Answered: ozone levels in urban areas reach…

ozone levels in urban areas reach unhealthy levels, residents are typically urged to avoid refueling their cars during daylight hours. Explain how this might help to reduce smog formation.

Chemistry for Engineering Students

3rd Edition

ISBN:9781285199023

Author:Lawrence S. Brown, Tom Holme

Publisher:Lawrence S. Brown, Tom Holme

Chapter11: Chemical Kinetics

Section: Chapter Questions

Problem 11.89PAE

See similar textbooks

Related questions

Q: Why chlorofluorocarbons (CFCs) are responsible for destroying ozone ?

A: Chlorofluorocarbons are chemical compounds made of chlorine, carbon and fluorine. These are…

Q: Explain what triggers the formation of the ozone hole over Antarctica.

Q: Match each pollutant with their final product in our atmosphere. SO2 NO₂ CO CH4 1. CO2 2. H₂SO4 3.…

A: Answer: In this question we have to identify the chemical reaction of the air pollutant that takes…

Q: would these chnages help to produce more ozone

A: I will give you a detailed explanation for the same. That's absolutely true that concentration,…

Q: Air pollution in the Mexico City metropolitan area is among the worst in the world. The…

A: Partial pressure in a mixture can be found using:

Q: Explain how ozone in the upper atmosphere functions to filter short-wavelength solar radiation, and…

A: Dear student I have given answer to your question in the image format.

Q: Some pollutants are difficult to break down and therefore accumulate in the environment. These are…

A: Pollutants are compounds in which pollutes the environment. They are toxic to living beings.…

Q: air pollution in the mexico city metropolitan area is among the worst in the world. the…

A: The pressure of a system is termed as the force that acts upon per unit area associated with the…

Q: Is it possible to create ozone with the technology we have today?

A: Stratospheric ozone is formed naturally through the interaction of solar ultraviolet (UV) radiation…

Q: Classify the listed properties of ozone (a pollutant in the lower atmosphere, but part of a…

A: a. Ozone is bluish in colour. It is a physical property. b. Ozone has pungent odour. It is a…

Q: Explain how ozone can be both beneficial and harmful?

A: good effects: ozone is “good” because it protects living things from ultraviolet radiation from the…

Q: Discuss the possible effects of the following on greenhouses gas chemistry. (b) CFCs cause further…

Q: Calculate The number of atoms 0.1g of ozone

A: We know that, 1 mol = 6.023×1023 number of molecules.

Q: Pick a source of (SO2) emissions and describe two ways (SO2) emissions from that source can be…

A: There are many sources of sulfur dioxide emission but one of the major sources is:

Q: Classify each of the listed properties of ozone (a pollutant in the lower atmosphere but part of a…

A: Physical properties are those properties that can be observed or measured without any change in…

Q: As of the writing of this text, EPA standards limit atmospheric ozone levels in urban environments…

A: Given that Area covered by the air above Los Angeles = 4000 sq. miles = 1.036 x 1010 m2 . and height…

Q: 11.4. a) Which layer contains the most ozone? b) How thick is the troposphere? c) What type of gas…

A: Given problem is based on earth atmosphere and how this atmosphere affects the climate of the earth.

Q: If gasoline produces only carbon dioxide and water when it burns completely, why is automobile…

A: We have to tell how automobile exhaust a source of air pollution.

Q: Explain why the concentration of CFCs increased in the atmosphere.

A: Chlorofluorocarbons(CFCs) are a chlorine-containing compound used in several appliances and cause…

Q: The vast majority of scientists believe that human activities are causing global warming. Describe…

A: Human activities causes global warming this can be explained by following phenomenon - 1) Due to…

Q: With respect to the chemical compounds involved, describe how smog is caused and what effects it may…

A: Smog is derived from two words –Smoke and fog. Two different types of smog are recognized:…

Q: Describe two ways that people can change their habits and choices to reduce their personal…

A: The two ways that people can change their habits and choices to reduce their personal greenhouse gas…

Q: What effect could a volcanic eruption have on the ozone layer? Use your knowledge of atmospheric…

A: The layer which is made up of ozone molecules that protects Earth from almost all the sun's harmful…

Q: What emissions from human activities lead to ozone depletion? What are the chlorine reactions that…

A: Ozone layer act as protective shield for earth's atmosphere and prevent harmful ultra violet (UV)…

Q: EXPLAIN: 1. What conclusion can you draw about the impact of environmental problems? 2. Is the…

A: Environmental problems are very huge problems on which all the humans have to focus if they have to…

Q: Climate change has impacted our planet in more ways than we can think. We can always do things…

A: In present time climate changes are rapid and it's due to excess emission of green house gases and…

Q: Give one main reason of ozone depletion?

A: Give one main reason for ozone depletion?

Q: Metal and its component are examples of what types of pollutants? A . inorganic B. Natural organic…

A: Pollutant :- A substance introduced into atmosphere by natural or human activity and exert harmful…

Q: Compare the effect of chlorination and ozone application in water treatment

A: Ozone and chlorination both are the process are of disinfection of water.

