Give the systematic name for the following coordination compound or complex ion: H3 NIIII.. NC Pt...CN NH3

The square-planar complex Pt(en)Cl2 has chloride ligands in a cis configuration. No trans isomer is known. Based on the bond lengths and bond angles of carbon and nitrogen in the ethylenediamine ligand, explain why the trans compound is not possible.

a. In the absorption spectrum of the complex ion Cr(NCS)63, there is a band corresponding to the absorption of a photon of light with an energy of 1.75 104 cm-1. Given 1 cm1 = 1.986 1023 J, what is the wavelength of this photon? b. The CrNC bond angle in Cr(NCS)63 is predicted to be 180. What is the hybridization of the N atom in the Ncs- ligand when a Lewis acid-base reaction occurs between Cr3+ and NCs- that would give a 180 CrNC bond angle? Cr(NCS)63 undergoes substitution by ethylenediamine (en) according to the equation Cr(NCS)63+2enCr(NCS)2(en)2++4NCS Does Cr(NCS)2(en)2+ exhibit geometric isomerism? Does Cr(NCS)2(en)2+ exhibit optical isomerism?

A certain coordination compound has the simplest formula PtN2H6Cl2. It has a molar mass of about 600 g/mol and contains both a complex cation and a complex anion. What is its structure?

How many geometric isomers of the complex ion [Cr(dmen)3]3+ can exist? (dmen is the bidentate ligand 1,1-dimethylethylenediamine.) 1,1-Dimethylethylenediamine, dmen

Trimethylphosphine, P(CH3)3, can act as a ligand by donating the lone pair of electrons on the phosphorus atom. If trimethylphosphine is added to a solution of nickel(Il) chloride in acetone, a blue compound that has a molecular mass of approximately 270 g and contains 21.5% Ni, 26.0% Cl, and 52.5% P(CH3)3 can be isolated. This blue compound does not have any isomeric forms. What are the geometry and molecular formula of the blue compound?

The glycinate ion, H2NCH2CO2, formed by deprotonation of the amino acid glycine, can function as a bidentate ligand, coordinating to a metal through the nitrogen of the amino group and one of the oxygen atoms. Glycinate ion, a bidentate ligand A copper complex of this ligand has the formula Cu(H2NCH2CO2)2(H2O)2. For this complex, determine the following: (a) the oxidation state of copper (b) the coordination number of copper (c) the number of unpaired electrons (d) whether the complex is diamagnetic or paramagnetic

Give the coordination number for each metal ion in the following compounds: (a) [Co(CO3)3]3- (note that CO32- is bidentate in this complex). (b) [Cu(NH3)4]2+. (c) [Co(NH3)4Br2]2(SO4)3. (d) [Pt(NH3)4][PtCl4]. (e) [Cr(en)3](NO3)3. (f) [Pd(NH3)2Br2] (square planar). (g) K3[Cu(Cl)5]. (h) [Zn(NH3)2Cl2]

The complex ion PdCl42is diamagnetic. Propose a structure for PdCl42.

How many geometric isomers are possible for the square-planar complex ion [Pt(NH3)(CN)Cl2)?