Q: Draw the following molecule with the correct formal charges on all functional groups at pH 2 and pH…
A: Step 1:At pH = 2 At pH = 7.4
Q: dont provide handwriting solution......
A: The question is asking for the major product of a reaction involving sodium hydroxide (NaOH), water…
Q: 11. a. Show how you would perform the following synthesis starting from the amine shown below (10…
A: Step 1: Step 2: Step 3: Step 4:
Q: Provide the principle organic product(s) for the following reactions. If more than one product is…
A:
Q: Determining the oxidation state of the metal in a coordination compound termine the oxidation state…
A: For neutral ligands, oxidation number is zero.For charged ligands, the oxidation number is based on…
Q: (1)(15 points) An AA was used to analyze the arsenic in samples of well water. Three As standards 1…
A: To determine the amount of arsenic in well water samples using atomic absorption (AA) spectrometry…
Q: 1. Consider 250 g of saturated steam at 100 °C, condensed to saturated liquid at 100 °C. Calculate Q…
A: Approach to solving the question:Please see attached photos for detailed solutions. Thank you.…
Q: Using the following reaction. Determine the mass of CO2 created by adding 85.2 g of C6H12O6 with…
A: The objective of this question is to determine the mass of CO2 produced when 85.2 g of C6H12O6…
Q: ☐ ☐ ☐ AlCl3 ㅁ ☐ ☐ ☐ ☐
A: Approach to solving the question: Detailed explanation: Examples: Key references:
Q: help please answer in text form with proper workings and explanation for each and every part and…
A: The major organic product obtained from the given reaction sequence is D.Here's the step-by-step…
Q: Consider how best to prepare one liter of a buffer solution with pH = 5.09 using one of the weak…
A: The objective of this question is to determine the amount of potassium salt of the weak acid and its…
Q: No answer from Chat GPT will downvote Give proper explanation
A:
Q: Curved arrows are used to illustrate the flow of electrons. Use the reaction conditions provided and…
A:
Q: To finance the development of a new product, a company borrowed $46,400 at 3.94% compounded…
A: (a.) How much is owed after the deferral period?In order to compute this, I will first use the…
Q: e. Suppose you had titrated your vinegar sample with barium hydroxide instead of sodium hydroxide:…
A: To determine the volume of 0.586 M barium hydroxide (Ba(OH)2) needed to reach the equivalence point…
Q: If the bond energy for the N−H bond is 391 kJ/molkJ/mol, how much energy is released when 1 molmol…
A: Approach to solving the question: Detailed explanation: Examples: Key references:
Q: which alcohols have a chiral center?
A: Step 1:A compound is said to be chiral if it is attached to four different atoms or groups.The…
Q: None
A: The balanced equation is: BaCl2 + Na2SO4 --> BaSO4 + 2 NaCl To get the mass of BaSO4 from…
Q: Incorrect Question 4 0/1 pts Is the C-Au bond nonpolar, polar covalent, or ionic? polar covalent…
A: The C-Au bond is typically considered to be polar covalent. This is because gold (Au) is less…
Q: Use Boyle's, Charles's, or Gay-Lussac's law to calculate the missing value in each of the following.…
A: (a) Given, V1=2.0 LV2=1 LP1=0.79 atm We can find P2 by using the formula of Boyle's law.…
Q: Use standard reduction potentials to calculate the standard free energy change in kJ for the…
A: First, let's identify the reduction and oxidation half-reactions and their potentials:- Reduction…
Q: #17 Row 1: Your answer is incorrect. Row 2: Your answer is incorrect. Row 3: Your answer is…
A: 2. **Reaction: Fe3+(aq)+6H2O(l)→[Fe(H2O)6]3+(aq) - **Highlighted Reactant: H2O -…
Q: In which pair of compounds should the first member be more covalent than the second member? OTICI 3,…
A: The objective of the question is to identify the pair of compounds in which the first member is more…
Q: Can the product shown below be made by a Michael addition? If it can, draw reactants 1 and 2. If it…
A: Step 1: Step 2: Step 3: Step 4:
Q: Consider the following equations: 3A+6B-3D E+2F→A AH = -412 kJ AH = -100.8 kJ C→E+3DAH = 73.2 kJ…
A: Step 1: Step 2: Step 3: Step 4:
Q: its for practice
A: Step 1:The reaction is between iron(III) chloride (FeCl3) and sodium hydroxide (NaOH). The products…
Q: The label on a bottle of medicine reads "Each 5 mL teaspoonful contains glucose, 1.87 g;…
A: The objective of the question is to find the amount of phosphoric acid in a given dosage of medicine…
Q: jlp.8
A: The product shown contains a cyclohexane ring attached to a chain with a conjugated double bond…
Q: None
A: Half-Life Change in a Half-Order ReactionThis problem explores how the half-life of a chemical…
Q: Chemistry
A:
Q: If the bond energy for the N−HN−H bond is 391 kJ/molkJ/mol, how much energy is released when 1…
A: Approach to solving the question: Detailed explanation: Examples: Key references:
Q: b. H3PO4(aq) + Ba(OH)2(aq) → Contains three acidic hydrogens 2 H3PO4(aq) + Ba(OH)2(aq) +
A: Step 1: The correct balanced equation for the reaction between H3PO4 (phosphoric acid) and…
Q: 3. Elektron bergerak dalam daerah di antara 2 plat paralel dengan kecepatan 1.88 x 107 m/s dan…
A: The objective of the question is to find the magnitude of the magnetic field that will allow an…
Q: DRAW a stepwise reaction mechanism for this reaction. NO₂ -N3 C c 03, NaHCO3, CH2C12/MeOH. then…
A: Step 1: Step 2: Step 3: Step 4:
Q: 40. What are the expected major products A and B in the following reaction sequence? (Gabriel's…
A:
Q: Please don't provide handwritten solution .....
