Q: To prepare an ether from an alkyl halide by a nucleophilic substitution reaction, what are the two…
A: Nucleophilic substitution reaction is a series of organic reactions in which one nucleophile…
Q: What two alkenes give rise to attached alcohol as the major product of acid-catalyzed hydration?
A:
Q: Complete each hydrogenation reaction. catalyst a. CH2=CH-CH3 + H2 catalyst b. CH3-CH-CH=CH2 + H2 ČH3…
A: Complete the following hydrogenation reaction. (a) (b) (c)
Q: 19. is symbolic notation of manner in which the electrons of its atoms are distributed over the…
A: The electronic configuration gives information about the group or the element.
Q: What reagent(s) needs to be added to cause the following transformation? CI ? NaOH NaOH, NaOCH3, or…
A:
Q: The –OH, -OR, -NH2 groups cannot be substituted directly by electrophilic substitution on the…
A:
Q: Write IUPAC name of the major product formed as a result of the reaction indicated CH3 H* + H,0 ?
A:
Q: You identified aldehydes or ketones by converting them into hydrazones. Which of the following…
A:
Q: Aliphatic compound Homologous series Type of reaction(s) addition/substitution/redox Propan-1-ol…
A: Propan-1-ol: Alcohol Propan-2-ol: Alcohol 2-methylpropan-2ol: Alcohol Ethanal: Aldehyde (carbonyl)…
Q: Ketones are able to be the substrate of a reduction reaction. Furthermore, ketones also are able to…
A: Answer: In this statement, it is being mentioned that, oxidation of ketone can be performed and…
Q: ---- ---- 1- r-..- What is a lachrymator? A tear inducing chemical a catalyst OA chemical that can…
A:
Q: HCI ןווי^י
A: The question is based on the concept of organic reactions. We have to determine Products &…
Q: Draw the structure of the organic product formed when the given compounds undergo the three-step…
A:
Q: nts is the alkylation of aldehydes vith methyl magnesium bromide
A:
Q: When HCl is added to an alkene in a Markovnikov reaction, the product will have a higher boiling…
A: There are two main factors that govern boiling point: 1. Molecular weight of compound (In general bp…
Q: Click the "draw structure" to launch the drawing utility. Draw the product formed when the following…
A: Ans
Q: What alkene can be used to prepare attached alcohol as the exclusive product of a two-step…
A: The given product of hydroboration-oxidation is:
Q: major substitution and major elimination products
A: The substitution and elimination products can be shown below, Rxn G
Q: What is a BH3 anti-markovnikov reaction in organic chemistry?
A:
Q: (a) Indicate all possible alkenes are used to produce the following alky halide. Then, write the…
A: Given incomplete reaction is : Indicate all the alkenes which produce the following alkyl halide =…
Q: Please explain the chosen letter. Which of the following molecules are capable of being converted…
A: Answer of the question given below,
Q: Q10:- Explain how Esters are more reactive than amides in nucleophilic acyl substitution reactions.
A: The structure of ester and amide are as follows:
Q: conc. Br Br HBr(aq) Ph Ph Ph + racemic racemic
A: We have to a circle around the major organic product you expect to form as a result of the…
Q: Name each of the following substituted ammonium and substituted anilinium ions. a. CH3-NH2-CH3…
A: NOTE : Since you've posted multiple sub-parts,we'll solve first three sub-parts for you. To get the…
Q: Write the structural formula of the organic product for the given reaction between an alkyne and an…
A: Given reaction is alkylation reaction of alkyne.
Q: the Aldehydes or Ketones from an Acetal or OH OH Aldehydes
A: Acetals and hemiacetals are madeup from aldehyde or ketone reacting with Alcohols.
Q: Complete each hydrogenation reaction. catalyst a. CH;=CH-CH; + H2 catalyst b. CH3-CH-CH=CH, + H2…
A: Complete each the following hydrogenation reaction.
Q: (R-MgX) what reagent is this?
