Concept explainers
(a)
Interpretation:
The preparation method for the given compound has to be given by taking ethyne as starting material.
Concept Introduction:
Acid Catalysed addition of water: When water is added to alkyne in the presence of an acid, the product formed will be an enol. Enol contains a double bond and an
If a carbonyl group is bonded to two alkyl groups, it is called as a
Conversion of terminal
(b)
Interpretation:
The preparation method for the given compound has to be given by taking ethyne as starting material.
Concept Introduction:
Deprotonation: The reaction in which proton is removed from the compound using reagents is known as deprotonation.
Different reagents are used for the deprotonation and one of the common reagent is sodium amide.
Lindlar catalyst: The catalyst is used for the hydrogenation of alkynes in a syn manner. This means both hydrogen are added on the same side across the triple bond and the product obtained will be a cis product.
Sodium in liquid ammonia: The catalyst is used for the formation of trans
(c)
Interpretation:
The preparation method for the given compound has to be given by taking ethyne as starting material.
Concept Introduction:
Deprotonation: The reaction in which proton is removed from the compound using reagents is known as deprotonation.
Different reagents are used for the deprotonation and one of the common reagent is sodium amide.
Lindlar catalyst: The catalyst is used for the hydrogenation of alkynes in a syn manner. This means both hydrogen are added on the same side across the triple bond and the product obtained will be a cis product.
Sodium in liquid ammonia: The catalyst is used for the formation of trans alkenes from alkynes. Because of its more reactivity towards triple bonds, the reaction will stop at the formation of alkenes.
Acid Catalysed addition of water: When water is added to alkyne in the presence of an acid, the product formed will be an enol. Enol contains a double bond and an
If a carbonyl group is bonded to two alkyl groups, it is called as a ketone. The enol formed in the acid catalysed addition of water will be easily converted into a ketone.
Conversion of terminal alkynes into enol: If we want to convert terminal alkyne into an enol, the presence of mercuric ion as a catalyst should be needed and the catalyst will increase the rate of the reaction.
(d)
Interpretation:
The preparation method for the given compound has to be given by taking ethyne as starting material.
Concept Introduction:
Deprotonation: The reaction in which proton is removed from the compound using reagents is known as deprotonation.
Different reagents are used for the deprotonation and one of the common reagent is sodium amide.
Lindlar catalyst: The catalyst is used for the hydrogenation of alkynes in a syn manner. This means both hydrogen are added on the same side across the triple bond and the product obtained will be a cis product.
Sodium in liquid ammonia: The catalyst is used for the formation of trans alkenes from alkynes. Because of its more reactivity towards triple bonds, the reaction will stop at the formation of alkenes.
(e)
Interpretation:
The preparation method for the given compound has to be given by taking ethyne as starting material.
Concept Introduction:
Deprotonation: The reaction in which proton is removed from the compound using reagents is known as deprotonation.
Different reagents are used for the deprotonation and one of the common reagent is sodium amide.
Lindlar catalyst: The catalyst is used for the hydrogenation of alkynes in a syn manner. This means both hydrogen are added on the same side across the triple bond and the product obtained will be a cis product.
Sodium in liquid ammonia: The catalyst is used for the formation of trans alkenes from alkynes. Because of its more reactivity towards triple bonds, the reaction will stop at the formation of alkenes.
(f)
Interpretation:
The preparation method for the given compound has to be given by taking ethyne as starting material.
Concept Introduction:
Deprotonation: The reaction in which proton is removed from the compound using reagents is known as deprotonation.
Different reagents are used for the deprotonation and one of the common reagent is sodium amide.
Lindlar catalyst: The catalyst is used for the hydrogenation of alkynes in a syn manner. This means both hydrogen are added on the same side across the triple bond and the product obtained will be a cis product.
Sodium in liquid ammonia: The catalyst is used for the formation of trans alkenes from alkynes. Because of its more reactivity towards triple bonds, the reaction will stop at the formation of alkenes.
Want to see the full answer?
Check out a sample textbook solutionChapter 7 Solutions
Organic Chemistry (8th Edition)
- What ketones are prepared by the following reactions?arrow_forwardShow how the following compound can be prepared from benzene:arrow_forwardAcetals are formed from the reaction of two alcohols with a carbonyl under acidic conditions. Acetal formation is faster with 1,2-ethanediol than with two methanol molecules. Choose the factor that explains the difference in reaction rates. A) The reaction with 1,2-ethanediol has a lower AH (enthalpy) of reaction. B) The reaction with 1,2-ethanediol has a higher AH (enthalpy) of reaction. C) The reaction with 1,2-ethanediol has a more favorable entropy of reaction.arrow_forward
- Starting from cyclohexanone, show how to make the two given products, include conditions to use in the reactions. CH3 CH3arrow_forwardDraw the major product(s) for reaction of methyl pentanoate with: NaOH, H2O, heat; then H3o*arrow_forwardPrepare the following compounds starting from benzaldehyde and the appropriate ketone. Provide reactions for preparing the ketones starting from aromatic hydrocarbon compounds.arrow_forward
- H₂SO4, H₂O Choose the enol(s) that can be formed from the following oxymercration reaction. OH ОН OH HgSO4 ОНarrow_forwardProvide reagents and conditions to produce the products indicated. EN OH H3C CH3 HO HOarrow_forwardWhat is the reduction product of the following compound with H2/Pd? A 2-propyl-1-cyclohexanol B 2-propenyl-1-cyclohexanol C2-propylcyclohexanone D 1-propyl-2-cyclohexanol What is the oxidation product of this compound? H' A ethanoic acid acetic acid propanoic acid D propanone What is the oxidation product of this compound? A 3,4-dimethylpentanoic acid B 2,3-dimethylpentanoic acid C2,3-dimethylpentanone 3,4-dimethylpentanonearrow_forward
- a) How would you synthesize the following compounds from cyclohexanone? b) CO₂Harrow_forwardEthyl butyrate, CH3CH2CH2CO2CH2CH3, is an artificial fruit flavor commonly used in the food industry for such flavors as orange and pineapple. Its fragrance and taste are often associated with fresh orange juice, and thus it is most commonly used as orange flavoring.It can be produced by the reaction of butanoic acid with ethanol in the presence of an acid catalyst (H+): CH3CH2CH2CO2H(l)+CH2CH3OH(l)H+⟶CH3CH2CH2CO2CH2CH3(l)+H2O(l) a) Given 7.70 g of butanoic acid and excess ethanol, how many grams of ethyl butyrate would be synthesized, assuming a complete 100% yield? b) A chemist ran the reaction and obtained 5.25 g of ethyl butyrate. What was the percent yield? c) The chemist discovers a more efficient catalyst that can produce ethyl butyrate with a 78.0% yield. How many grams would be produced from 7.70 g of butanoic acid and excess ethanol?arrow_forwardEthyl butyrate, CH3CH2CH2CO2CH2CH3, is an artificial fruit flavor commonly used in the food industry for such flavors as orange and pineapple. Its fragrance and taste are often associated with fresh orange juice, and thus it is most commonly used as orange flavoring.It can be produced by the reaction of butanoic acid with ethanol in the presence of an acid catalyst (H+): CH3CH2CH2CO2H(l)+CH2CH3OH(l)H+⟶CH3CH2CH2CO2CH2CH3(l)+H2O(l) Given 8.50 g of butanoic acid and excess ethanol, how many grams of ethyl butyrate would be synthesized, assuming a complete 100%yield? Express your answer in grams to three significant figures.arrow_forward