water is…

A: Given-> Volume of buffer = 50.00 ml Molarity of HClO = 0.280 M Molarity of NaClO = 0.450 M Volume…

Q: 5. Consider the following half-reactions: F,(g) + 2 e Cu2*(aq) + 2 e Sn2*(aq) + 2 e → AР' (aq) + 3 e…

A: Which of the above elements or ions will oxidize Sn(s)?

Q: Write a balanced acid ionization reaction tor the acid given below. Use the tollowing tormat to…

A: Given, Acid = HSO4- Write a balanced acid ionization reaction for the acid given below = ?

Q: According to Hess's Law: AHReaction = AHsolution + AHNeutralization %3D Calculated AHR Percent Error

A: Given, experimental value of ∆HR is -18194.6 cal/mol.

Q: A 0.01M solution of carbonic acid dissociates into 0.000066 moles HCO3- /L at equilibrium. What is…

Q: Make 50 ml of the extraction buffer containing the following ingredients using the stock solution…

A: We need to make 50 mL of the extraction buffer.

Q: An air-standard Diesel cycle has a compression ratio of 18 and a cut-off ratio of 2.5. The state at…

Q: 13.25 Use the Nernst equation to calculate the cell potentials of the following cells at 298 K. (a)…

Q: Question 3 The vapor pressure of 2-propanol (60.096 g/mol) is 50.00 kPa at 338.8 °C, but it fell to…

Q: The activation energy for the reaction CH3CO - CH3+ CO is 71 kJimol. How many times greater is the…

Q: A reaction is experimentally found to follow the rate law, Rate - K(A2 where k - 0.355 Mmin.…

Q: Which of the following was used in excess in the gravimetric method of analysis experiment? BaCl,…

A: The correct answer about gravimetric analysis is given below

Q: PROBLEM: Many gaseous reactions occur in a car engine and exhaust system. One of these is NO (g)-…

Q: A chemistry student weighs out 0.146 g of chloroacetic acid (HCH,CICO,) into a 250. mL volumetric…

Q: A student attempts to determine the molecular weight of an unknown liquid with a boiling point of…

A: To explain the reason why the student is unable to determine the molecular weight.

Q: This refers to a point wherein both liquid phases have the same composition. Hence, extraction is…

A: Answer: This question is based on the Liquid-liquid extraction where certain terms are used to…

Q: Draw compounds containing the following. A. A primary alcohol B A tertiary nitrile C. A secondary…

A: Alcohol - mean contains OH group Nitrile - contains CN group Thiol - contains SH group

Q: Describe why "new" elements (man-made elements) are created, or why do we benefit in creating them?…

Q: 13.72 A metallurgist wants to gold-plate a thin sheet with the following dimensions: 1.5 in x 8.5 in…

A: We have find out the answer.

Q: 1) For each compound, complete the following steps: a) Write a complete, balanced combustion…

A: "Since you have asked multiple questions, we will solve the first question (i.e. first compound-…

Q: A 356 g sample of nitrogen goes through a temperature change of +71.43 °C. The J specific heat…

Q: Provide an IUPAC name for the structure shown. H

A: 1. Select the principle carbon chain 2. Numbering 3. Naming (prefix + word root + suffix)

Q: Br + CIO" + H' → Br, + Cl + H,O Sn* + Vo, + H* → Sn" + V* + H,O

Q: regard

A: According to the question, we need to explain why NaOH be a poor choice for the base, as opposed to…

Q: Consider the reaction 2CO2(g) + 5H2(g)C2H2(g) + 4H2O(g) Using the standard thermodynamic data in…

Q: Saved A city's water supply is contaminated with a toxin at a concentration of 0.63 mg/L. For the…

A: Given-> Initial concentration of toxin = 0.63 mg/L Final concentration of toxin=1.5 ×…

Q: nd the nuclear binding energy of potassium-40 (atomic mass - 39.9632591 amu) in units of joules per…

Q: Predict the conjugate acid of CH,O'. A) CH,ОН В) СН,ОН, + C) CH,O? '2 D) CH,O

A: We have to predict the conjugate acid of given species.