A:
Q: QUESTION 5 Fill in the blanks and follow the directions to complete the 2-step synthesis given…
A: We have given that Conversion Aldehyde to alkyl hailde To know intermediate we first we have to…
Q: 2 mol CH₂CH₂CH₂ OCH₂CH₂ NaOCH, CH,OH (11) SEP
A: Two molecules of ester having alpha hydrogen undergo condensation when treated with CH3ONa and CH3OH…
Q: create a synthesis reaction for N,N-dimethylethanamide from alkene, alkane, a halogen, and ammonia.…
A: GIVEN:-
Q: The type of intermediate formed when HgSO4/H2SO4/H2O is added to an alkyne is: a.an alcohol b.an…
A: An alkyne reacts with HgSO4/ H2SO4/ H2O to form ketone.
Q: Draw the structure of the organic product formed when the following compounds undergo the three-step…
A:
Q: List some common nucleophiles used in nucleophilic substitution reactions ?
A: A nucleophile is a nucleus loving group that will be electron rich. Nucleophiles attack…
Q: What explains why many aldehydes and ketones can undergo self- condensation reactions in basic…
A:
Q: Explain why pentane-2,4-dione forms two different alkylation products (A or B) when the number of…
A: Alkylation of carbonyl compounds can be done by treating it with a base followed by the treatment of…
Q: For each of the following molecules, put a box around the nucleophilic atom(s). MgBr SH H.
A:
Q: Classify the attached transformation as substitution, elimination, or addition.
A: The given reaction is
Q: Draw the product that is formed when the compound shown below is treated with an excess of HCI. Draw…
A: The compound taken is ethanol. Reaction between this alcohol and excess HCl is considered.
Q: Draw the structures of the two carbocation intermediates that might form during the reaction of…
A:
Q: I. Using Markovnikov's rule, predict the predominant product in each of the following addition…
A:
Q: Na / NH3 H2 Lindlar Catalyst
A:
Q: To make ethyl acetate, what substrate and reagents and solvent are needed? Example: acetic aicd +…
A: to make ethyl acetate we need acetyl chloride and ethanol reaction is given below
Q: 3) Please draw the structures that correspond to omitted structure for each of the following…
A: Since we only answer up to 3 sub-parts, we’ll answer the first 3. Please resubmit the question and…
Q: Using Markovnikov's rule, predict the predominant product in each of the following additic reaction…
A: According to markovnikov's rule nucleophile (negative specie) added in that double bonded carbon…
Q: Fill in the blanks: H₂C. CH₂ H₂C. CH3 Br2 H₂C CH₂ FeBr3 H₂C CH₂ After the bromination reaction, the…
A:
Q: What two alkenes give rise to attached alcohol as the major product of acid-catalyzed hydration?
A: Alcohol can be formed by the hydration of alkenes in the presence of am acid. The given alcohol is…
Q: onsider the following reaction to answer questions 29 and 30. Y ethanol HO + A£NO3 + HO + AgX + HNO3…
A: Nucleophile is neutral or negatively charged species which donates its electrons to form new bonds.…
Step by step
Solved in 2 steps with 1 images
- Draw the tautomer of this enol. Include all lone pairs. Ignore inorganic byproducts. :OH: H3O+ Draw TautomerDraw the tautomer of this ketone. Include all lone pairs. Ignore inorganic byproducts. :0: H3O+ 0 ✔4. WHAT ARE IMINES? HOW ARE THEY FORMED? 5. WHAT IS GRIGNARD REACTION? WHAT CONSTITUTES A GRIGNARD REAGENT? 6. WHAT IS KETO-ENOL TAUTOMERIZATION?
- Explain why methyl trifluoroacetate, CF3CO2CH3, is more reactive than methyl acetate, CH3CO2CH3, in nucleophilic acyl substitution reactions.Draw the organic product(s) formed when CH3CH₂CH₂OH is treated with each reagent. a. H₂SO4 d. HBr g. TsCl, pyridine b. NaH h. [1] NaH; [2] CH₂CH₂Br e. SOCI₂, pyridine f. PBr3 c. HCI + ZnCl₂ Hint: NaH deprotonates the alcohol forming an alkoxideIdentify the alcohol reactant needed to produce each of the following compounds as the major product of an alcohol dehydration reaction. H,SO, Alcohol → CH3–CH=CH–CH3 180°C a. H,SO, Alcohol → CH,=CH-CH–CH3 180°C CH3 b. H,SO, Alcohol CH3-CH-CH2–0–CH,-CH–CH3 140°C ČH3 с. H,SO, Alcohol CH,=CH-CH,–CH3 180°C H,SO, Alcohol CH;-C=C-CH3 180°C CH3 CH3 e.
