Reaction of 2 pentanol with zncl2/hcl? Write missing reactant, substrate, reaction conditions, product and reaction mechanism.

For the reaction shown, in blank '1', use IUPAC nomenclature and name the major product of the reaction shown. In blank '2; use IUPAC nomencature and name the minor product of the reaction shown. In the 3rd blank, select the name of the type of reaction. Is it halogenation, hydration, hydrogenation, or hydrohalogenation. HBr ?

6. a) Complete the two reactions below. Provide full chemical reactions with structures and names of reactants and all products. Include necessary catalysts. b) What type of reaction is it? N-ethylbutanamide + H₂O → What type of reaction is this? Drawings: (product names)

7. a) Complete the two reactions below. Provide full chemical reactions with structures and names of reactants and all products. Include necessary catalysts. b) What type of reaction is it? N-ethylprobutanamide + H₂O → What type of reaction is this? Drawings: (product names)

Payli

Start with condensed structural formula CH3-CH(OH)-CH(CH3)-CH2-CH(CH3)2 and react it first with H2SO4 and high heat, to produce a major substrate product. Then, take that major substrate product, and use it as the substrate of the next reaction, by reacting it with Br2 (in the presence of CH2Cl2 solvent), to produce the FINAL MAJOR substrate product.   The complete correct condensed structural formula for the major substrate product after reaction step 1 is  ___________.  (If no new product is formed in this step, type "no reaction.") The complete correct condensed structural formula for the final major substrate product (after reaction step 2) is __________ .  (If no new product is formed in this step, type "no reaction.")

Draw a structural formula for the major organic product(s) of the reaction shown below.

5A In the following reactions, mixtures of alkenes and ethyl ethers are formed. Draw their structures. Explain which is or are likely to be the main product(s) in each reaction. In case of formation of two isomers of alkenes, explain which is formed in greater proportion CH3 ofi H3C- -Br CH3 EtOH