Question 10.d of 14SubmitM Cu2* as the second half cellCu²*(aq) + 2 e¯ → Cu(s) E°red=0.337 VThe measured cell potential whenthe water sample was placed intothe silver side of the cell was0.0925 V.Given the standard cell potential forthis cell is 0.115 V, and themeasured cell potential is 0.0925,what is the concentration ofchloride ions in the solution?| M123C79.+/-x 10 0LO00 Question 10.d of 14SubmitA student wishes to determine thechloride ion concentration in awater sample at 25 °C using agalvanic cell constructed with agraphite electrode and a half-cell ofAGCI(s) + e¯ → Ag(s) + Cl"(aq)E°red = 0.2223 VAnd a copper electrode with 0.500M Cu2* as the second half cellCu²*(aq) + 2 e → Cu(s) E°red=0.337 VThe measured cell potential whenthe water sample was placed intoM123C79.+/-x 10 0LO00

The standard reduction potential is measured under the following conditions as the 298 K…

Answered: Given the standard cell potential for…

Given the standard cell potential for this cell is 0.115 V, and the measured cell potential is 0.0925, what is the concentration of chloride ions in the solution?

Chemistry

9th Edition

ISBN:9781133611097

Author:Steven S. Zumdahl

Publisher:Steven S. Zumdahl

Chapter18: Electrochemistry

Section: Chapter Questions

Problem 153CP: Consider the following galvanic cell: A 15 0-mole sample of NH is added to the Ag compartment...

See similar textbooks

Related questions

Q: Calculate the cell potential for the galvanic cell in w

Q: Calculate for the standard cell potential, Eo, for the cell.

A: Answer

Q: Consider the electrolysis of tin (II) sulphate during which tin is deposited at one electrode and…

A: A numerical problem based on electrolysis, which is to be accomplished.

Q: How is equilibrium constant of a reaction related to standard cell potential?

A: How is equilibrium constant of a reaction related to standard cell potential?

Q: What is the calculated value of the cell potential at 2

Q: What unit is used to measure the magnitude of electrical current? What unit is used to measure the…

A: The unit used to measure the magnitude of electrical current is Amperes.The unit used to measure the…

Q: How do I calculate the cell potential of this situation?

A: We have given a galvanic cell in which [Ti3+] = 0.02723 M [TiO2+] = 0.00146 M pH = 3 ESHE = 0.00V…

Q: For the following reactions, determine the standard cell potential, the cell potential, ΔG and ΔG°…

A: a)

Q: Calculate the standard cell potential, ?∘cell, for the equation Zn(s)+F2(g)⟶Zn2+(aq)+2F−(aq) Use…

Q: 1. What is a cell potential? 2. In what way does a galvanic cell becomes an electrolytic cell?

A: Galvanic cell is the spoteneous redox reaction where chemical energy transferred to electrical…

Q: Calculate the standard cell potential of the following cell at 25°C:

A: From electrochemical cells standard reduction potential (SRP) values of Pd and Cu electrodes are…

Q: (iii) Standard Hydrogen Electrode (SHE) is used to measure standard potential of electrodes.

A: This is the concept of electrochemistry

Q: A concentration cell similar to the one shown is composed of two Mg electrodes and solutions of…

A: A electrochemical cell is used is used convert chemical energy to electrical energy it involves a…

Q: In a galvanic cell, a full redox reaction takes place, one half-reaction at each electrode. How is…

Q: a galvanic cell is constructed of a standard half-zinc element and a chromium electrode immersed in…

A: Given information: Standard half-zinc element

Q: What will be the potential of a cell constructed of a sta

Q: .What happens to the standard cell potential of a battery when temperature increases? A.The…

A: The potential of an electrode to lose or gain electrons is referred to as its electrode potential.…

Q: Calculate the standard cell potential for this reaction.

A: Here, we have to find the standard cell potential for the given reaction using the standard…

Q: What is electrode potential?

A: Electrode potential is to be defined.

Q: d. Calculate the standard cell potential, AE".

A: the cell potential is defined as the difference between the potential of the two half cell in an…

Q: Determine the overall reaction and its standard cell potential at 25 °C for the reaction involving…

A: The galvanic cell involves the conversion of the energy associated with the redox chemical reaction…

Q: In an electrolytic cell, does the reaction of electrolysis of water take place in a standard state?

A: Here we to explain whether the reaction of elctrolysis of water takes place in standard state or…

Q: Calculate the standard potential for the cell.

A: The first step is to determine the cell potential at its standard state — concentrations of 1 mol/L…

Q: What is the EMF of a galvanic cell if the standard reduction potential of the reduction…

Q: How is the cell potential of an electrochemical cell related to the potentials of the half-cells?

A: An electrochemical cell or a galvanic cell is a device that can generate electricity due to the…

Q: Using the Standard Reduction Potential Table, use half-reaction potentials to identify whether the…

Q: Given the following cell notation for a galvanic cell, calculate the cell potential. Mg(s)|Mg²+ (aq)…

Q: At 298 K a cell reaction has a standard cell potential of +0.17 V. The equilibrium constant for the…

A: Given: T = Temperature in K = 298 K E = standard emf = 0.17 V K = equilibrium constant = 5.5 X 105…

Q: B) Calculate standard cell potential (E°).