A: Step 1:Do the curved arrows create a reasonable structure? No Increasing the positive charge on an…
Q: None
A: Calculating Ecell with Non-Standard Concentrations (Step-by-Step)The scenario presented involves an…
Q: If the bond energy for the C=O bond is 798 kJ/molkJ/mol, how much energy is released when 4.0 molmol…
A: The objective of the question is to calculate the total energy released when 4.0 mol of carbon…
Q: help please answer in text form with proper workings and explanation for each and every part and…
A: Step 1: Reaction Step 2: Mechanism (I) Grignard reagent adds to the carbon of the nitrile forming a…
Q: The compound that will undergo SN¹ reaction with the fastest rate is (1) (3) CH3 Br - (2) (2) Br (4)…
A: Step 1:We know that, The SN1 (Substitution Nucleophilic Unimolecular) mechanism is a type of…
Q: Which of the following best describes the mechanism of the Grignard reaction? a.) The partially…
A: Step 1:In the Grignard reaction, an alkyl or aryl magnesium halide (commonly referred to as a…
Q: Show the mechanism for the following two reaction that use Chromic acid
A:
Q: An analytical chemist is titrating 79.6 mL of a 0.9000M solution of cyanic acid (HCNO) with a 1.200…
A: The objective of this question is to calculate the pH of the acid solution after a certain volume of…
Q: The pressure above a pure sample of solid Substance X at -180. °C is lowered. At what pressure will…
A: Temp. = -180.°C + 273 = 93. K @ 93. K, using the graph we can: Step 1: Project a vertical line from…
Q: Curved arrows are used to illustrate the flow of electrons. Using the provided resonance structures,…
A: Step 1:In the first step, the negative charge is transferred and carbon-oxygen double bond is…
Q: Which of the following is the correct ground state electron configuration for Cr3⁺?…
A: The electronic configuration of Cr in ground state is: Cr=1s22s22p63s23p63d54s1Or Cr=[Ar]3d⁵4s¹ The…
Q: Save Answer 2 points What is the product, I, II, III, or IV of the following two step reaction of…
A: In step 1, aldehydes form a cyanohydrin in reaction with NaCN and HCl.In step 2, the cyanohydrin, in…
Q: Calculate the molarity (M) of 154.6 g of H2SO4 in 1.080 L of solution
A: The objective of this question is to calculate the molarity of a solution. Molarity is a measure of…
Q: b) Disaccharide E is a reducing sugar. It is hydrolyzed by an α-glycosidase enzyme, which means it…
A:
Q: Consider the reaction below: A (aq) A(aq) B B(aq) A 1.000 M solution of A was heated at different…
A: Step 1: Step 2: Finding out the value of equilibrium constant at 67.270CGiven…
Step by step
Solved in 2 steps with 1 images
- Ethyl butyrate, CH3CH2CH2CO2CH2CH3CH3CH2CH2CO2CH2CH3, is an artificial fruit flavor commonly used in the food industry for such flavors as orange and pineapple. Its fragrance and taste are often associated with fresh orange juice, and thus it is most commonly used as orange flavoring. It can be produced by the reaction of butanoic acid with ethanol in the presence of an acid catalyst (H+H+): CH3CH2CH2CO2H(l)+CH2CH3OH(l)H+⟶CH3CH2CH2CO2CH2CH3(l)+H2O(l) Part A Given 7.30 gg of butanoic acid and excess ethanol, how many grams of ethyl butyrate would be synthesized, assuming a complete 100%% yield? Express your answer in grams to three significant figures. Part B A chemist ran the reaction and obtained 5.95 gg of ethyl butyrate. What was the percent yield? Express your answer as a percent to three significant figures. Part C The chemist discovers a more efficient catalyst that can produce ethyl butyrate with a 78.0%% yield. How many grams would be produced from 7.30 gg of…Ethyl butyrate, CH3CH2CH2CO2CH2CH3CH3CH2CH2CO2CH2CH3, is an artificial fruit flavor commonly used in the food industry for such flavors as orange and pineapple. Its fragrance and taste are often associated with fresh orange juice, and thus it is most commonly used as orange flavoring. It can be produced by the reaction of butanoic acid with ethanol in the presence of an acid catalyst (H+H+): CH3CH2CH2CO2H(l)+CH2CH3OH(l)H+⟶CH3CH2CH2CO2CH2CH3(l)+H2O(l) Given 8.45 gg of butanoic acid and excess ethanol, how many grams of ethyl butyrate would be synthesized, assuming a complete 100%% yield? Express your answer in grams to three significant figures. A chemist ran the reaction and obtained 5.50 gg of ethyl butyrate. What was the percent yield? Express your answer as a percent to three significant figures. The chemist discovers a more efficient catalyst that can produce ethyl butyrate with a 78.0%% yield. How many grams would be produced from 8.45 gg of butanoic acid and excess…Ethyl butyrate, CH3CH2CH2CO2CH2CH3, is an artificial fruit flavor commonly used in the food industry for such flavors as orange and pineapple. Its fragrance and taste are often associated with fresh orange juice, and thus it is most commonly used as orange flavoring.It can be produced by the reaction of butanoic acid with ethanol in the presence of an acid catalyst (H+): CH3CH2CH2CO2H(l)+CH2CH3OH(l)H+⟶CH3CH2CH2CO2CH2CH3(l)+H2O(l). The chemist discovers a more efficient catalyst that can produce ethyl butyrate with a 78.0% yield. How many grams would be produced from 8.50 gof butanoic acid and excess ethanol? Express your answer in grams to three significant figures.
