2,6 A rhodium metal centre undergoes cyclometallation with two units of C=C, what is the expected product of this reaction?O A. 5-membered rhodacycle ring is formedO B. 6-membered rhodacycle ring is formedO C. the two units of C=C are reduced to alkane C-C bond.O D. the two units of C=C are inserted to the rhodium metal centre Why can an organometallic complex perform the reactions such as insertion where normal coordination complex could not perform?O A. Because of the intramolecular pi-electron charge transfer in the ligand.OB.Because of the intermolecular pi-electron charge transfer in the ligand.Because the presence of dorbitals in the metal centre.O D. Because of the metal to ligand pi-electron charge transfer.

Correct choice is option ( A) 5 membered rhodacycle ring is formed.

A rhodium metal centre undergoes cyclometallation with two units of C=C, what is the expected product of this reaction? O A. 5-membered rhodacycle ring is formed O B. 6-membered rhodacycle ring is formed O C. the two units of C=C are reduced to alkane C-C bond. O D. the two units of C=C are inserted to the rhodium metal centre

A rhodium metal centre undergoes cyclometallation with two units of C=C, what is the expected product of this reaction? O A. 5-membered rhodacycle ring is formed O B. 6-membered rhodacycle ring is formed O C. the two units of C=C are reduced to alkane C-C bond. O D. the two units of C=C are inserted to the rhodium metal centre

Principles of Modern Chemistry

8th Edition

ISBN:9781305079113

Author:David W. Oxtoby, H. Pat Gillis, Laurie J. Butler

Publisher:David W. Oxtoby, H. Pat Gillis, Laurie J. Butler

Chapter8: Bonding In Transition Metal Compounds And Coordination Complexes

Section: Chapter Questions

Problem 33P

See similar textbooks

Related questions

Q: An antacid tablet weighing 0.853g contained calcium carbonate as the active ingredient, in addition…

A: A balanced equation for the above reaction can be written as,

Q: (b) 1.9-BBN 2. H₂O2, KOH

A: Given,The reaction:

Q: The average human fart contains .00643 g of methane gas. 1) Write and balance the reaction for the…

A: CH4+2O2→CO2+2H2OMass of CH4=0.00643g1mol of CH4=16gno. of moles of methane=0.0064316=0.00040.004…

Q: Acetic acid (shown below) has a Ką that is much smaller, 1.8x10-5. Why is fluoroacetic acid a…

A: The acidic character of a compound depends on the stability of the resulting conjugate base. If the…

Q: individual bikes to work one day a week 50/52 work weeks (5 days) a year. they save 12.5

Q: what are the organic molecules? H H H H H C C (3 lines) C C C…

Q: Calculate Eºcell (in V) and indicate whether the reaction shown is spontaneous or nonspontaneous…

Q: Complete the translation of the words. 1.8H/THF 2. H,O-OH KOCCH,)ylsi 1. 2 mol CH,MgBr 2. H,O" 1.…

Q: Which molecules are enantiomers? Which molecules are the same? (A).

A: The molecules with the same molecular formula but different structures are known as isomers. If the…

Q: Ag+KNO3

A: The replacement of metal by other metal atom is known as the replacement of metal reaction. It can…

Q: (4pts) Determining the Thickness of Aluminum Foil Be sure to report answers with the correct number…

A: To calculate the volume of the aluminum foil, we need to use the formula for the volume of a…

Q: QUESTION 4 Rank the alkenes show in order of stability with 1 being most stable and 3 being least…

A: Information of question

Q: Scientists can learn a great deal about a community's drug use (both legal and illegal) by analyzing…

A: The objective of the question is to identify the polar covalent bonds in the structure of cotinine,…

Q: ОН A N SOH D B LCHO с

A: Alkenes are converted to cyclopropane derivatives using organozinc reagent. The reaction involves…

Concept explainers

Designing a Synthesis

Organic synthesis is a branch of chemical synthesis that involves the planned construction of organic compounds/molecules from smaller units that possess functional groups. Friedrich Wöhler was the first scientist who designed the synthesis of an organic compound, urea from inorganic starting materials silver cyanate with ammonium chloride via a simple, one-step synthesis.

