common and short-hand notation Name the following Fatty Acids using their systematic_ 1. CH3(CH2)5CH=CH(CH2)¬COOH 2. CH3(CH2)7CH=CH(CH2)7COOH 3. CH3(CH2)10COOH 4. CH3(CH2)16COOH 5. CH3CH2(CH=CHCH2)3(CH2)6COOH

Although the first two carbons of fructose and glucose are identical in structure to DHAP and GADP (from glycolysis), DHAP and GADP equilibriate on their in solution to favor the ketone over the aldehyde, while fructose and glucose do not.  Why? a)The larger size of the molecule sterically hinders the isomerization b)The larger sugars have more OH groups which hydrogen bond and disrupt isomerization c)The larger sugars cyclize, and there is no carbonyl to isomerize in the cyclic form d)The larger sugars cyclize, and in the cyclic form the hydrogen bonding is very strong e)The larger sugars are less soluble in water than the smaller sugars

Consider this monosaccharide. H H OH H .OH HO H HO H CH₂OH Part: 0/3 Part 1 of 3 Label the chirality center(s) for the monosaccharide by highlighting the carbon(s) in the structure below. H H -OH H -OH HO -H HO -H CH₂OH હે

Fill in ..... (1) the complete systematic names for sugars A, B and C (remember to you pyranosyl or furanosyl because these are not the terminal sugar). (2) The appropriate descriptor of the glycosidic bonds where appropriate/necessary. (3) Draw the missing sugars as indicated onto the given diagram. HO OH GED A HO OH a-L-psicofuranose (1➜6)- (1➜4)- a-D-idopyranose HO OH B OH OH OH OH SUGAR A SUGAR B SUGAR C