Consider the reaction
Given that ΔG° for the reaction at 25°C is 173.4 kJ/mol, (a) calculate the standard free energy of formation of NO and (b) calculate Kp of the reaction. (c) One of the starting substances in smog formation is NO. Assuming that the temperature in a running automobile engine is 1100°C, estimate Kp for the given reaction. (d) As farmers know, lightning helps to produce a better crop. Why?
Interpretation:
Calculate the standard free energy
Concept Introduction:
Standard free energy
Entropy
Homogeneous equilibrium: A homogeneous equilibrium involved has a everything present in the same phase and same conditions, for example reactions where everything is a gas, or everything is present in the same solution.
Kp and Kc: This equilibrium constants of gaseous mixtures, these difference between the two constants is that Kc is defined by molar concentrations, whereas Kp is defined by the partial pressures of the gasses inside a closed system.
Le Chatelier's Principle (Kp): In a closed system if there is an increase in pressure, then the equilibrium will shift towards the side of the reaction having smaller number of moles. The decrease in pressure the equilibrium will shift towards the side of the reaction with high moles of gas.
To find: Calculate the
Answer to Problem 15.95QP
The equilibrium constant (Kp), standard free energy values
Explanation of Solution
(a)
Calculate and analyze the standard free energy
Consider the following equation (1)
The equilibrium constant is related to the to the standard free energy change by the followed above equation (1). Than the given statement of values (KP, R and T) are substituted in same equation.
Let us consider the statement (b)
The given equilibrium concentration reaction the different reactants and products all exists in the single phase and this equilibrium reaction expression contains single conditions like gases phase, so this equilibrium reaction homogenies equilibrium reaction. The thermodynamic terms are constant can also be represented by Kp, Kc, R, T and
To find: Calculate the standard enthalpy changes (
(b)
Calculate the standard enthalpy changes
The given reaction is homogenous equilibrium reaction proceeds in same conditions (for example both reactant and product are proceeds in gas phase). Further the total equilibrium that is given N2 and two products are generated in
Statement (d): The equilibrium reactions lightening supply the energy necessary to derive this reaction, concerting the two most abundant gases in the atmosphere into
Want to see more full solutions like this?
Chapter 15 Solutions
GEN COMBO CHEMISTRY: ATOMS FIRST; ALEKS 360 2S ACCESS CARD CHEMISTRY:ATOMS FIRST
Additional Science Textbook Solutions
Chemistry: The Central Science (14th Edition)
Chemistry
Chemistry
Thermodynamics, Statistical Thermodynamics, & Kinetics
Chemistry
Chemistry: A Molecular Approach
- a Calculate K1, at 25C for sulfurous acid: H2SO3(aq)H+(aq)+HSO3(aq) b Which thermodynamic factor is the most significant in accounting for the fact that sulfurous acid is a weak acid? Why?arrow_forwardAdenosine triphosphate, ATP, is used as a free-energy source by biological cells. (See the essay on page 624.) ATP hydrolyzes in the presence of enzymes to give ADP: ATP(aq)+H2O(l)ADP(aq)+H2PO4(aq);G=30.5kJ/molat25C Consider a hypothetical biochemical reaction of molecule A to give molecule B: A(aq)B(aq);G=+15.0kJ/molat25C Calculate the ratio [B]/[A] at 25C at equilibrium. Now consider this reaction coupled to the reaction for the hydrolysis of ATP: A(aq)+ATP(aq)+H2O(l)B(aq)+ADP(aq)+H2PO4(aq) If a cell maintains a high ratio of ATP to ADP and H2PO4 by continuously making ATP, the conversion of A to B can be made highly spontaneous. A characteristic value of this ratio is [ATP][ADP][H2PO4]=500 Calculate the ratio [B][A] in this case and compare it with the uncoupled reaction. Compared with the uncoupled reaction, how much larger is this ratio when coupled to the hydrolysis of ATP?arrow_forwardActually, the carbon in CO2(g) is thermodynamically unstable with respect to the carbon in calcium carbonate(limestone). Verify this by determining the standardGibbs free energy change for the reaction of lime,CaO(s), with CO2(g) to make CaCO3(s).arrow_forward