Question

2,6

A rhodium metal centre undergoes cyclometallation with two units of C=C, what is the expected product of this reaction?
O A. 5-membered rhodacycle ring is formed
O B. 6-membered rhodacycle ring is formed
O C. the two units of C=C are reduced to alkane C-C bond.
O D. the two units of C=C are inserted to the rhodium metal centre

Why can an organometallic complex perform the reactions such as insertion where normal coordination complex could not perform?
O A. Because of the intramolecular pi-electron charge transfer in the ligand.
OB.
Because of the intermolecular pi-electron charge transfer in the ligand.
Because the presence of dorbitals in the metal centre.
O D. Because of the metal to ligand pi-electron charge transfer.

Expert Solution

This question has been solved!

Explore an expertly crafted, step-by-step solution for a thorough understanding of key concepts.

SEE SOLUTION Check out a sample Q&A here

Step 1

VIEW

Step 2

VIEW

Step by step

Solved in 2 steps with 1 images

SEE SOLUTION Check out a sample Q&A here

Knowledge Booster

Learn more about

Need a deep-dive on the concept behind this application? Look no further. Learn more about this topic, chemistry and related others by exploring similar questions and additional content below.

Similar questions

Which of the following statement(s) is( are) true? a. The coordination number of a metal ion in an octahedral complex ion is 8. b. All tetrahedral complex ions are low-spin. c. The formula for triaquatrianuninechromiwn(III) sulfate is [Cr(H2O)3(NH3)](SO4)3. d. The electron configuration of Hf2+ is [Xe]4f126s2. e. Hemoglobin contains Fe3+.
a. In the absorption spectrum of the complex ion Cr(NCS)63, there is a band corresponding to the absorption of a photon of light with an energy of 1.75 104 cm-1. Given 1 cm1 = 1.986 1023 J, what is the wavelength of this photon? b. The CrNC bond angle in Cr(NCS)63 is predicted to be 180. What is the hybridization of the N atom in the Ncs- ligand when a Lewis acid-base reaction occurs between Cr3+ and NCs- that would give a 180 CrNC bond angle? Cr(NCS)63 undergoes substitution by ethylenediamine (en) according to the equation Cr(NCS)63+2enCr(NCS)2(en)2++4NCS Does Cr(NCS)2(en)2+ exhibit geometric isomerism? Does Cr(NCS)2(en)2+ exhibit optical isomerism?
The square-planar complex Pt(en)Cl2 has chloride ligands in a cis configuration. No trans isomer is known. Based on the bond lengths and bond angles of carbon and nitrogen in the ethylenediamine ligand, explain why the trans compound is not possible.
The transition metals form a class of compounds called metal carbonyls, an example of which is the tetrahedral complex Ni(CO)4. Given the following thermodynamic data (at 298 K): (a) Calculate the equilibrium constant for the formation of Ni(CO)4(g) from nickel metal and CO gas. (b) Is the reaction of Ni(s) and CO(g) product- or reactant-favored at equilibrium? (c) Is the reaction more or less product-favored at higher temperatures? How could this reaction be used in the purification of nickel metal?
Is it possible for a complex of a metal in the transition series to have six unpaired electrons? Explain.
How many geometric isomers of the complex ion [Cr(dmen)3]3+ can exist? (dmen is the bidentate ligand 1,1-dimethylethylenediamine.) 1,1-Dimethylethylenediamine, dmen
Chelating ligands often form more stable complex ions than the corresponding monodentate ligands with the same donor atoms. For example, Ni2+(aq)+6NH3(aq)Ni(NH3)62+(aq)K=3.2108Ni2+(aq)+3en(aq)Ni(en)32+(aq)K=1.61018Ni2+(aq)+penten(aq)Ni(penten)2+(aq)K=2.01019 where en is ethylenediamine and penten is This increased stability is called the chelate effect. Based on bond energies, would you expect the enthalpy changes for the above reactions to be very different? What is the order (from least favorable to most favorable) of the entropy changes for the above reactions? How do the values of the formation constants correlate with S? How can this be used to explain the chelate effect?
Trimethylphosphine, P(CH3)3, can act as a ligand by donating the lone pair of electrons on the phosphorus atom. If trimethylphosphine is added to a solution of nickel(Il) chloride in acetone, a blue compound that has a molecular mass of approximately 270 g and contains 21.5% Ni, 26.0% Cl, and 52.5% P(CH3)3 can be isolated. This blue compound does not have any isomeric forms. What are the geometry and molecular formula of the blue compound?
What is the coordination number of the central metal atom in the following complexes? (a) [Fe(H2O)63+] (b) [Pt(NH3)Br3] (c) [V(en)Cl42] (d) [Au(CN)2+]