Introductory Chemistry: A Foundation
8th Edition
ISBN: 9781285199030
Author: Steven S. Zumdahl, Donald J. DeCoste
Publisher: Cengage Learning
expand_more
expand_more
format_list_bulleted
Concept explainers
Textbook Question
Chapter 12, Problem 10CR
What is a driving force? Name two common and important driving forces, and give an example of each. What is entropy? Although the total energy of the universe is constant, is the entropy of the universe constant? What is a spontaneous process?
Expert Solution & Answer
Want to see the full answer?
Check out a sample textbook solutionChapter 12 Solutions
Introductory Chemistry: A Foundation
Ch. 12.2 - use differences in electronegativity to account...Ch. 12.2 - trong>Exercise 12.1 For each of the following...Ch. 12.5 - ns have different radii than their parent atoms....Ch. 12.6 - trong>Exercise 12.2 Write the Lewis structure for...Ch. 12.7 - trong>Exercise 12.3 Ozone is a very important...Ch. 12.7 - trong>Exercise 12.4 Write the Lewis structures...Ch. 12.9 - u have seen that molecules with four electron...Ch. 12.9 - Prob. 12.5SCCh. 12 - sing only the periodic table, predict the most...Ch. 12 - rite the proper charges so that an alkali metal, a...
Ch. 12 - hat is meant by a chemical bond?Ch. 12 - hy do atoms form bonds with one another? What can...Ch. 12 - ow does a bond between Naand Cldiffer from a bond...Ch. 12 - n your own words, what is meant by the term...Ch. 12 - xplain the difference between ionic bonding and...Ch. 12 - rue or false? In general, a larger atom has a...Ch. 12 - hy is there an octet rule (and what does actet...Ch. 12 - Does a Lewis structure tell which electrons came...Ch. 12 - If lithium and fluorine react, which has more...Ch. 12 - In a bond between fluorine and iodine, which has...Ch. 12 - We use differences in electronegative to account...Ch. 12 - Prob. 14ALQCh. 12 - Why do we only the consider the valence electrons...Ch. 12 - How do we determine the total number of valence...Ch. 12 - What is the main idea in the valence shell...Ch. 12 - The molecules NH3andBF3have the same general...Ch. 12 - How do we deal with multiple bonds in VSEPR...Ch. 12 - In Section 12.10 of your text, the term “effective...Ch. 12 - Prob. 21ALQCh. 12 - Prob. 22ALQCh. 12 - Prob. 1QAPCh. 12 - Prob. 2QAPCh. 12 - hat sorts of elements react to form ionic...Ch. 12 - n general terms, what is a covalent bond?Ch. 12 - escribe the type of bonding that exists in the...Ch. 12 - Prob. 6QAPCh. 12 - he relative ability of an atom in a molecule to...Ch. 12 - hat does it mean to say that a bond is polar? Give...Ch. 12 - Prob. 9QAPCh. 12 - What factor determines the relative level of...Ch. 12 - In each of the following groups, which element is...Ch. 12 - In each of the following groups. which element is...Ch. 12 - On the basis. of the electronegativity values...Ch. 12 - On the basis of the electronegativity values given...Ch. 12 - Which of the following molecules contain polar...Ch. 12 - Which of the following molecules contain polar...Ch. 12 - On the basis of the electronegativity values given...Ch. 12 - On the basis of the electronegativity values given...Ch. 12 - Which brand in each of the following pairs has the...Ch. 12 - Which hand in each of the following pairs has less...Ch. 12 - What is a dipole moment? Give four examples of...Ch. 12 - Why is the presence of a dipole moment in the...Ch. 12 - In each of the following diatomic molecules, which...Ch. 12 - In each of the following diatomic molecules. which...Ch. 12 - For each of the following bonds, draw a figure...Ch. 12 - For each of the following bonds, draw a figure...Ch. 12 - For each of the following bonds, draw a figure...Ch. 12 - For each of the following bonds, draw a figure...Ch. 12 - What does it mean when we say that in forming...Ch. 12 - Prob. 30QAPCh. 