Q: At 700 K. the reaction 2502la) - Ozlal = 2503la) has the equilibrium constant Ke -4.3 - 106, and the…

A: The equilibrium reaction given is 2 SO2 (g) + O2 (g) ⇌ 2 SO3 (g) The equilibrium constant, Kc =…

Q: 15. How many moles are in a 675 mL sample of gas at 313 K and 1.65 atm?

A: • The values provided in the question are:- i) Pressure of a sample of gas, P = 1.65 atm…

Q: H,C-g-S-CH b. H3C NH2 a. Crus th

Q: Which of the following phase diagrams corresponds to a system wherein the upper critical temperature…

A: The phase diagrams corresponds to a system wherein the upper critical temperature is less than the…

Q: A first-order reaction is 40.0% complete at the end of 39.1 minutes. What is the value of the rate…

A: Given reaction is 40% completed hence remaining concentration is 60%

Q: 23. What volume of carbon dioxide gas at STP could be produced from the decomposition of 150.0 grams…

A: ★ Answer : 33.55 Litres CO2 gas will be produced at STP from the decomposition of 150g CaCO3. ★…

Q: Kp for the reaction 4CUO(s) = 2Cu20(s) + O2(g) Is 0.49 at 1024 °C. Calculate Kc at this temperature

A: Given :- 4CuO(s) <-----> 2Cu2O(s) + O2(g) Kp = 0.49 T = 1024°C To calculate :- value of Kc…

Q: 18. What is the equilibrium concentration of barium ions in a 1.0L solution of barium carbonate to…

A: Answer: For the saturated solution of sparingly soluble salt, its solubility product becomes equal…

Q: Chemistry Propose a synthesis of the target molecule from the starting material(s) provided. Please…

A: Step 1 : Hydrogenation. Step 2 : PCC oxidation Step 3 : acetylide anion addition to keto. Step 4 :…

Q: 1. O3 2. (CH3)2S

A: Detail mechanistic pathway is given below

Q: A sample of antacid tablet that contains NaHCO3 is analyzed in the lab. The student dissolves 1.50g…

A: The balanced equation for the reaction of NaHCO3 and HCl is: NaHCO3 + HCl ----> CO2 + H2O + NaCl…

Q: The molar solubility of MnCO3 is 4.2 × 10−6 M. What is Ksp for this compound?

A: Given-> Molar solubility = s = 4.2 × 10-6 M

Q: 5. Predict the ESR spectrum of pentafluorooxovanadium(IV), VOF,. For $v, I=7/2 with explanation.

Q: Suppose that at some initial time all the molecules in a container have the same translational…

A: Given that, the translational energy is is E = 2.0×10-14 ergs. We have to calculate the final…

Q: Assuming 100% of the sugars are hydrolyzed/isomerized into glucose, and that 100% of the glucose is…

Q: 3.33 Calculate the standard free energy change for the follow- ing reactions using the standard cell…

Concept explainers

Diol

In chemistry there are so many chemical compounds that have a hydroxyl group but a chemical compound having two hydroxyl groups (-OH) is termed as a diol. It also implies the presence of two alcohols whereas polyols contain two or more than two hydroxyl groups (-OH). Glycol or 1,2-diol is an aliphatic diol that has two alcohol groups on adjacent carbon atoms. In industries, the most commonly used diol is ethylene glycol.

Question

100%

What is the IUPAC name of this compound ?
A. 3-ethyl-2,7,8-trimethylnonane
B. 2,6-diisopropyloctane
C. 6-ethyl-2-isopropyl-7-methyloctane
D. 7-ethyl-2,3,8-trimethylnonane
E. 7-isopropyl-2,3-dimethylnonane

Expert Solution

This question has been solved!

Explore an expertly crafted, step-by-step solution for a thorough understanding of key concepts.

This is a popular solution!

SEE SOLUTION Check out a sample Q&A here

Step 1

VIEW

Step 2

VIEW

Trending now

This is a popular solution!

