Answered: If an ideal gas has a pressure of 6.85…

If an ideal gas has a pressure of 6.85 atm, a temperature of 91.94 °C, and a volume of 88.45 L, how many moles of gas are in the sample? n = mol

Chemistry: Matter and Change

1st Edition

ISBN:9780078746376

Author:Dinah Zike, Laurel Dingrando, Nicholas Hainen, Cheryl Wistrom

Publisher:Dinah Zike, Laurel Dingrando, Nicholas Hainen, Cheryl Wistrom

Chapter13: Gases

Section13.2: The Ideal Gas Law

Problem 29PP

See similar textbooks

Related questions

Q: -37.1 Celsius to Fahrenheit round to 3 significant digits

A: Celsius serves as the standard measurement for temperature in both practical and scientific…

Q: None

A: Step 1:For the three compounds, the nitrogen is connected to one carbon thus, it is a primary…

Q: dont provide handwriting solution ...

A: The objective of the question is to find the missing values in the table for the concentration of…

Q: Arrange the following compounds from least reactive to most reactive toward nucleophilic addition. I…

A: Nucleophiles are species that are identified to be electron-rich and show a tendency to attack the…

Q: Question 2 Provide the correct IUPAC name for the compound below. Answer: Answer NH2 NH2

A: To determine the IUPAC name for the compound, Identify the longest carbon chain that contains the…

Q: 1.What mass spectral resolution is required to differentiate dibutylphthalate (MW = 278.343) and…

A: Mass spectral resolution is the measure of the ability to distinguish between two peaks of slightly…

Q: Please explain mechanism. G.

A: Step 1: Step 2: Step 3: Step 4:

Q: Can you include the species please

A: Step 1:KC3H5O3 is potassium lactate. It will dissociate to potassium ions (K+ ) and lactate ions (…

Q: How many peptide bonds are in the below peptide O + HN-CH-CNH-CHC-NH-CH-c-o + CH₂ CH₂OH CH2(CH2)3NH3…

A: Thank You.

Q: Draw the Lewis structure of the following ions, and predict the ionic structure. (Indicate the…

A: Lewis structure Lewis structures are diagrams that show the bonding between atoms of a molecule as…

Q: Provide the products of the following acid-base reactions: 요오 ii OH OH OMe e OH OH

Q: -1 38. Aniline, C6H5NH2, when reacted with picric acid gives a derivative with an absorptivity of…

A: Given: ϵ=134cm−1⋅g−1⋅L;C=1.00x10−4M;b=1.00cm;MC6H5NH2=93.13g/molStep 1: Write the Beer's Law…

Q: 4. Oxygen Binding A related process that can occur in these complexes is oxygen binding.…

A: The objective of the question is to determine the oxidation states, electron counts, and ligand…

Q: I need help calculating solubility for this question. thank you C. Calcium Fluoride, CaF2 (aka,…

A: The objective of the question is to calculate the concentrations of:

Q: 3. Draw the reaction for the bromination of 3-methylpentane. (May have multiple products)

Q: Highlight each of the positions on the benzene ring that you expect will be most likely to react by…

A: The objective of the question is to identify the positions on a benzene ring that are most likely to…

Q: 13. Which of the following changes will increase the reaction rate? A. an increase in the…

A: Step 1:The correct answer is:D. an increase in the concentration of reactantsExplanation:The rate of…

Q: An unknown white powder have been seized by the police on the country border. The chemical analysis…

A: The objective of the given question is propose analytical strategy to establish whether the powder…

Q: (a) Use retrosynthetic analysis to devise a synthetic route to the following molecule 16: Ph-N Ph ΝΗ…

A: The objective of the question is to predict the following Propose a retrosynthetic method to…

Q: 2. What are the expected major products (A and B) for the following reaction sequence? AICI 3, CI…

A: Step 1:

Q: Write the quillibrium expression for 2NO(g) + Br2(g)---2NOBr(g)

A: The objective of the question is to write the equilibrium expression for the given chemical…

Q: If an electron has an uncertainty in its velocity of 2.30 m/s, what is the uncertainty (in meters)…

Q: Devise a synthesis for your assigned compound using organic reagents no larger than two or three…

A: The target molecule contains a cyclohexane ring fused with a pyrrolidine ring, and an acetyl group…

Q: following reactions. Give the major organic product or missing starting material for the 1)…

A: Given reactions and draw the major product.Aldol condensation reaction is there.LDA is a base that…

Q: Diamonds: Complete the roadmap below. A B 1. NaOCH3 2. H3O+ F 1. MeLi (excess) (hard Nuc) 2. H3O+…

A: COMPLETE ROADMAP :MECHANISM :A = Ethyl formate (HCOOEt)B = Methyl acetate ( CH3COOMe)These two…

Q: Write a balanced half-reaction for the oxidation of bismuth ion (Bi³+) to bismuth oxide ion…

A: Half-reaction is a part of the overall reaction representing either an oxidation or a reduction…

Q: A bar of gold measures 0.127 m x 0.0483 m x 0.0155 m. How many gallons of water have the same mass…

Q: A chemistry graduate student is given 100. mL of a 1.70M hydrocyanic acid (HCN) solution.…