A: B. Standard cell potential Eo = reduction potential of cathode + oxidation potential of anode From…

Q: The Nernst equation can be used to calculate... A. cell potentials from standard cell potentials…

A: According to the nernst equation, the cell potential is given as Ecell = E0cell - (0.0591/n) log(Q)…

Q: standard reduction potential, standard oxidation potential, and standard cell potential. Explain…

Q: What do you mean by ( i) negative standard electrode potential and(ii) positive standard electrode…

A: Standard electrode potential is defined as the potential of the electrode at the standard conditions…

Q: How is cell potential affected when the concentration of the reactants are decreased from standard…

A: The correct option is (c): The cell potential will increase, but later decrease.

Q: Calculate the standard cell potential and note whether the reaction is spontaneous under standard…

A: The more positive reduction potential of reduction reactions are more spontaneous. When viewing a…

Q: Will the potential of the galvanic cell change if we add the same amount of water to the electrolyte…

A: Cell potential is given by Nernst equation , which is as: Ecell = Eocell - RTnFlnQ Cell potential…

Q: Using the provided standard reduction potentials, which of the following cells is an example of a…

A: One with smaller or negative value will be anode and one with positive will be cathode .

Q: In an electroplating operation, the cell potential is sometimes 0 V. Why is zero potential possible…

A: In this question we need to illustrate the fact that cell potential for an electroplating cell can…

Q: If a solution of CuCl2 is electrolyzed, what reaction will occur at the anode when the minimum…

A: In the electrolysis process, the cations move towards the cathode and the anions move towards the…

Q: The electrolyte concentration in M at which an electrochemical cell is at its standard state.

A: The electrolyte concentration should have to be unity (1M) at its standard state

Q: Cu"taa) Sn (aa) Cus Consider a cell: Sn in which the concentration of [Cu2*] and (Sn2] are both 2M.…

Q: Calculate the standard free-energy change of a voltaic cell with a potential of 0.35 V under…

A: Given data: E0cell = 0.35V no of moles(n) = 2moles of electron formula used: ∆G0 = -nFE0cell Where…

Concept explainers

Potentiometric Titrations

Potentiometric titration is one of the important titration methods and is mainly carried out to characterize acid solutions. It follows a method similar to that of the normal titration technique, but the main difference is that there is no indicator used in the potentiometric titrations. Instead of using an indicator, electrodes are employed for monitoring the whole titration process. A scientist named Robert Behrend did the potentiometric titration for the first time, and it was done using the mercurous solution and potassium chloride.

Question

Expert Solution

This question has been solved!

Explore an expertly crafted, step-by-step solution for a thorough understanding of key concepts.

This is a popular solution!

SEE SOLUTION Check out a sample Q&A here

Step 1

Step 2

Step 3

Step 4

Trending now

This is a popular solution!

Step by step

Solved in 4 steps

SEE SOLUTION Check out a sample Q&A here

Knowledge Booster

Learn more about

Need a deep-dive on the concept behind this application? Look no further. Learn more about this topic, chemistry and related others by exploring similar questions and additional content below.

Similar questions

Halide ions can he deposited at a silver anode, the reaction being Ag(s) + X- AgX(s) +e- Suppose that a cell was formed by immersing a silver anode in an analyte solution that was 0.0250 M Cl-,Br-, and I -ions and connecting the half-cell to a saturated calomel cathode via a salt bridge. (a) Which halide would form first and at what potential? Is the cell galvanic or electrolytic? (b) Could I- and Br- be separated quantitatively? (Take 1.00 l0-5 M as the criterion for quantitative removal of an ion.) If a separation is feasible, what range of cell potential could he used? (c) Repeat part (b) for I- and Cl-. (d) Repeat part (b) for Br- and Cl-.
The half-cells Ag+(aq. 1.0 M)|Ag(s) and H+(aq, ? M)|H2(1.0 bar) are linked by a salt bridge to create a voltaic cell. With the silver electrode as the cathode, a value of 0.902 V is recorded tor kcell at 298 K. Determine the concentration of H+ and the pH of the solution.
Calculate the standard cell potential of the following cell at 25C. Sn(s)Sn2+(aq)I2(aq)I(aq)
Consider the following galvanic cell: A 15 0-mole sample of NH is added to the Ag compartment (assume 1.00 L of total solution after the addition). The silver ion reacts with ammonia to form complex ions as shown: Ag+(aq)+NH3(aq)AgNH3+(aq)K1=2.1103AgNH3+(aq)+NH3(aq)Ag(NH3)2+(aq)K2=8.2103 Calculate the cell potential after the addition of 15.0 moles of NH3.
What is the standard cell potential you would obtain from a cell at 25C using an electrode in which I(aq) is in contact with I2(s) and an electrode in which a chromium strip dips into a solution of Cr3(aq)?
The cell potential of the following cell at 25C is 0.480 V. ZnZn2+(1M)H+(testsolution)H2(1atm)Pt What is the pH of the test solution?
Calculate the cell potential of a cell operating with the following reaction at 25C, in which [Cr2O32] = 0.020 M, [I] = 0.015 M, [Cr3+] = 0.40 M, and [H+] = 0.60 M. Cr2O72(aq)+6I(aq)+14H+(aq)2Cr3+(aq)+3I2(s)+7H2O(l)
What is the cell potential (Ecell) of a spontaneous cell that is run at 25C and contains [Cr3+] = 0.10 M and [Ag+] = 1.0 104 M?
What is the cell potential of the following cell at 25C? Ni(s)Ni2+(1.0M)Sn2(1.5104M)Sn(s)
What is the voltage of a concentration cell of Fe2+ ions where the concentrations are 0.0025 and 0.750 M? What is the spontaneous reaction?