12 - Nonmetals form negative ions by (losing/gaining)...Ch. 12 - Explain how the atoms in covalent molecules...Ch. 12 - Which simple ion would each of the following...Ch. 12 - Which simple ion would each of the following...Ch. 12 - For each of the following numbers of electrons,...Ch. 12 - Give the formula of a negative ion that would have...Ch. 12 - On the basis of their electron configurations,...Ch. 12 - On the basis of their electron configurations,...Ch. 12 - Name the noble gas atom that has the same electron...Ch. 12 - Atoms form ions so as to achieve electron...Ch. 12 - Prob. 41QAPCh. 12 - Describe in general terms the structure of ionic...Ch. 12 - Why are cations always smaller than the atoms from...Ch. 12 - Why are anions always larger than the atoms from...Ch. 12 - For each of the following pairs, indicate which...Ch. 12 - Prob. 46QAPCh. 12 - Prob. 47QAPCh. 12 - For each of the following pairs, indicate which is...Ch. 12 - Why are the valence electrons of an atom the only...Ch. 12 - Explain what the “duet" and “octet” rules are and...Ch. 12 - What type of structure must each atom in a...Ch. 12 - When elements in the second and third periods...Ch. 12 - How many electrons are involved when two atoms in...Ch. 12 - Prob. 54QAPCh. 12 - Write the simple Lewis structure for each of the...Ch. 12 - Write the simple Lewis structure for each of the...Ch. 12 - Give the total number of valence electrons in each...Ch. 12 - Give the total number of valence electrons in each...Ch. 12 - Write a Lewis structure for each of the following...Ch. 12 - Write a Lewis structure for each of the following...Ch. 12 - Write a Lewis structure for each of the following...Ch. 12 - Prob. 62QAPCh. 12 - The “Chemistry in Focus“ segment Broccoli—Miracle...Ch. 12 - The “Chemistry in Focus" segment Hiding Carbon...Ch. 12 - Write a Lewis structure for each of the following...Ch. 12 - Write a Lewis structure for each of the following...Ch. 12 - Write a Lewis structure for each of the following...Ch. 12 - Write a Lewis structure for each of the following...Ch. 12 - What is the geometric structure of the water...Ch. 12 - What is the geometric sanctum of the ammonia...Ch. 12 - What is the geometric structure of the boron...Ch. 12 - What is the geometric structure of the...Ch. 12 - Why is the geometric structure of a molecule...Ch. 12 - Prob. 74QAPCh. 12 - How is the structure around a given atom related...Ch. 12 - Why are all diatomic molecules linear, regardless...Ch. 12 - Although the valence electron pairs in ammonia...Ch. 12 - Although both the BF3and NF3molecules contain the...Ch. 12 - For the indicated atom in each of the following...Ch. 12 - Prob. 80QAPCh. 12 - Using the VSEPR theory, predict the molecular...Ch. 12 - Prob. 82QAPCh. 12 - Using the VSEPR theory, predict the molecular...Ch. 12 - Using the VSEPR theory, predict the molecular...Ch. 12 - For each of the following molecules or ions,...Ch. 12 - For each of the following molecules or ion....Ch. 12 - The “Chemistry in Focus" segment Taste—It's the...Ch. 12 - Prob. 88QAPCh. 