- Draw the structure(s) of the major organic product(s) of the following reaction. yen H CH3Mgl 1. Dry Et₂O 2. aqueous HCI at 0°Draw the structure(s) of the major organic product(s) of the following reaction. 1. KMnO4/ aq. NaOH 2. aqueous H₂SO4Give the systematic (IUPAC) names for these molecules. Boononon cnolonongron. НаСНз CHОССH2СH2СНCHЗ CH3 phenyl propanoate |4-methyl pentane methanoat Incorrect. You mixed up the acyl and alkoxy portions of the molecule. Name the alkoxy part first, followed by the acyl part.
- Ethyl butyrate, CH3CH2CH2CO2CH2CH3CH3CH2CH2CO2CH2CH3, is an artificial fruit flavor commonly used in the food industry for such flavors as orange and pineapple. Its fragrance and taste are often associated with fresh orange juice, and thus it is most commonly used as orange flavoring. It can be produced by the reaction of butanoic acid with ethanol in the presence of an acid catalyst (H+H+): CH3CH2CH2CO2H(l)+CH2CH3OH(l)H+⟶CH3CH2CH2CO2CH2CH3(l)+H2O(l)CH3CH2CH2CO2H(l)+CH2CH3OH(l)⟶H+CH3CH2CH2CO2CH2CH3(l)+H2O(l) A chemist ran the reaction and obtained 5.40 g of ethyl butyrate. What was the percent yield, The chemist discovers a more efficient catalyst that can produce ethyl butyrate with a 78.0% yield. How many grams would be produced from 7.45g of butanoic acid and excess ethanol?Ethyl butyrate, CH3CH2CH2CO2CH2CH3CH3CH2CH2CO2CH2CH3, is an artificial fruit flavor commonly used in the food industry for such flavors as orange and pineapple. Its fragrance and taste are often associated with fresh orange juice, and thus it is most commonly used as orange flavoring. It can be produced by the reaction of butanoic acid with ethanol in the presence of an acid catalyst (H+H+): CH3CH2CH2CO2H(l)+CH2CH3OH(l)H+⟶CH3CH2CH2CO2CH2CH3(l)+H2O(l) Part A Given 7.30 gg of butanoic acid and excess ethanol, how many grams of ethyl butyrate would be synthesized, assuming a complete 100%% yield? Express your answer in grams to three significant figures. Part B A chemist ran the reaction and obtained 5.95 gg of ethyl butyrate. What was the percent yield? Express your answer as a percent to three significant figures. Part C The chemist discovers a more efficient catalyst that can produce ethyl butyrate with a 78.0%% yield. How many grams would be produced from 7.30 gg of…Ethyl butyrate, CH3CH2CH2CO2CH2CH3CH3CH2CH2CO2CH2CH3, is an artificial fruit flavor commonly used in the food industry for such flavors as orange and pineapple. Its fragrance and taste are often associated with fresh orange juice, and thus it is most commonly used as orange flavoring. It can be produced by the reaction of butanoic acid with ethanol in the presence of an acid catalyst (H+H+): CH3CH2CH2CO2H(l)+CH2CH3OH(l)H+⟶CH3CH2CH2CO2CH2CH3(l)+H2O(l) Given 8.45 gg of butanoic acid and excess ethanol, how many grams of ethyl butyrate would be synthesized, assuming a complete 100%% yield? Express your answer in grams to three significant figures. A chemist ran the reaction and obtained 5.50 gg of ethyl butyrate. What was the percent yield? Express your answer as a percent to three significant figures. The chemist discovers a more efficient catalyst that can produce ethyl butyrate with a 78.0%% yield. How many grams would be produced from 8.45 gg of butanoic acid and excess…