- For the decomposition of formic acid, HCOOH(l)H2O(l)+CO(g) H = +29 kJ/mol at 25C. a Does the tendency of this reaction to proceed to a state of minimum energy favor the formation of water and carbon monoxide or formic acid? Explain. b Does the tendency of this reaction to proceed to a state of maximum entropy favor the formation of products or reactants? Explainarrow_forwardSilver carbonate, Ag2CO3, is a light yellow compound that decomposes when heated to give silver oxide and carbon dioxide: Ag2CO3(s)Ag2O(s)+CO2(g) A researcher measured the partial pressure of carbon dioxide over a sample of silver carbonate at 220C and found that it was 1.37 atm. Calculate the partial pressure of carbon dioxide at 25C. The standard enthalpies of formation of silver carbonate and silver oxide at 25C are 505.9 kJ/mol and 31.05 kJ/mol, respectively. Make any reasonable assumptions in your calculations. State the assumptions that you make, and note why you think they are reasonable.arrow_forwardWhat information can be determined from G for a reaction? Does one get the same information from G, the standard free energy change? G allows determination of the equilibrium constant K for a reaction. How? How can one estimate the value of K at temperatures other than 25C for a reaction? How can one estimate the temperature where K = 1 for a reaction? Do all reactions have a specific temperature where K = 1?arrow_forward
- Consider the decomposition of red mercury(II) oxide under standard state conditions.. 2HgO(s,red)2Hg(l)+O2(g) (a) Is the decomposition spontaneous under standard state conditions? (b) Above what temperature does the reaction become spontaneous?arrow_forwardConsider the reaction of 1 mol H2(g) at 25C and 1 atm with 1 mol Br2(l) at the same temperature and pressure to produce gaseous HBr at these conditions. If this reaction is run in a controlled way to generate work, what is the maximum useful work that can be obtained? How much entropy is produced in this case?arrow_forwardCobalt(II) chloride hexahydrate, CoCl26H2O, is a bright pink compound, but in the presence of very dry air it loses water vapor to the air to produce the light blue anhydrous salt CoCl2. Calculate the standard free-energy change for the reaction at 25C: CoCl26H2O(s)CoCl2(s)+6H2O(g) Here are some thermodynamic data at 25C: What is the partial pressure of water vapor in equilibrium with the anhydrous salt and the hexahydrate at 25C? (Give the value in mmHg.) What is the relative humidity of air that has this partial pressure of water? The relative humidity of a sample of air is Relativehumidity=partialpressureofH2O(g)inairvaporpressureofwater100 What do you expect to happen to the equilibrium partial pressure over the hexahydrate as the temperature is raised? Explain.arrow_forward
- Use the data in Appendix J to calculate rG andKPat 25 C for the reaction 2HBr(g)+Cl2(g)2HCl(g)+Br2() Comment on the connection between the sign of rG and the magnitude ofKP.arrow_forwardFor each of the following processes, identify the systemand the surroundings. Identify those processes that arespontaneous. For each spontaneous process, identify theconstraint that has been removed to enable the process to occur: Ammonium nitrate dissolves in water. Hydrogen and oxygen explode in a closed bomb. A rubber band is rapidly extended by a hangingweight. The gas in a chamber is slowly compressed by aweighted piston. A glass shatters on the floor.arrow_forwardCalculate G at 355 K for each of the reactions in Question 17. State whether the reactions are spontaneous.arrow_forward
- Chemistry: An Atoms First ApproachChemistryISBN:9781305079243Author:Steven S. Zumdahl, Susan A. ZumdahlPublisher:Cengage LearningChemistryChemistryISBN:9781305957404Author:Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCostePublisher:Cengage Learning
- Chemistry by OpenStax (2015-05-04)ChemistryISBN:9781938168390Author:Klaus Theopold, Richard H Langley, Paul Flowers, William R. Robinson, Mark BlaserPublisher:OpenStaxGeneral Chemistry - Standalone book (MindTap Cour...ChemistryISBN:9781305580343Author:Steven D. Gammon, Ebbing, Darrell Ebbing, Steven D., Darrell; Gammon, Darrell Ebbing; Steven D. Gammon, Darrell D.; Gammon, Ebbing; Steven D. Gammon; DarrellPublisher:Cengage LearningChemistry: The Molecular ScienceChemistryISBN:9781285199047Author:John W. Moore, Conrad L. StanitskiPublisher:Cengage Learning