Warm-up question Using data from the Appendix, calculate AG° (in kJ) at 65 °C for the reaction: N2O(1 atm)+ H2(1 atm) N2(1 atm) + H2O(l) + (Recall, all gases at 1 atm for standard conditions) Answer: Calculate AG (in kJ) at 65 °C for the reaction: N2O(0.0028 atm) + H2(0.12 atm) → N₂(700.6 atm) + H2O(l) Answer: Assume that the AH° and AS° of vaporization do not change significantly with temperature. Calculate the vapor pressure of CH3 54 °C (in atm). CH3OH (1) - CH3OH(g)... AH° = 38.0 kJ and AS° = 112.9 J/K (Don't round unil the end. Using the exponent enlarges any round-off error.) Hint given in feedback. Answer: Calculate the vapor pressure of Hg at 14 °C (in atm). Hg(1) Hg(g)... AH° = 61.32 kl and AS° = 98.83 J/K Answer:

Warm-up question Using data from the Appendix, calculate AG° (in kJ) at 65 °C for the reaction: N2O(1 atm)+ H2(1 atm) N2(1 atm) + H2O(l) + (Recall, all gases at 1 atm for standard conditions) Answer: Calculate AG (in kJ) at 65 °C for the reaction: N2O(0.0028 atm) + H2(0.12 atm) → N₂(700.6 atm) + H2O(l) Answer: Assume that the AH° and AS° of vaporization do not change significantly with temperature. Calculate the vapor pressure of CH3 54 °C (in atm). CH3OH (1) - CH3OH(g)... AH° = 38.0 kJ and AS° = 112.9 J/K (Don't round unil the end. Using the exponent enlarges any round-off error.) Hint given in feedback. Answer: Calculate the vapor pressure of Hg at 14 °C (in atm). Hg(1) Hg(g)... AH° = 61.32 kl and AS° = 98.83 J/K Answer:

Chemistry

10th Edition

ISBN:9781305957404

Author:Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCoste

Publisher:Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCoste

Chapter6: Thermochemistry

Section: Chapter Questions

Problem 104AE: Nitrogen gas reacts with hydrogen gas to form ammonia gas .Consider the reaction between nitrogen...

See similar textbooks

Similar questions

From the values for G f given in Appendix 1, calculate G at 25C for each of the reactions in Question 19.
Given the following data 2O3(g) 3O2(g)H = 427 kJ O2(g) 2O(g)H = 495 kJ NO(g) + O3(g) NO2(g) + O2(g)H = 199 kJ Calculate H for the reaction NO(g) + O(g) NO2(g)
Using values of fH and S, calculate rG for each of the following reactions at 25 C. (a) 2 Na(s) + 2 H2O() 2 NaOH(aq) + H2(g) (b) 6 C(graphite) + 3 H2(g) C6H6() Which of these reactions is (are) predicted to be product-favored at equilibrium? Are the reactions enthalpy- or entropy-driven?
On the basis of your experience, predict which reactions are spontaneous: (a) PbO2(s)Pb(s)+O2(g)(b) N2(l)N2(g) at 25C (c) C6H12O6(s)C6H12O6(l) at 25C (d) Ca2+(aq)+CO32(aq)CaCO3(s)
The bombardier beetle uses an explosive discharge as a defensive measure. The chemical reaction involved is the oxidation of hydroquinone by hydrogen peroxide to produce quinone and water: C6H4(OH)2(aq) + H2O2(aq) C6H4O2(aq) + 2H2O(l) Calculate H for this reaction from the following data: C6H4(OH)2(aq) C6H4O2(aq) + H2(g)H = 177.4 kJ H2(g) + O2(g) H2O2(aq)H = 191.2 kJ H2(g) + 12O2(g) H2O(g)H = 241.8 kJ H2O(g) H2O(l)H = 43.8 kJ
For the reaction NO(g)+NO2(g)N2O3(g) , use tabulated thermodynamic data to calculate H and S. Then use those values to answer the following questions. (a) Is this reaction spontaneous at 25°C? Explain your answer. (b) If the reaction is not spontaneous at 25°C, will it become spontaneous at higher temperatures or lower temperatures? (c) To show that your prediction is accurate, choose a temperature that corresponds to your prediction in part (b) and calculate G . (Assume that both enthalpy and entropy are independent of temperature.)
Use the data in Appendix G to calculate the standard entropy change for H2(g) + CuO(s) H2O() + Cu(s)
Calculate H and G for the following reactions at 25C, using thermodynamic data from Appendix C; interpret the signs of H and G. a 2PbO(s)+N2(g)2Pb(s)+2NO(g)\ b CS2(l)+2H2O(l)CO2(g)+2H2S(g)
Nitrogen gas reacts with hydrogen gas to form ammonia gas .Consider the reaction between nitrogen and hydrogen as depicted below: a. Draw what the container will look like after the reaction has gone to completion. Assume a constant pressure of 1 atm. b. Is the sign of work positive or negative, or is the value of work equal to zero for the reaction? Explain your answer.
Predict the sign of S, if possible, for each of the following reactions. If you cannot predict the sign for any reaction, state why. a 2SO3(g)2SO2(g)+O2(g) b C2H5OH(l)+3O2(g)2CO2(g)+3H2O(l) c P4(g)P4(s) d 2NaHCO3(s)Na2CO3(s)+H2O(g)+CO2(g)
Calculate H and G for the following reactions at 25C, using thermodynamic data from Appendix C; interpret the signs of H and G. a Al2O3(s)+2Fe(s)Fe2O3(s)+2Al(s) b COCl2(g)+H2O(l)CO2(g)+2HCl(g)
For the reaction TiCl2(s) + Cl2(g) TiCl4(), rG = 272.8 kj/mol-txn. Using this value and other data available in Appendix L, calculate the value of fG for TiCl2(s).