A voltaic cell consists of one half-cell that contains Ag(s) and Ag+(aq), and one half-cell that contains Sn(s) and Sn2+(aq). What species are produced at each of the electrodes under standard conditions?Ag+(aq) + e- → Ag(s)           E° = +0.80 VSn2+(aq) + 2 e- → Sn(s)       E° = -0.14 V Sn2+(aq) is formed at the cathode, and Ag(s) is formed at the anode. Ag(aq) is formed at the cathode, and Sn(s) is formed at the anode. Ag(s) is formed at the cathode, and Sn2+(aq) is formed at the anode. Sn(s) is formed at the cathode, and Ag+(aq) is formed at the anode.

Draw a diagram of each cell. Label the anode, the cathode, the species in each half-cell solution, the direction of electron movement in an external circuit, and thedirection of movement of ions within the cell. (a) Cu(s) | Cu2+(aq) || Fe2+(aq) |Fe(s) (b) Pt(s) | H2O2(aq), H+(aq) || Fe2+(aq), Fe3+(aq) | Pt(s)

A voltaic cell is constructed in which one half-cell consists of a silver wire in an aqueous solution of AgNO3.The other half cell consists of an inert platinum wire in an aqueous solution containing Fe2+(aq) and Fe3+(aq). (a) Calculate the cell potential, assuming standard conditions. (b) Write the net ionic equation for the reaction occurring in the cell. (c) Which electrode is the anode and which is the cathode? (d) If [Ag+] is 0.10 M, and [Fe2+] and [Fe3+] are both 1.0 M, what is the cell potential? Is the net cell reaction still that used in part (a)? If not, what is the net reaction under the new conditions?

Consider a galvanic cell based on the following half-reactions: a. What is the expected cell potential with all components in their standard states? b. What is the oxidizing agent in the overall cell reaction? c. What substances make up the anode compartment? d. In the standard cell, in which direction do the electrons flow? e. How many electrons are transferred per unit of cell reaction? f. If this cell is set up at 25C with [Fe2+] = 2.00 104 M and [La3+] = 3.00 103 M, what is the expected cell potential?

An electrolysis experiment is performed to determine the value of the Faraday constant (number of coulombs per mole of electrons). In this experiment, 28.8 g of gold is plated out from a AuCN solution by running an electrolytic cell for two hours with a current of 2.00 A. What is the experimental value obtained for the Faraday Constant?

You have 1.0 M solutions of Al(NO3)3 and AgNO3 along with Al and Ag electrodes to construct a voltaic cell. The salt bridge contains a saturated solution of KCl. Complete the picture associated with this problem by a writing the symbols of the elements and ions in the appropriate areas (both solutions and electrodes). b identifying the anode and cathode. c indicating the direction of electron flow through the external circuit. d indicating the cell potential (assume standard conditions, with no current flowing). e writing the appropriate half-reaction under each of the containers. f indicating the direction of ion flow in the salt bridge. g identifying the species undergoing oxidation and reduction. h writing the balanced overall reaction for the cell.

In principle, a battery could be made from aluminum metal and chlorine gas. (a) Write a balanced equation for the reaction thatwould occur in a battery using Al3+(aq) | Al(s) andCl2(g) | Cl(aq) half-cells. (b) Identify the half-reaction at the anode and at the cathode. Do electrons flow from the Al electrode when thecell does work? Explain. (c) Calculate the standard potential, Ecell, for the battery.

At 298 K, the solubility product constant for Pb(IO3)2 is 2.6 1013, and the standard reduction potential of the Pb2+(aq) to Pb(s) is 0.126 V. (a) Find the standard potential of the half-reaction Pb(IO3)2(s)+2ePb(s)+2IO3(aq) (Hint: The desired half-reaction is the sum of the equations for the solubility product and the reduction of Pb2+. Find G for these two reactions, and add them to find G for their sum. Convert the G to the potential of the desired half-reaction.) (b) Calculate the potential of the Pb/Pb(IO3)2 electrode in a 3.5 103 M solution of NaIO3.

At 298 K, the solubility product constant for PbC2O4 is 8.5 1010, and the standard reduction potential of the Pb2+(aq) to Pb(s) is 0.126 V. (a) Find the standard potential of the half-reaction PbC2O4(s)+2ePb(s)+C2O42(aq) (Hint: The desired half-reaction is the sum of the equations for the solubility product and the reduction of Pb2+. Find G for these two reactions and add them to find G for their sum. Convert the G to the potential of the desired half-reaction.) (b) Calculate the potential of the Pb/PbC2O4 electrode in a 0.025 M solution of Na2C2O4.

Give the notation for a voltaic cell whose overall cell reaction is Mg(s)+2Ag+(aq)Mg2+(aq)+2Ag(s) What are the half-cell reactions? Label them as anode or cathode reactions. What is the standard cell potential of this cell?