Q: 7) Explain how NOx and SOx gases contribute to acid rain. 8) Explain how CFCS contribute to the…

A: Answer - Acid rain - Acid rain, or acid deposition, is a broad term that includes any form of…

Q: Differentiate between London smog and Los Angeles smog?

A: Given terms, London smog and Los Angeles smog

Q: Classify the listed properties of ozone (a pollutant in the lower atmosphere, but part of a…

Q: Match each pollutant with their final product in our atmosphere. > SO₂ NO₂ CO CH4 1. CO2 2. H₂SO4 3.…

A: Pollutants - Pollutants like SO2 , CO , CH4 ,NO2 etc combine with water and oxygen to give hazardous…

Q: Answer the following question about natural gas. How is natural gas produced in nature? What keeps…

A: 1. Natural gas is produced deep inside the earth from the decomposition of organic matter. When the…

Q: When ozone levels in urban area reach unhealthy levels, residents are typically urged to avoid…

A: The chemical reactions that lead to the formation of smog are: Nitrogen dioxide breaks down in…

Q: Why does a smelly gas produced in a factory can move a long distance from where it was produced?

Q: Describe how the ozone layer forms and why it is important.

A: The ozone layer is present in the stratosphere layer of the atmosphere, ozone layer prevents the…

Q: What is smog? The London smog is caused in which season and time of the day?

A: Smog is a mixture of smoke (the collection of airborne particulates) and fog (vapor form of water).…

Q: Why is it important to continuously monitor the concentration of pollutants in the air?

A: The beginning stage of air quality observing is to initially contemplate if a zone has an air…

Concept explainers

Environmental Pollution

Environmental pollution occurs due to some unwanted alteration in the surroundings which results in unfavorable effects on all organisms of that surrounding.

Question

When ozone levels in urban areas reach unhealthy levels, residents are typically urged to avoid refueling their cars during daylight hours. Explain how this might help to reduce smog formation.

Expert Solution

This question has been solved!

Explore an expertly crafted, step-by-step solution for a thorough understanding of key concepts.

SEE SOLUTION Check out a sample Q&A here

Step 1

VIEW

Step 2

VIEW

Step 3

VIEW

Step by step

Solved in 3 steps

SEE SOLUTION Check out a sample Q&A here

Knowledge Booster

Learn more about

Need a deep-dive on the concept behind this application? Look no further. Learn more about this topic, chemistry and related others by exploring similar questions and additional content below.

Similar questions

When ozone levels in urban area reach unhealthy levels, residents are typically urged to avoid refuelingtheir cars during daylight hours. Explain how this might help to reduce smog formation?
Why is ground level ozone most likely to reach its highest concentrations on hot, sunny days during periods of heavy traffic in large cities?
As of the writing of this text, EPA standards limit atmospheric ozone levels in urban environments to 84 ppb. How many moles of ozone would there be in the air above Los Angeles County (an area about 4000 square miles; consider a height of 100 m above the ground) if ozone was at this concentration?
4. Photochemical smog is a type of air pollution in the troposphere of our planet produced when sunlight acts upon motor vehicle exhaust gases to form harmful substances such as ozone (O3). For example, nitrogen dioxide (NO2) reacts with atmospheric oxygen (O2) in the presence of light to produce ozone (O3) and nitrogen monoxide (NO).
9. Indicate the products are formed when the following compounds react with ozone. a. b. C. 0
Is it possible to create ozone with the technology we have today?
1. What are the three main types of greenhouse gases, what are their respective characterization factors or global warming potential? 2. What is meant by the efficiency of a solar panel (PV) and what are the implications for a solar farm? 3. How is energy extracted from wind and what are the implications for a wind farm? 4. For a wind turbine, what is the impact of the wind speed on the electricity production and how does the design of the wind turbine dictate its efficiency? What control strategies can be used to optimise the performance of wind turbines? How can energy be extracted geothermally. Explain how geothermal energy can be utilised to contribute towards heat demand and what is the role of co-produced water. 5. 6.
Question 6 Examine the graph below, which shows global emissions of ozone-depleting sub- stances from 1961 to 2014. Global Emissions of Ozone-Depleting Substances 1.4 million 1.2 million 1 million 800,000 600,000 400,000 Total emissions 200,000 Natural emissions 1961 1970 1980 1990 2000 2014 Years Source: Hegglin, M.L Fahey, D. W. McFarland, M. Montzka, S. A, & Nash, E. R. (2014) World Meteorological Organization, Emission (tonnes)
Which gas is not associated with the formation of acid rain? NO2 CONO SO3
What do you understand by Natural and Human Enhanced Greenhouse Effect? Discuss the causes and impacts of enhanced greenhouse effect.
Describe why ozone is more reactive than oxygen gas?
Given that the concentration of CH4 in the atmosphere is 1.8 ppm, calculate the total mass of this gas that is present in the atmosphere. Note that the total mass of the atmosphere is 5.1 x 1018 kg and that its average molar mass is 29.0 g/mol.