Concept explainers
Use the values of
a.
b.
c.
a)
Interpretation: Standard enthalpy change has calculated for given reaction.
Concept introduction
Standard Enthalpy change (
Answer to Problem 79E
Explanation of Solution
Given data
Standard state for given compound in the reaction are,
Substance and state |
To calculate standard enthalpy change.
The balanced equation is,
In generally,
Here,
=
=
b)
Interpretation: Standard enthalpy change has calculated for given reaction.
Concept introduction
Standard Enthalpy change (
Answer to Problem 79E
Explanation of Solution
Given data
Standard state for given compound in the reaction are,
Substance and state |
The standard state of ammonia gas, oxygen, methane, hydrogen cyanide and water vapour are given. By substituting the values in the standard enthalpy change equation the standard enthalpy change for the reaction calculated as
To calculate standard enthalpy change.
The balanced equation is,
=
=
The standard state of some compounds which present in the reaction are given. By substituting the values in the standard enthalpy change equation, the standard enthalpy change for the reaction calculated as
c)
Interpretation: Standard enthalpy change has calculated for given reaction.
Concept introduction
Standard Enthalpy change (
Answer to Problem 79E
Explanation of Solution
Given data
Standard state for given compound in the reaction are,
Substance and state |
|
To calculate standard enthalpy change.
The balanced equation is,
=
=
The standard state of some compounds which present in the reaction are given. By substituting the values in the standard enthalpy change equation, the standard enthalpy change for the reaction calculated as
Want to see more full solutions like this?
Chapter 6 Solutions
EBK CHEMISTRY
- A green plant synthesizes glucose by photosynthesis, as shown in the reaction: 6CO2(g) + 6H2O(l) C6H12O6(s) + 6O2(g) Animals use glucose as a source of energy: C6H12O6(s) + 6O2(g) 6CO2(g) + 6HO2(l) If we were to assume that both of these processes occur to the same extent in a cyclic process, what thermodynamic property must have a nonzero value?arrow_forwardThe formation of aluminum oxide from its elements is highly exothermic. If 2.70 g Al metal is burned in pure O2 to give A12O3, calculate how much thermal energy is evolved in the process (at constant pressure).arrow_forwardThermodynamics provides a way to interpret everyday occurrences. If you live in northern climates, one common experience is that during early winter, snow falls but then melts when it hits the ground. Both the formation and the melting happen spontaneously. How can thermodynamics explain both of these seemingly opposed events?arrow_forward
- 9.68 What are some features of petroleum that make it such an attractive fuel?arrow_forwardSolid NH4NO3 is placed in a beaker containing water at 25 C. When the solid has completely dissolved, the temperature of the solution is 23.5 C. (a) Was the process exothermic or endothermic? (b) Was the process spontaneous? (c) Did the entropy of the system increase? (d) Did the entropy of the universe increase?arrow_forwardThere are millions of organic compounds known, and new ones are being discovered or made at a rate of morethan 100,000 compounds per year. Organic compoundsburn readily in air at high temperatures to form carbondioxide and water. Several classes of organic compoundsare listed, with a simple example of each. Write a balanced chemical equation for the combustion in O2ofeach of these compounds, and then use the data inAppendix J to show that each reaction is product-favoredat room temperature. From these results, it is reasonable to hypothesize thatallorganic compounds are thermodynamically unstable inan oxygen atmosphere (that is, their room-temperaturereaction with O2(g) to form CO2(g) and H2O() isproduct-favored). If this hypothesis is true, how canorganic compounds exist on Earth?arrow_forward
- Use the values of Hf in Appendix 4 to calculate H for the following reactions. (See Exercise 77 .) a. b. SiCl4(l)+2H2O(l)SiO2(s)+4HCl(aq) c. MgO(s)+H2O(l)Mg(OH)2(s)arrow_forwardThe decomposition of ozone, O3, to oxygen, O2, is an exothermic reaction. What is the sign of q? If you were to touch a flask in which ozone is decomposing to oxygen, would you expect the flask to feel warm or cool?arrow_forwardCoal is used as a fuel in some electric-generating plants. Coal is a complex material, but for simplicity we may consider it to be a form of carbon. The energy that can be derived from a fuel is sometimes compared with the enthalpy of the combustion reaction: C(s)+O2(g)CO2(g) Calculate the standard enthalpy change for this reaction at 25C. Actually, only a fraction of the heat from this reaction is available to produce electric energy. In electric generating plants, this reaction is used to generate heat for a steam engine, which turns the generator. Basically the steam engine is a type of heat engine in which steam enters the engine at high temperature (Th), work is done, and the steam then exits at a lower temperature (Tl). The maximum fraction, f, of heat available to produce useful energy depends on the difference between these temperatures (expressed in kelvins), f = (Th Tl)/Th. What is the maximum heat energy available for useful work from the combustion of 1.00 mol of C(s) to CO2(g)? (Assume the value of H calculated at 25C for the heat obtained in the generator.) It is possible to consider more efficient ways to obtain useful energy from a fuel. For example, methane can be burned in a fuel cell to generate electricity directly. The maximum useful energy obtained in these cases is the maximum work, which equals the free-energy change. Calculate the standard free-energy change for the combustion of 1.00 mol of C(s) to CO2(g). Compare this value with the maximum obtained with the heat engine described here.arrow_forward
- For the reaction NO(g)+NO2(g)N2O3(g) , use tabulated thermodynamic data to calculate H and S. Then use those values to answer the following questions. (a) Is this reaction spontaneous at 25°C? Explain your answer. (b) If the reaction is not spontaneous at 25°C, will it become spontaneous at higher temperatures or lower temperatures? (c) To show that your prediction is accurate, choose a temperature that corresponds to your prediction in part (b) and calculate G . (Assume that both enthalpy and entropy are independent of temperature.)arrow_forwardFor the reaction TiCl2(s) + Cl2(g) TiCl4(), rG = 272.8 kj/mol-txn. Using this value and other data available in Appendix L, calculate the value of fG for TiCl2(s).arrow_forwardHow is the sign of q, heat, defined? How does it relate to the total energy of the system?arrow_forward
- ChemistryChemistryISBN:9781305957404Author:Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCostePublisher:Cengage LearningChemistry: The Molecular ScienceChemistryISBN:9781285199047Author:John W. Moore, Conrad L. StanitskiPublisher:Cengage Learning
- Chemistry: Principles and PracticeChemistryISBN:9780534420123Author:Daniel L. Reger, Scott R. Goode, David W. Ball, Edward MercerPublisher:Cengage LearningChemistry & Chemical ReactivityChemistryISBN:9781337399074Author:John C. Kotz, Paul M. Treichel, John Townsend, David TreichelPublisher:Cengage LearningChemistry & Chemical ReactivityChemistryISBN:9781133949640Author:John C. Kotz, Paul M. Treichel, John Townsend, David TreichelPublisher:Cengage Learning