Answered: Draw the structure of the following…

Draw the structure of the following compounds. a. cyclobutanecarboxylic acid b. 3,3-dimethylpentanedioic acid c. 4-aminopentanoic acid d. 2-methylcyclohexanecarboxylic acid e. m-chlorobenzoic acid 6.

Chemistry for Today: General, Organic, and Biochemistry

9th Edition

ISBN:9781305960060

Author:Spencer L. Seager, Michael R. Slabaugh, Maren S. Hansen

Publisher:Spencer L. Seager, Michael R. Slabaugh, Maren S. Hansen

Chapter15: Carboxylic Acids And Esters

Section: Chapter Questions

Problem 15.39E

See similar textbooks

Related questions

Q: reactions similar? How are the reactions different? Give an example of each reaction. Draw…

A: Since you have asked multiple question, we will solve the first question for you. If you want any…

Q: Draw a structure for cycloheptanecarboxylic acid

A: The structure of the chemical compounds gives the 3-D structure of the bonds present in the molecule

Q: Preparation of the amine from the amide?

A: amines from amides: Amides on reduction by Lithium aluminium hydride forms the amines. simple amides…

Q: Ethylamine is soluble in water, whereas aniline is almost insoluble, why?

A: A compound that can form H bond with water is soluble.

Q: Benzylpenicillin shown in Figure 34 was the first antibiotic to be manufactured on large scale. How…

A: The solution is as follows:

Q: How harmful Terephthalic acid is paarticularly in human health and environment?

A: Terephthalic acid is an organic compound with formula C6H4(CO2H)2 . The structural formula of…

Q: How will you purify benzoic acid that is contaminated with methyl orange? Give the step-by-step…

A: Both benzoic acid and methyl orange are sparingly soluble in water. But when we add strong base like…

Q: dentify the organic functional groups and reaction type for the following reaction. The reactant is…

Q: Refer to the following: HCI + CH3OH OH OCH3 A в D The reaction of a carboxylic acid (A) with an…

A: 13) only as specified.

Q: 2. Name and Draw the structures reactions of the p- aminophenol; a. Halogenation (Chlorination or B…

A: The question is based on the concept of organic reactions. we have to carry out electrophilic…

Q: (d) Sketch the chemical structure (i) t-butylamine (ii) 2,2-dimethylhexanoic acid

A: Tertiary butyl amine is the primary amines in which the amino group is attached to the tertiary…

Q: Give the order of basicity of alkaloids

A: The term alkaloid refers to alkali like. Alkaloid is the basic heterocyclic nitrogenous compound of…

Q: B. Draw the structure of the following compounds: a. ethyl butanoate b. 5-hydroxyhexanoic acid for…

A: Since you have posted a question with multiple subparts, we will solve the first three subparts for…

Q: Draw the structure of each of the following carboxylic acids:a. b-Chlorobutyric acidb.…

A: A carboxylic acid is an organic acid that contains a carboxyl group (C(=O)OH) attached to an…

Q: 2. This term means without water. a. carbonyl b. hydroxyl c. anhydride d. carboyl 3. Compounds…

A: 2)(c) anhydride 3)(a) Nitriles 4)(d) RMgX 5)(b) amines 6)(b) Thiols 7)(b) CnH2n+2 8)(a) CnH2n…

Q: Why is methylamine more basic than aniline?

A: Both methylamine and aniline are basic in nature.

Q: Write reactions of 3-aminopropanoic acid with the following reagents: a. CH3I; b. PBr5;

Q: Lewis acid catalyst in the reaction is ______ c. This reaction proceeds___________(

A: According to the question, we need to determine the nucleophile, Lewis act for the organic reaction.…

Q: Is Terephthalic acid harmful?

A: Yes, terephthalic acid is harmful .

Q: which one of the following will be soluble in water. a.hexanoic acid b. propanal c.2-heptanone…

A: Since we know that organic compound containing hydrogen bonding are water soluble . We also know…

Q: How are these compounds synthesized?

A: Here we are required to synthesize the product from benzene

Q: Draw the structures of the following carboxylic acids.(a) a@methylbutyric acid (b) 2-bromobutanoic…

A: Concept introduction: Hydrocarbons in which C-atom is bonded with O-atom (double bond) and -OH group…

Q: Amino acids can be synthesized by reductive amination. Draw the structure of the organic compound…

Q: Why are acid/base catalysts required when producing esters from carboxylic acids and amides but not…

A: In formation of ester nucleophile attack on electrophilic carbon of carbonyl group. In case of acyl…

Q: Which is true about tert-butylamine? A. It belongs to an amide group B. It is tertiary amine NR3…

Q: What is/are true regarding the following compound? * СООН IUPAC name is 4-Carboxy-2- pentylbutanoate…

Q: Chapter 12 25. Which of the following molecules would boil at the lowest temperature? Explain why.…

A: The boiling point of the alkanes is directly proportional to their molecular masses. On increasing…

Q: Select the functional group with the lowest oxidation state. a. carboxylic acid b. nitrile c. alkene…

A: We are to find the group with least oxidation state from a. carboxylic acid b. nitrile c. alkene d.…

Q: CI COOH

A: Recall the various functional groups with their names -COOH → Carboxylic acid RCOOR' →…

Q: Determine the reactants required to make pentyl butanoate and show the reaction. b. What kind of…

A: Pentyl butanoate is an ester. It can be obtained by the reaction of pentanol and butanoic acid.

