1. Draw the carboxylic acids formed by the oxidation of each of the following molecules. HOH₂C H2 CH3 L H3CH2C + 2. Draw the esters formed by the following reactions. a. H3C H3C-C-C H₂ H3C. OH H3C OH b. OH H3C H3CHCH2CH2C- + H3C CH `CH2CH3 OH H₂ 3. Indicate the products of the following reaction: CH3 + H2O H3CH2CH2C CH₂OH

1. Draw the carboxylic acids formed by the oxidation of each of the following molecules. HOH₂C H2 CH3 L H3CH2C + 2. Draw the esters formed by the following reactions. a. H3C H3C-C-C H₂ H3C. OH H3C OH b. OH H3C H3CHCH2CH2C- + H3C CH `CH2CH3 OH H₂ 3. Indicate the products of the following reaction: CH3 + H2O H3CH2CH2C CH₂OH

Chemistry for Today: General, Organic, and Biochemistry

9th Edition

ISBN:9781305960060

Author:Spencer L. Seager, Michael R. Slabaugh, Maren S. Hansen

Publisher:Spencer L. Seager, Michael R. Slabaugh, Maren S. Hansen

Chapter15: Carboxylic Acids And Esters

Section: Chapter Questions

Problem 15.58E

See similar textbooks

Similar questions

What type of chemical reaction does carboxylic acid undergo in the following situations? 17. synthesis of methyl salicylate18. reaction with a strong alkali19. occurs in aqueous solution21. release of hydrogen gas22. production of carboxylate salts23. reaction with acetyl chloride24. one of the reactants is alcohol25. alcohol used as reactant
What are the different carboxylic acid derivatives? Describe each. What is the specific characteristics of esters and their importance? Enumerate the importance of esterification process in pharmacy and in medicine.
Acid anhydride Carboxylic Acid H₂C CH₂OH H₂O CH,OH CH3 Ester H₂C O CH₂OH 1. CH₂MgBr 2. H₂O* Acid chloride CH,CH,NH, Tertiary alcohol Amide
Formation of Esters. Odor of ester Chemical Equation:
Name: 2) When water is introduced into an ester under high temperature conditions, esters are hydrolyzed into their carboxylic acid and alcohol components. Draw the structure of the resulting carboxylic acid and alcohol when the ester shown below is hydrolyzed. + H20 3) Why is it important that the test tube be thoroughly dry before making esters? Use the principles of chemical equilibrium to explain your answer.
Draw a reaction showing the reactants (the ester and water) and the products (the alcohol and the carboxylic acid) for each ester below. You can google the structures of the esters. Ester 1 aspirin, Ester 2 benzocaine, Ester 3 gamma-butyrolactone
1. Characterize an ester functional group in terms of the following: a. The number of oxygen atoms that are presentb. The minimum number of carbon atoms that must be present 2. Differentiate the two hydrolytic reactions of esters. 3. Choose the correct answer. i. Which compound has the higher boiling point—CH3CH2CH2COOH or CH3CH2CH2COOCH3? Justify your answer. ii. Which compound is more soluble in water—methyl acetate or octyl acetate? Justify your answer. 4. True or False: Write True if the statement is correct and False if otherwise. i. Esters are formed by the reaction of a salt with an acid. ii. In such reactions, the —OR group from the alcohol replaces the —OH group in the carboxylic acid. iii. Esters are polar compounds, but they cannot form hydrogen bonds to each other. iv. Their boiling points are lower than those of alcohols and acids of similar molecular mass v. Esters cannot be converted back to carboxylic acids and alcohols under either acidic or basic conditions. vi.…
What is the name of the major product formed during the reaction between berzoyl chloride and phenol? a. phenyl benzoate b. benzyl ester C. cyclopentanoate d. benzyl phenoate e. benzenecarboxylic acid O a O b O c e
I. Complete the table. Classification of Carboxylic Acids and its derivatives No. Common Name Structure IUPAC Name 1. CH3CH2CH2COONA COOH(CH2)SCOOH 3. CH3CH2CH2CH2CH2COOH 4. C6HSCOOCOC6H5 5. CICOCH2CH2CH2CH2OH 6. CH3(CH2)7CONH2 7. CH3(CH2)3CH2COOCH2(CH2).CH3 CH3CH2OCOCH2CH2CH2CH2CH2CH2 8. CH3 9. CH3CH2CH2CH2CH2CH2CH2CH2COCI 10. H2NCOCH2CH2CH2CH3 2.
Which is not a carboxylic acid derivative? O A. amides O B. ethers O C. esters D. anhydrides
What type of chemical reaction does carboxylic acid undergo in the following situations? 1. production of carboxylate salts 2. reaction with acetyl chloride 3. one of the reactants in alcohol 4. alcohol used as reactant
Each of the following acids contains an additional type of functional group besides the carboxyl group. For each acid, specify the non-carboxyl functional group present. 1.Malic acid2. Tartaric acid