A: The volume of the solution = Concentration of HCN = of =

Q: What ratio of NaCN to HCN is needed to prepare a pH 9.90 buffer? (Ka of HCN is 4.9 × 10⁻¹⁰)

A: The objective of this question is to find the ratio of sodium cyanide (NaCN) to hydrogen cyanide…

Q: Add explaintion each step

A: The reaction of pyruvate with lactate dehydrogenase (LDH) during lactic acid fermentation forms…

Q: Predict the product for the following reaction. To preview the image MeO. CHO heat + MeO MeO. ± OA…

A: Step 1: Step 2: It the the cyclo-addition reaction of pericyclic. Step 3: Step 4:

Q: Show the mechanism of the following reaction to obtain the product of 2 moles of an alkyl halide: 2…

A: Step 1:

Q: Draw structural formulas for the diene and dienophile that combine in a Diels-Alder reaction to form…

A: Step 1: To solve this question, we need to draw the structural formulas for the diene and…

Q: make 100.0 mL of either 1.0 M or 0.10 M ethanol (aqueous). Start with a stock ethanol solution that…

A: Thank YouPlease Rate if this solution helps you

Q: Naming and Drawing Organic Molecules Recognizing different skeletal structures How many different…

Q: 2. Rank the bolded-H in the following series of compounds from most (1) to least (5) acidic. You do…

A: The acidic strength of a substance depends on the stability of the conjugate base formed. The higher…

Q: 1. Draw the mechanism and products for the following synthetic sequence. OH 1) TMSCI, Et3N Br 2) Mg…

A: TMS PROTECTION MECHANISM(SCHEMATIC):TMS DE-PROTECTION MECHANISM(SCHEMATIC):

Q: ΚΗ Consider the following reaction which has the observed kinetic isotope effect = 1.5. kD Cy2 "PH Δ…

Q: Payalben

A: Given: masssample=7.91g;V=33.3mL;[BrO3−]=0.135M;MSb=121.76g/molStep 1: Write the…

Q: Write the equillibrium expression for C(s) + 2N2O(g) CO2(g) + 2N2(g)

A: The objective of the question is to write the equilibrium expression for the given chemical…

Q: Consult the table below and answer the questions that follow. The table below shows the equilibrium…

A: Le Chatelier's principle suggests that when a system at equilibrium is disturbed by changing factors…

Q: According to the following graph, the activity of the enzyme decreases more sharply at high…

A: I. As temperature is increased, the substrate binding slowly becomes poorer. This is true. At high…

Q: None

Q: Expand the structure and name the compound H₂C CH,CH CH₂ CH(CHCH 2-bromo-2-ethyloctane…

A: The Newman projection is used to understand the 3-dimensional structure of a molecule.In the Newman…

Q: The Ksp for LaF3 is 2.0 x 10-19. What is the solubility of LaF, in water in moles per liter (Molar…

Q: Please provide appropriate reagents to achieve the conversion of B into α,ẞ-unsaturated ester C over…

A: Given is organic synthesis reaction.Here, we need to find out reagents for conversion of B to C.

Q: ASAP PLEASE

A: (a)-Cycloaddition reaction:- A cycloaddition reaction is a reaction where two or more unsaturated…

Q: None

Q: Which buffer will have the greatest capacity resistance to changes in pH upon the addition of…

A: The objective of this question is to evaluate the concept of buffer capacity, which refers to the…

Q: The ion concentrations reported for a water below are all mg/L as CaCO3. Ca² = 200.00; Mg2+ = 420;…

A: The objective of this question is to perform calculations and conversions based on provided ion…

Question

If an ideal gas has a pressure of 6.85 atm, a temperature of 91.94 °C, and a volume of 88.45 L, how many moles of gas are in
the sample?
n =
mol

AI-Generated Solution

AI-generated content may present inaccurate or offensive content that does not represent bartleby’s views.

Unlock instant AI solutions

Tap the button
to generate a solution

Click the button to generate
a solution

SEE SOLUTION

Similar questions

Calculate the molar mass of a gas if a 0.165-g sample at 1.22 atm occupies a volume of 34.8 mL at 50 C.
A 39.6-mL sample of gas is trapped in a syringe and heated from 27 C to 127 C. What is the new volume (in mL) in the syringe if the pressure is constant?
The atmosphere in a sealed diving bell contained oxygen and helium. If the gas mixture has 0.200 atm of oxygen and a total pressure of 3.00 atm, calculate the mass of helium in 10.0 L of the gas mixture at 40C.
How would the graph in Figure 9.12 change if the number of moles of gas in the sample used to determine the curve were doubled?
Silane, SiH4, is the silicon analogue of methane, CH4. It is prepared industrially according to the following equations: Si(s)+3HC1(g)HSiCl3(l)+H2(g)4HSiCl3(l)SiH4(g)+3SiCl4(l) a. If 156 mL HSiCl3 (d = 1.34 g/mL) is isolated when 15.0 L HC1 at 10.0 atm and 35C is used, what is the percent yield of HSiCl3? b. When 156 mL HSiCl3 is heated, what volume of SiH4 at 10.0 atm and 35C will be obtained if the percent yield of the reaction is 93.1%?
What is the molar mass of a gas if 0.281 g of the gas occupies a volume of 125 mL at a temperature 126 C and a pressure of 777 torr?