Consider the reaction:
Given that
Interpretation:
The standard free energy change for the formation of
Concept introduction:
All the energy available in the system that is utilized in doing useful work is called Gibbs free energy.
The standard free energy change is the change in free energy that occurs under the standard state condition.
The standard free energy of formation is defined as the free energy change that occurs when one mole of a compound is combined from its constituent elements with each in the standard state.
Answer to Problem 85AP
Solution:
a)
b)
c)
d)
Lightening helps in the production of better crops because there is formation of nitrates and nitrite with soil mineral, which are good fertilizers.
Explanation of Solution
Given information: The reaction is as follows:
Temperature
a)The standard free energy of formation of NO
The equation for the reaction of
The standard free energy change for the formation of
Here,
The Gibbs energy for the reaction is as follows:
The standard free energy of formation of any element in its stable allotropic form at
From appendix 2, the values of the standard free energy of formation of the compounds are as follows:
Substitute the values of the standard free energy of formation of the compoundsand
Therefore, thestandard free energy change for the formation of
b)
The equation for the reaction of
The equilibrium pressure constant is calculated by using the expression as follows:
Here,
Substitute the values of
Therefore, the equilibrium pressure constant is
Given information: The reaction is as follows:
Temperature
c)The equilibrium pressure for the given reaction
The equation for the reaction of
The standard enthalpy change of the reaction (
Here,
The enthalpy for the reaction is as follows:
From appendix 2, the values of the standard enthalpy change for the formation of the substances are as follows:
Substitute the values of the standard enthalpy change for the formation of the substances in the above expression as follows:
The temperatures are converted from degree Celsius to Kelvin as follows:
The equilibrium pressure for this reaction at a temperature of
Here,
Substitute the values of
The value of
Hence, the equilibrium pressure at a temperature of
d)Lightning helps to produce better crops
In the atmosphere, nitrogen molecules are present. Two nitrogen atoms are tightly boundedto each other. In lightening, electrical energy is generated, which has enough energy to break the bonds of the nitrogen atoms in the air. It combines with oxygen to form
The equation for the reaction of
Hence, lightening helps in the production of better crops because there is formation of nitrates and nitrite with soil mineral, which are fertilizers.
Want to see more full solutions like this?
Chapter 18 Solutions
Chemistry
- Adenosine triphosphate, ATP, is used as a free-energy source by biological cells. (See the essay on page 624.) ATP hydrolyzes in the presence of enzymes to give ADP: ATP(aq)+H2O(l)ADP(aq)+H2PO4(aq);G=30.5kJ/molat25C Consider a hypothetical biochemical reaction of molecule A to give molecule B: A(aq)B(aq);G=+15.0kJ/molat25C Calculate the ratio [B]/[A] at 25C at equilibrium. Now consider this reaction coupled to the reaction for the hydrolysis of ATP: A(aq)+ATP(aq)+H2O(l)B(aq)+ADP(aq)+H2PO4(aq) If a cell maintains a high ratio of ATP to ADP and H2PO4 by continuously making ATP, the conversion of A to B can be made highly spontaneous. A characteristic value of this ratio is [ATP][ADP][H2PO4]=500 Calculate the ratio [B][A] in this case and compare it with the uncoupled reaction. Compared with the uncoupled reaction, how much larger is this ratio when coupled to the hydrolysis of ATP?arrow_forwarda Calculate K1, at 25C for sulfurous acid: H2SO3(aq)H+(aq)+HSO3(aq) b Which thermodynamic factor is the most significant in accounting for the fact that sulfurous acid is a weak acid? Why?arrow_forwardActually, the carbon in CO2(g) is thermodynamically unstable with respect to the carbon in calcium carbonate(limestone). Verify this by determining the standardGibbs free energy change for the reaction of lime,CaO(s), with CO2(g) to make CaCO3(s).arrow_forward
- For the decomposition of formic acid, HCOOH(l)H2O(l)+CO(g) H = +29 kJ/mol at 25C. a Does the tendency of this reaction to proceed to a state of minimum energy favor the formation of water and carbon monoxide or formic acid? Explain. b Does the tendency of this reaction to proceed to a state of maximum entropy favor the formation of products or reactants? Explainarrow_forwardSilver carbonate, Ag2CO3, is a light yellow compound that decomposes when heated to give silver oxide and carbon dioxide: Ag2CO3(s)Ag2O(s)+CO2(g) A researcher measured the partial pressure of carbon dioxide over a sample of silver carbonate at 220C and found that it was 1.37 atm. Calculate the partial pressure of carbon dioxide at 25C. The standard enthalpies of formation of silver carbonate and silver oxide at 25C are 505.9 kJ/mol and 31.05 kJ/mol, respectively. Make any reasonable assumptions in your calculations. State the assumptions that you make, and note why you think they are reasonable.arrow_forwardUse the data in Appendix J to calculate rG andKPat 25 C for the reaction 2HBr(g)+Cl2(g)2HCl(g)+Br2() Comment on the connection between the sign of rG and the magnitude ofKP.arrow_forward
- A crucial reaction for the production of synthetic fuels is the production of H2 by the reaction of coal with steam. The chemical reaction is C(s) + H2O(g) CO(g) + H2(g) (a) Calculate rG for this reaction at 25 C, assuming C(s) is graphite. (b) Calculate Kp for the reaction at 25 C. (c) Is the reaction predicted to be product-favored at equilibrium at 25 C? If not, at what temperature will it become so?arrow_forwardWhat information can be determined from G for a reaction? Does one get the same information from G, the standard free energy change? G allows determination of the equilibrium constant K for a reaction. How? How can one estimate the value of K at temperatures other than 25C for a reaction? How can one estimate the temperature where K = 1 for a reaction? Do all reactions have a specific temperature where K = 1?arrow_forwardCobalt(II) chloride hexahydrate, CoCl26H2O, is a bright pink compound, but in the presence of very dry air it loses water vapor to the air to produce the light blue anhydrous salt CoCl2. Calculate the standard free-energy change for the reaction at 25C: CoCl26H2O(s)CoCl2(s)+6H2O(g) Here are some thermodynamic data at 25C: What is the partial pressure of water vapor in equilibrium with the anhydrous salt and the hexahydrate at 25C? (Give the value in mmHg.) What is the relative humidity of air that has this partial pressure of water? The relative humidity of a sample of air is Relativehumidity=partialpressureofH2O(g)inairvaporpressureofwater100 What do you expect to happen to the equilibrium partial pressure over the hexahydrate as the temperature is raised? Explain.arrow_forward
- Chemistry: An Atoms First ApproachChemistryISBN:9781305079243Author:Steven S. Zumdahl, Susan A. ZumdahlPublisher:Cengage LearningChemistryChemistryISBN:9781305957404Author:Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCostePublisher:Cengage Learning
- General Chemistry - Standalone book (MindTap Cour...ChemistryISBN:9781305580343Author:Steven D. Gammon, Ebbing, Darrell Ebbing, Steven D., Darrell; Gammon, Darrell Ebbing; Steven D. Gammon, Darrell D.; Gammon, Ebbing; Steven D. Gammon; DarrellPublisher:Cengage LearningChemistry & Chemical ReactivityChemistryISBN:9781133949640Author:John C. Kotz, Paul M. Treichel, John Townsend, David TreichelPublisher:Cengage LearningChemistry & Chemical ReactivityChemistryISBN:9781337399074Author:John C. Kotz, Paul M. Treichel, John Townsend, David TreichelPublisher:Cengage Learning