- Ethyl butyrate, CH3CH2CH2CO2CH2CH3, is an artificial fruit flavor commonly used in the food industry for such flavors as orange and pineapple. Its fragrance and taste are often associated with fresh orange juice, and thus it is most commonly used as orange flavoring.It can be produced by the reaction of butanoic acid with ethanol in the presence of an acid catalyst (H+): CH3CH2CH2CO2H(l)+CH2CH3OH(l)H+⟶CH3CH2CH2CO2CH2CH3(l)+H2O(l) a) Given 7.70 g of butanoic acid and excess ethanol, how many grams of ethyl butyrate would be synthesized, assuming a complete 100% yield? b) A chemist ran the reaction and obtained 5.25 g of ethyl butyrate. What was the percent yield? c) The chemist discovers a more efficient catalyst that can produce ethyl butyrate with a 78.0% yield. How many grams would be produced from 7.70 g of butanoic acid and excess ethanol?Ethyl butyrate, CH3CH2CH2CO2CH2CH3, is an artificial fruit flavor commonly used in the food industry for such flavors as orange and pineapple. Its fragrance and taste are often associated with fresh orange juice, and thus it is most commonly used as orange flavoring.It can be produced by the reaction of butanoic acid with ethanol in the presence of an acid catalyst (H+): CH3CH2CH2CO2H(l)+CH2CH3OH(l)H+⟶CH3CH2CH2CO2CH2CH3(l)+H2O(l) Given 8.50 g of butanoic acid and excess ethanol, how many grams of ethyl butyrate would be synthesized, assuming a complete 100%yield? Express your answer in grams to three significant figures.Draw the keto and enol forms of (a) propanal and (b) 3-pentanone.
- (a) Draw the structure of the hemiacetal formed from one mole of benzaldehyde and one mole of ethanol. (b) Draw the structure of the acetal formed from one mole of benzaldehyde and two moles of ethanol. (c) Draw the structure of 2-methoxy-2-butanol. What compounds could you prepare this from? (d) Draw the structure of 3-methoxyl-2-butanol. What functional groups are present? Is this an acetal, a hemiacetal, or neither? Explain. (e) Identify the functional groups in the molecules shown below. Circle any acetals or hemiacetal, and identify which they are. 0-(a) Draw the structure of the hemiacetal formed from one mole of benzaldehyde and one mole of ethanol. (b) Draw the structure of the acetal formed from one mole of benzaldehyde and two moles of ethanol. (c) Draw the structure of 2-methoxy-2-butanol. What compounds could you prepare this from?Explain why methyl trifluoroacetate, CF3CO2CH3, is more reactive than methyl acetate, CH3CO2CH3, in nucleophilic acyl substitution reactions.
- Phenylethanol can be oxidised to phenylethanal or phenylethanoic acid, depending on the reagents used (both the alcohol and the aldehyde are of interest for their antimicrobial properties, while the acid is used to treat type II hyperammonemia): A (a) (b) (c) CoH,CH,CHO phenylethanal B C6H5CH₂CH₂OHC₂H₂CH₂CO₂H phenylethanol Suggest reagents (shown as A and B in the scheme above) that could be used to carry out the oxidation of the alcohol to the aldehyde and the acid, respectively. C6H5CH₂- Suggest two other syntheses of phenylethanoic acid, in each case indicating the starting materials and other reagents required, but not giving details of mechanism. One of your proposed syntheses must start with a compound which only contains seven carbon atoms (the acid product contains eight carbon atoms). phenylethanoic acid Phenylethanal can be converted to a hydrate in the presence of aqueous acid, though the position of equilibrium is very far to the left: H H+/H₂O OH C6H5CH₂-C-H OH Explain why…Dibenzalpropanone is a compound that can absorb UV rays and can be used as a sunscreen. Write down the reagents used to synthesize the compound dibenzalpropanone.Give TWO reagents to distinguish cyclohexanone from hexanal.