In the metric system, energy is measured in Joules. In the diagram below, "kJ" stands for kiloJoules (1 kJ = 1000 Joules). The amount of energy released in the kJ. [remember the previous exothermic reaction illustrated below is question: it's just how much lower the products are than the reactants.] Energy Activation 250 kJ energy 50 kJ Reactants 200 kJ Heat AH evolved 100 kJ Products 100 kJ Reaction

In the metric system, energy is measured in Joules. In the diagram below, "kJ" stands for kiloJoules (1 kJ = 1000 Joules). The amount of energy released in the kJ. [remember the previous exothermic reaction illustrated below is question: it's just how much lower the products are than the reactants.] Energy Activation 250 kJ energy 50 kJ Reactants 200 kJ Heat AH evolved 100 kJ Products 100 kJ Reaction

Chemistry

10th Edition

ISBN:9781305957404

Author:Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCoste

Publisher:Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCoste

Chapter17: Spontaneity, Entropy, And Free Energy

Section: Chapter Questions

Problem 16Q: Consider the following potential energy plots: a. Rank the reactions from fastest to slowest and...

See similar textbooks

Similar questions

9.61 Silane, SiH4, burns according to the reaction, SiH4+2O2SiO2+2H2O , with H=1429 kJ. How much energy is released if 15.7 g of silane is burned?
Explain in your own words what is meant by the term entropy. Explain how both matter spread and energy spread are related to the concept of entropy.
9.20 State the first law of thermodynamics briefly in your own words.
Explain what happens as a reaction starts with G0 (negative) and reaches the point where G=0.
xplain why aluminum cans make good storage containers for soft drinks. Styrofoam cups can be used to keep coffee hot and cola cold. How can this be?
Thermodynamics provides a way to interpret everyday occurrences. If you live in northern climates, one common experience is that during early winter, snow falls but then melts when it hits the ground. Both the formation and the melting happen spontaneously. How can thermodynamics explain both of these seemingly opposed events?
The overall reaction that occurs when sugar is metabolized is C12H22O11(s)+12O2(g)12CO2(g)+11H2O(l) For this reaction, H° is -5650 kJ and G° is -5790 kJ at 25°C. (a) If 25% of the free energy change is actually converted to useful work, how many kilojoules of work are obtained when one gram of sugar is metabolized at body temperature, 37°C? (b) How many grams of sugar would a 120-lb woman have to eat to get the energy to climb the Jungfrau in the Alps, which is 4158 m high? ( w=9.79103mh, where w= work in kilojoules, m is body mass in kilograms, and h is height in meters.)
9.58 For the reaction C2H2(g)+2H2(g)C2H6,H=136 kJ. What are the ratios that can be defined between moles of substances and energy?
Coal is used as a fuel in some electric-generating plants. Coal is a complex material, but for simplicity we may consider it to be a form of carbon. The energy that can be derived from a fuel is sometimes compared with the enthalpy of the combustion reaction: C(s)+O2(g)CO2(g) Calculate the standard enthalpy change for this reaction at 25C. Actually, only a fraction of the heat from this reaction is available to produce electric energy. In electric generating plants, this reaction is used to generate heat for a steam engine, which turns the generator. Basically the steam engine is a type of heat engine in which steam enters the engine at high temperature (Th), work is done, and the steam then exits at a lower temperature (Tl). The maximum fraction, f, of heat available to produce useful energy depends on the difference between these temperatures (expressed in kelvins), f = (Th Tl)/Th. What is the maximum heat energy available for useful work from the combustion of 1.00 mol of C(s) to CO2(g)? (Assume the value of H calculated at 25C for the heat obtained in the generator.) It is possible to consider more efficient ways to obtain useful energy from a fuel. For example, methane can be burned in a fuel cell to generate electricity directly. The maximum useful energy obtained in these cases is the maximum work, which equals the free-energy change. Calculate the standard free-energy change for the combustion of 1.00 mol of C(s) to CO2(g). Compare this value with the maximum obtained with the heat engine described here.
Calculate H for each of the following reactions using the data in Appendix 4: 4Na(s)+O2(g)2Na2O(s)2Na(s)+2H2O(l)2NaOH(aq)+H2(g)2Na(s)+CO2(g)Na2O(s)+CO(g) Explain why a water or carbon dioxide fire extinguisher might not be effective in putting out a sodium fire.
Ethylene, C2H2, a byproduct from the fractional distillation of petroleum, is fourth among the 50 chemical compounds produced commercially in the largest quantities. About 80% of synthetic ethanol is manufactured from ethylene by its reaction with water in the presence of a suitable catalyst. C2H2(g)+H2O(g)C2H5OH(l) Using the data in the table in Appendix G, calculate H for the reaction.
Explain why each of the following chemical equations is not a correct formation reaction: 4Al( s )+3 O 2 ( g )2 Al 2 O 3 ( s ) N 2 ( g )+ 3 2 H 2 ( g ) NH 3 ( g ) 2Na( s )+O( g ) Na 2 O( s )