A battery can provide a current of 2.60 A at 1.60 V for 1.50 hr. How much energy (in kJ) is produced?

A standard galvanic cell is constructed so that the overall cell reaction is 2A13++(aq)+3M(s)3M2+(aq)+2A1(s) Where M is an unknown metal. If G = 411 kJ for the overall cell reaction, identify the metal used to construct the standard cell.

The mass of three different metal electrodes, each from a different galvanic cell, were determined before and after the current generated by the oxidation-reduction reaction in each cell was allowed to flow for a few minutes. The first metal electrode, given the label A, was found to have increased in mass; the second metal electrode, given the label B, did not change in mass; and the third metal electrode, given the label C, was found to have lost mass. Make an educated guess as to which electrodes were active and which were inert electrodes, and which were anode(s) and which were the cathode(s).

Hydrazine, N2H4, can be used as the reducing agent in a fuel cell. N2H4(aq) + O2(aq) N2(g) + 2 H2O () (a) If rG for the reaction is 598 kJ, calculate the valueof E expected for the reaction. (b) Suppose the equation is written with all coefficients doubled. Determine rG and E for this new reaction.

Calculate the standard free-energy change at 25C for the following reaction. 4Al(s)+3O2(g)+12H+(aq)4Al3+(aq)+6H2O(l) Use standard electrode potentials.

A fuel cell designed to react grain alcohol with oxygen has the following net reaction: C2H5OH(l)+3O2(g)2CO2(g)+3H2O(l) The maximum work that 1 mole of alcohol can do is 1.32 103 kJ. What is the theoretical maximum voltage this cell can achieve at 25C?

Zinc is produced by electrolytic refining. The electrolytic process, which is similar to that for copper, can be represented by the two half-reactions Zn(impure,s)Zn2++2eZn2++2eZn(pure,s) For this process, a voltage of 3.0 V is used. How many kilowatt hours are needed to produce one metric ton of pure zinc?

Consider the following galvanic cell at 25C: Pt|Cr2+(0.30M),Cr3+(2.0M)||Co2+(0.20M)|Co The overall reaction and equilibrium constant value are 2Cr2+(aq)+Co2+(aq)2Cr3+(aq)+Co(s)K=2.79107 Calculate the cell potential, for this galvanic cell and G for the cell reaction at these conditions.

A voltaic cell is constructed in which one half-cell consists of a silver wire in an aqueous solution of AgNO3.The other half cell consists of an inert platinum wire in an aqueous solution containing Fe2+(aq) and Fe3+(aq). (a) Calculate the cell potential, assuming standard conditions. (b) Write the net ionic equation for the reaction occurring in the cell. (c) Which electrode is the anode and which is the cathode? (d) If [Ag+] is 0.10 M, and [Fe2+] and [Fe3+] are both 1.0 M, what is the cell potential? Is the net cell reaction still that used in part (a)? If not, what is the net reaction under the new conditions?

For each of the reactions, calculate E from the table of standard potentials, and state whether the reaction is spontaneous as written or spontaneous in the reverse direction under standard conditions. (a) Cu2+(aq)+Ni(s)Cu(s)+Ni2+(aq) (b) 2Ag(s)+Cl2(g)2AgCl(s) (c) Cl2(g)+2I(aq)2Cl(aq)+I2(s)