Draw all the constitutional isomers that fit the molecular formula C4H8Cl2 and circle the ones that have chiral carbons. Do not use wedges and dashes

1. Draw the line-angle formulas of at least 10 constitutional isomers of C6H12. 2. Generate the IUPAC names of these isomers. 3. Calculate the properties of each of these isomers.

What is the dihedral angle between the two C-Cl bonds in the highest energy conformer of 1,2-dichloroethane, CICH₂-CH₂CI ? A) 180° B) 120° C) 60° D) 0°

Draw the line-angle structure of one isomer of the compound shown. The isomer must not have the same functional groups shown and must have 4 C atoms in a row. 힝

2. Using Newman projections looking along the C2-C3 bond, draw the lowest and highest energy conformations of 2,2,3-trimethylbutane.

2. Which of the following compounds could have configurational isomerism (cis or trans) and if they do, draw the both of the structures and label them as cis and trans d) 1,2-dichloroethene e) 2-methyl-2-butene f) 1-chloropropene

What is the correct name of the molecule with the formnulas CH; CH, CH, CH, CH, CH2 CH3? Heptane Octane Butane Hexane Pentane

Chemistry Determine how many substituents in the axial position does the most stable conformer of (1R,2S,4R)-4-bromo-1,2-dimethylcyclohexane have?

Convert the following condensed formula into a skeletal structure. CH3(CH2)5C(CH3)2(CH2)2CH3

1. Follow IUPAC rules to name the following molecule. a. Circle or highlight the longest chain b. Number the chain according to the rules c. List all substituents H3C- H₂C. H₂C CH3 d. Determine absolute configuration of chiral centers e. Write the full name of the molecule OCH 3 CH3 CH 3 H3C F Br CH3