Q: Define Reduction of Carboxylic Acids and Amides ?

A: Reduction is defined as the addition of hydrogen. Carboxylic acids are the compounds having -COOH as…

Q: why CH3CONH2 is a stronger acid and a weaker base than CH3CH2NH2?

Q: An unknown compound is believed to be one of these three compounds (benzilic acid, propanoic acid,…

A: Find: explain how you would go about finding out your compound is Benzelic acid or propanoic acid…

Q: The esterification reaction of 1 mL each of 1-propanol and propanoic acid is catalyzed with 2-3…

A: Esterification reaction

Q: An unknown compound is believed to be one of these three compounds (benzilic acid, propanoic acid,…

A: Benzelic acid is a carboxylic acid (an acid ) Propanoic acid is also a carboxylic acid (an acid )…

Q: Refer to the following: + CH;OH HCI OH OCH3 A в с B D The reaction of a carboxylic acid (A) with an…

Q: Benzo(a)pyrene is a well known carcinogen. Based on its chemical properties, explain why…

A: Solution - Benzo(a)pyrene - Benzo[a]pyrene is a polycyclic aromatic hydrocarbon and the result of…

Q: Explain the use of pyridine ?

A: Pyridine has molecular formula C6H5N. It is heterocyclic compound which is used in many medicine,…

Q: Draw the structure of 3-ethylheptanoic acid

A: To draw the structures, IUPAC nomenclature rules should be kept in mind. Suffix and prefix part…

Q: Which is not a carboxylic acid derivative? O A. amides O B. ethers O C. esters D. anhydrides

A: Correct Option B. ethers

Q: ) Amines with more than six b) aqueous HCI c) A a) water a) butyl amine N-butylbutanamide b) butyl…

A: Smell bad - butyl amine Saponification - hydrolysis of an ester Condensation Polymerization - H20…

Question

6. Draw the structure of the following compounds.
a. cyclobutanecarboxylic acid
b. 3,3-dimethylpentanedioic acid
c. 4-aminopentanoic acid
d. 2-methylcyclohexanecarboxylic acid
e. m-chlorobenzoic acid

Expert Solution

This question has been solved!

Explore an expertly crafted, step-by-step solution for a thorough understanding of key concepts.

SEE SOLUTION Check out a sample Q&A here

Step 1

VIEW

Step 2

VIEW

Step by step

Solved in 2 steps with 1 images

SEE SOLUTION Check out a sample Q&A here

Knowledge Booster

Types of Polymers on the Basis of Physical Properties

Learn more about

Need a deep-dive on the concept behind this application? Look no further. Learn more about this topic, chemistry and related others by exploring similar questions and additional content below.

Similar questions

Amide hydrolysis in basic conditions forms A. a carboxylic acid and an amine B. a carboxylate salt and an amine 3. an ester and an amine 4. a carboxylic acid and an amine salt
C. Amides 1. Amidation a. Acetic acid + ammonia
acetylsalicylic acid vs salicylic acid? What is the main chemical difference? Why can acetylsalicylic acid pass through the stomach without harm while salicylic acid can cause harm to the stomach????
Which is not a carboxylic acid derivative? O A. amides O B. ethers O C. esters D. anhydrides
Which functional group is the most acidic? a. amide b. carboxylic acid c. alcohol d. phenol e. amine
1. Which is more reactive? a. carboxylic acid b. acid anhydride c. acid halide d. amides e. esters 2. Removal of water? a. carboxylic acid b. acid anhydride c. acid halide d. amides e. esters 3. Condensation of alcohol and RCOOH? a. carboxylic acid b. acid anhydride c. acid halide d. amides e. esters
1: Classify the following compounds as to: A. Carboxylic acid, B. Ester, C. Acid Chloride, D. Acid Anhydride E. Amide. 1. CH: 2. CH:CHCH2CHCOOH H 3. Br 4. CH2CHCH2С—CI 5.
The hydrolysis of an amide in acidic conditions forms A. a carboxylate salt and an alcohol B. a carboxylate salt and an amine C. an alcohol and an amine salt (an ammonium ion) D. a carboxylic acid and an amine salt (an ammonium ion)
which has the greatest acidity? a. 2-hexanol b. valeric acid c. naphtol d. ethyl propionate which produces effervescence when dissolved in 10% sodium bicarbonate? a. 2-hexanol b. valeric acid c. napththol d. ethyl propionate
I. Complete the table. Classification of Carboxylic Acids and its derivatives No. Common Name Structure IUPAC Name 1. CH3CH2CH2COONA COOH(CH2)SCOOH 3. CH3CH2CH2CH2CH2COOH 4. C6HSCOOCOC6H5 5. CICOCH2CH2CH2CH2OH 6. CH3(CH2)7CONH2 7. CH3(CH2)3CH2COOCH2(CH2).CH3 CH3CH2OCOCH2CH2CH2CH2CH2CH2 8. CH3 9. CH3CH2CH2CH2CH2CH2CH2CH2COCI 10. H2NCOCH2CH2CH2CH3 2.
What is the name of the major product formed during the reaction between berzoyl chloride and phenol? a. phenyl benzoate b. benzyl ester C. cyclopentanoate d. benzyl phenoate e. benzenecarboxylic acid O a O b O c e
why n-hexanol has higher boiling point than n-hexane. why acetic acid is more acidic then butanoic acid. why sugar is soluble in water in terms of their molecular interactions.