Step by step

Solved in 2 steps with 2 images

SEE SOLUTION Check out a sample Q&A here

Knowledge Booster

Learn more about

Need a deep-dive on the concept behind this application? Look no further. Learn more about this topic, chemistry and related others by exploring similar questions and additional content below.

Similar questions

Why are different conformations of an alkane not considered structural isomers?
The IUPAC name for the compound CH3 - CH2 - CH2 - O - CH2 - CH3 is 2-ethoxyethane. 2-ethoxypropane. 1-ethoxypropane. 1-propoxyethane. ethyl propyl ether.
It has been suggested that the following compound was incorrectly named trans-3,5-dimethyl-4- propylnon-3-ene. What is the correct IUPAC name for the compound? A. cis-3,5-dimethyl-4-propylnon-3-ene trans-4(2-hexane)3methylhept-3-ene B. C. trans-4-propyl 3,5-dimethylnon-3-ene D. cis-4(2-hexane)3methylhept-3-ene E. trans-3,5-dimethyl-4-propylnon-3-ene
Each of the following IUPAC names is incorrect. Explain why it is incorrect and give the correct IUPAC name.a. 2,2-dimethyl-4-ethylheptaneb. 5-ethyl-2-methylhexanec. 2-methyl-2-isopropylheptaned. 1,5-dimethylcyclohexanee. 1-ethyl-2,6-dimethylcycloheptanef. 5,5,6-trimethyloctaneg. 3-butyl-2,2-dimethylhexane
What is the IUPAC name of the following compound? O A. 3,4,4-Triethyl-2,2,5-trimethylhexane B. 3-Ethyl-3-isopropyl-4-tertbutylhexane O c. 3,3,4-Triethyl-2,5,5-trimethylhexane D. 3,4-Diethyl-4-isopropyl-2,2- dimethylhexane.
What is the IUPAC name for the following compound ? A. 3,7-dichloro-5-ethyl-6-methyloctane B. 2-chloro-3-methyl-4-(2-chlorobutyl)hexane C. 2,6-dichloro-4-ethyl-3-methyloctane D. 3-chloro-5-(2-chloro-1-methylpropyl)heptane E. 2,3,4,6-dichloroethylmethyoctane
What is the IUPAC name of the following compound? a. 2-isopropyl-5-methylpentane b. 5-isopropyl-2-methylpentane c. 2,3,5-trimethylhexane d. 1,2-diisopropylpropane a O d
12. What is the correct IUPAC name of the following compound ? A. 2,3-dimethyl-4-propylhexane. B. 4-ethyl-5,6-dimethylheptane. C. 4-ethyl-2,3-dimethylheptane. D. 3-propyl-4,5-dimethylhexane.
What is the condensed structural formula for 3,3-diethyl-2-methylhexane? A. CH3CH2CH(CH2CH3)CH2(CH3)CH2CH3 B. CH3CH2C(CH2CH3)2CH2(CH3)CH2CH3 C. CH3CH(CH3)C(CH2CH3)2CH2CH2CH3 D. CH3C(CH3)2C(CH2CH3)2CH2CH2CH3
1. What is the IUPAC name of the compound below? (Please refer to the image attached.) A. Trichloro-1,2,3-propylbenzene B. 2,3,5-Trichlorotoluene C. 1-Propyl-2,3,5-trichlorobenzene D. 1,2,5-Trichloro-3-propylbenzene E. None of the choices 2. Which of the following is a carbonyl containing functional group? I. Aldehyde II. Ketone III. Carboxylic acid IV. Amine A. I,II,III,IV B. I,II,III C. I,II D. I 3. Which of the following functional group contains a hydroxyl group? A. Ester B. Ether C. Aldehyde D. Alcohol
Choose the correct IUPAC name with its correct functional group. 1. CH3COOCH3 2. C5H11COOH 3. CH3CH2CH2COOH 4. CH3COOH 5.
What is the correct IUPAC name for the compound above? a. 2,3,4-trimethylhexane b. 2-ethyl-3-isopropylbutane c. 1,2,3,4-tetramethylpentane d. 3,4-dimethylheptane