What is the correct name for the following structure? O (RE)-3-ethyl-5-methylnon-7-en-3-yne ○ (R.Z)-3-ethyl-5-methylnon-2-en-6-yne (RE)-3-ethyl-5-methylnon-2-en-6-yne O (S.Z)-3-ethyl-5-methylnon-2-en-6-yne

What is the IUPAC name for the molecule shown below? CI (4R,5Z)-4-chlorohept-5-en-2-yne (2E,4S)-4-chlorohept-2-en-5-yne (4R, 5E)-4-chlorohept-5-en-2-yne O (2E,4S)-4-chlorooct-2-en-5-yne

q43

28. What is the systematic (IUPAC) name for the compound shown below? OH (A) 2-ethyl-1,3-dimethyl-1-hexanol (B) 3-ethyl-4-methyl-2-heptanol (C) 3-ethyl-2-hydroxy-4-methylheptane (D) 3-hydroxyethyl-4-methylheptane

34

estion 12 of 33 Write down the common (not IUPAC) names of the organic molecules that would be released if this molecule were hydrolyzed: 0 CH2-0-C-(CH2)16-CH3 о о O= = = CH-O-C-(CH2)4-CH=CH-CH2-CH=CH-CH2-CH=CH-(CH2)4-CH3 Separate each name with a comma. You will find useful information in the ALEKS Data resource. Question 13 of 33 Write down the common (not IUPAC) names of the organic molecules that would be released if this molecule were hydrolyzed: CH₂-01 CH-O ང CH₂-01 Separate each name with a comma. You will find useful information in the ALEKS Data resource. Question 14 of 33 Draw the skeletal ("line") structure of the triacylglycerol that could be formed from lauric acid.

What is the name of the following compound? H3C H H CH3 CH CH3 CH3 3-chloro-3-isopropyl-2-methylbutane 1-chloro-1-isopropyl-2-methylpropane 3-chloro-3-isopropyl-2-methylpropane 1-chloro-1,1-diisopropylmethane 3-chloro-2,4-dimethylpentane

1. Provide acceptable IUPAC names for the following compounds HO, CI- НО. OCH3 2. Provide an acceptable structure for the following IUPAC names. 2,5-dichloroanisole (1S,2R,5S)-1,2,5-triphenylcyclohexane

Please provide the reason why the chosen answer is correct! HOW MANY different types of DIETHYLBENZENE are there, and what are their names? three: 1,3-diethylbenzene, ortho-diethylbenzene, m-diethylbenzene one: diethylbenzene three: meta-diethylbenzene, 1,2-diethylbenzene, p-diethylbenzene four: 1,1-diethylbenzene, m-diethylbenzene, 1,4-diethylbenzene, ortho-diethylbenzene two: cis-diethylbenzene, trans-diethylbenzene