Which of the following is TRUE regarding Zn(NH3)4²+? O a. Zn(NH3)4²+ is colorless due to the filled 3d orbitals of Zn²+ O b. Zn(NH3)42+ is colorless due to the high field splitting energy of the tetrahedral compound. O c. Replacing ammonia in Zn(NH3)4²+ with ethylenediamine changes the transmitted color of the solution closer to red. O d. Both A and C

Which of the following is TRUE regarding Zn(NH3)4²+? O a. Zn(NH3)4²+ is colorless due to the filled 3d orbitals of Zn²+ O b. Zn(NH3)42+ is colorless due to the high field splitting energy of the tetrahedral compound. O c. Replacing ammonia in Zn(NH3)4²+ with ethylenediamine changes the transmitted color of the solution closer to red. O d. Both A and C

Chemistry & Chemical Reactivity

9th Edition

ISBN:9781133949640

Author:John C. Kotz, Paul M. Treichel, John Townsend, David Treichel

Publisher:John C. Kotz, Paul M. Treichel, John Townsend, David Treichel

Chapter22: The Chemistry Of The Transistion Elements

Section22.5: Bonding In Coordination Compounds

Problem 2RC

See similar textbooks

Similar questions

Two different compounds are known with the formula Pd(py)2Cl2, but there is only one compound with the formula Zn(py)2Cl2. The symbol py is for pyridine, a mono-dentate ligand. Explain the differences in the Pd and Zncompounds.
a. In the absorption spectrum of the complex ion Cr(NCS)63, there is a band corresponding to the absorption of a photon of light with an energy of 1.75 104 cm-1. Given 1 cm1 = 1.986 1023 J, what is the wavelength of this photon? b. The CrNC bond angle in Cr(NCS)63 is predicted to be 180. What is the hybridization of the N atom in the Ncs- ligand when a Lewis acid-base reaction occurs between Cr3+ and NCs- that would give a 180 CrNC bond angle? Cr(NCS)63 undergoes substitution by ethylenediamine (en) according to the equation Cr(NCS)63+2enCr(NCS)2(en)2++4NCS Does Cr(NCS)2(en)2+ exhibit geometric isomerism? Does Cr(NCS)2(en)2+ exhibit optical isomerism?
Trimethylphosphine, P(CH3)3, can act as a ligand by donating the lone pair of electrons on the phosphorus atom. If trimethylphosphine is added to a solution of nickel(Il) chloride in acetone, a blue compound that has a molecular mass of approximately 270 g and contains 21.5% Ni, 26.0% Cl, and 52.5% P(CH3)3 can be isolated. This blue compound does not have any isomeric forms. What are the geometry and molecular formula of the blue compound?
Draw the Crystal field diagrams for [Fe(NO2)6]4- and [FeF6]3-. State whether each complex is high spin or low spin, paramagnetic or diamagnetic, and compare ?oct to P for each complex.
Which of the following electron distributions will be expected for [Rh(en)3]3+? Rhº:[Kr]5s²4d7 O A. (tzg^leg? O B. (t2gle® O C.(t2le,° D. (t2g)?(eg)ª
Which of the following pairs are coordination isomers? a. [Pt Br2Cl2(H20)2]CO3 and [PtBr2Cl2]CO3 2H20 b. [Cr(H,0)a][PtCla] and [PtCl,(H,0)2][C•CI,(H,0)2] C. None of the choices |d. [PtCl4(H2O)2]Cl2 and [PtCl3(H20)2]Cl3
Which of the following electron distributions will be expected for [Rh(en)3]3+? Rhº: [Kr]5s?4d7 A. (t2g)^leg}? B. (tzg)°leg}3 O C. (tzg)leg)° D. (tzg)^leg}*
Identify the first row transition metal that satisfies the requirements given:a. [M(H2O)6]2+ having two unpaired electrons (list all possibilities).b. [M(NH3)6]3+ that may have splitting of spin-allowed absorption band as a consequence of distortion of excited state (provide one example).c. [M(H2O)6]2+ expected to have the palest color in aqueous solution.
Determine the formal bond order between the two metals in the complex [Ru2(mu-O2CCH3)4]2* O Double O Triple O Quadruple O Single O Zero
Identify the first-row transition metal for the following 18-electron species: a. [M(CO)3(PPh3)]¯¯ c. (n*-CgHg)M(CO), b. HM(CO)5 d. [(n-C5H5)M(CO)3]2 (assume single M-M bond)
Determine the valence electrons count for the following complexes: CO 9e" [FI] Co. OC Co X X H₂N ANH3 PH H₂N NH3 NH3 ? A 6 x 2 =12 3+ d". 6 8+8=16 ? C
Draw the d orbital diagram for the following molecules/ions and calculate CFSE energy. a. Cr(H2O)62+ b. Co(NH3)62+ c. Mn(NH3)62+ d. NiI42- e. Mn(CN)63- f. PtCl42-