What was the internal heat when the change in energy was 750 J and the work by the system was 200 J? 1500 J 950 J O 550 J 3.75 J

You did an experiment in which you found that 59.8 J was required to raise the temperature of 25.0 g of ethylene glycol (a compound used as antifreeze in automobile engines) by 1.00 K. Calculate the specific heat capacity of ethylene glycol from these data.

Gasohol, a mixture of gasoline and ethanol, C2H5OH, is used as automobile fuel. The alcohol releases energy in a combustion reaction with O2. C2H5OH(l)+3O2(g)2CO2(g)+3H2O(l) If 0.115 g ethanol evolves 3.62 kJ when burned at constant pressure, calculate the combustion enthalpy for ethanol.

Under what circumstances is the heat of a process equal to the enthalpy change for the process?

A sample of benzene, C6H6, weighing 3.51 g was burned in an excess of oxygen in a bomb calorimeter. The temperature of the calorimeter rose from 25.00C to 37.18C. If the heat capacity of the calorimeter and contents was 12.05 kJ/C, what is the value of q for burning 1.00 mol of benzene at constant volume and 25.00C? The reaction is C6H6(l)+152O2(g)6CO2(g)+3H2O(l) Is q equal to U or H?

In which of the following systems is(are) work done by the surroundings on the system? Assume pressure and temperature are constant. a. 2SO2(g)+O2(g)2SO3(g) b.CO2(s)CO2(g) c. 4NH3(g)+7O2(g)4NO2(g)+6H2O(g) d.N2O4(g)2NO2(g) e.CaCO3(s)CaCO(s)+CO2(g)

The temperature of the cooling water as it leaves the hot engine of an automobile is 240 F. After it passes through the radiator it has a temperature of 175 F. Calculate the amount of heat transferred from the engine to the surroundings by one gallon of water with a specific heat of 4.184 J/g oC.

A sample of ethanol, C2H5OH, weighing 2.84 g was burned in an excess of oxygen in a bomb calorimeter. The temperature of the calorimeter rose from 25.00C to 33.73C. If the heat capacity of the calorimeter and contents was 9.63 kJ/C, what is the value of q for burning 1.00 mol of ethanol at constant volume and 25.00C? The reaction is C2H5OH(l)+3O2(g)2CO2(g)+3H2O(l) Is q equal to U or H?

The statement Energycan beneithercreatednor destroyedis sometimes used as an equivalent statement of the first law of thermodynamics. There areinaccuracies to the statement, however. Restate it tomake it less inaccurate.

Which of the following processes will lead to a decrease in the internal energy of a system? (1) Energy is transferred as heat to the system; (2) energy is transferred as heat from the system; (3) energy is transferred as work done on the system; or (4) energy is transferred as work done by the system. (a) 1 and 3 (b) 2 and 4 (c) 1 and 4 (d) 2and3