12 - What is resonance? Give three examples of...Ch. 12 - Prob. 90APCh. 12 - The geometric arrangement of electron pairs around...Ch. 12 - Choose the bond that is the least polar. Explain...Ch. 12 - Prob. 93APCh. 12 - Prob. 94APCh. 12 - Prob. 95APCh. 12 - For each of the following pairs of elements,...Ch. 12 - On the basis of the electronegativity values given...Ch. 12 - Which of the following molecules contain polar...Ch. 12 - Prob. 99APCh. 12 - Prob. 100APCh. 12 - or each of the following bonds, draw a figure...Ch. 12 - Prob. 102APCh. 12 - Prob. 103APCh. 12 - Prob. 104APCh. 12 - hich noble gas has the same electron configuration...Ch. 12 - Prob. 106APCh. 12 - rite the Lewis structure for each of the following...Ch. 12 - Prob. 108APCh. 12 - rite a Lewis structure for each of the following...Ch. 12 - Prob. 110APCh. 12 - rite a Lewis structure for each of the following...Ch. 12 - Prob. 112APCh. 12 - hy is the molecular structure of H2Ononlinear,...Ch. 12 - Prob. 114APCh. 12 - sing the VSEPR theory, predict the molecular...Ch. 12 - Prob. 116APCh. 12 - or each of the following molecules, indicate the...Ch. 12 - Prob. 118APCh. 12 - Prob. 119APCh. 12 - Prob. 120APCh. 12 - Prob. 121APCh. 12 - Classify the bonding in each of the following...Ch. 12 - ompare the electronegativities of each pair of...Ch. 12 - Prob. 124CPCh. 12 - rrange the atoms and/or ions in the following...Ch. 12 - Prob. 126CPCh. 12 - Prob. 127CPCh. 12 - he formulas of several chemical substances are...Ch. 12 - Prob. 1CRCh. 12 - hat does temperature measure? Are the molecules in...Ch. 12 - Prob. 3CRCh. 12 - Prob. 4CRCh. 12 - Prob. 5CRCh. 12 - hat is the enthalpy change for a process? Is...Ch. 12 - Prob. 7CRCh. 12 - Prob. 8CRCh. 12 - Prob. 9CRCh. 12 - What is a driving force? Name two common and...Ch. 12 - Prob. 11CRCh. 12 - Methane, CH4, is the major component of natural...Ch. 12 - What is electronegative radiation? Give some...Ch. 12 - Prob. 14CRCh. 12 - Do atoms in excited states emit radiation...Ch. 12 - Prob. 16CRCh. 12 - Schrodinger and de Broglie suggested a...Ch. 12 - Describe the general characteristics of the first...Ch. 12 - Prob. 19CRCh. 12 - Describe the sublevels and orbitals that...Ch. 12 - Describe electron spin. How does electron spin...Ch. 12 - Prob. 22CRCh. 12 - List the order in which the orbitals are filled as...Ch. 12 - Prob. 24CRCh. 12 - Prob. 25CRCh. 12 - Prob. 26CRCh. 12 - What are the representative elements? In what...Ch. 12 - Prob. 28CRCh. 12 - Prob. 29CRCh. 12 - Prob. 30CRCh. 12 - Prob. 31CRCh. 12 - Prob. 32CRCh. 12 - Prob. 33CRCh. 12 - Prob. 34CRCh. 12 - Give evidence that ionic bonds are very strong....Ch. 12 - Prob. 36CRCh. 12 - Prob. 37CRCh. 12 - For three simple molecules of your own choice,...Ch. 12 - Prob. 39CRCh. 12 - Prob. 40CRCh. 12 - Prob. 41CRCh. 12 - Prob. 42CRCh. 12 - Prob. 43CRCh. 12 - Prob. 44CRCh. 12 - Prob. 45CRCh. 12 - Prob. 46CR
Knowledge Booster
Learn more about
Need a deep-dive on the concept behind this application? Look no further. Learn more about this topic, chemistry and related others by exploring similar questions and additional content below.Similar questions
- For the reaction HgO(s)Hg(l)+12O2(g),H=+90.7KJ: a. What quantity of heat is required to produce 1 mole of mercury by this reaction? b. What quantity of heat is required to produce 1 mole of oxygen gas by this reaction? c. What quantity of heat would be released in the following reaction as written? 2Hg(l)+O2(g)2HgO(s)arrow_forwardWhat mass of acetylene, C2H2(g), must be burned to produce 3420 kJ of heat, given that its enthalpy of combustion is 1301 kJ/mol? Compare this with the answer to Exercise 5.91 and determine which substance produces more heat per gram.arrow_forwardThe following reactions can be used to prepare samples of metals. Determine the enthalpy change under standard state conditions for each. (a) 2Ag2O(s)4Ag(s)+O2(g) (b) SnO(s)+CO(g)Sn(s)+CO2(g) (c) Cr2O3(s)+3H2(g)2Cr(s)+3H2O(l) (d) 2Al(s)+Fe2O3(s)Al2O(s)+2Fe(s)arrow_forward
- 9.41 Under what conditions does the enthalpy change equal the heat of a process?arrow_forwardA 0.470-g sample of magnesium reacts with 200 g dilute HCl in a coffee-cup calorimeter to form MgCl2(aq) and H2(g). The temperature increases by 10.9 C as the magnesium reacts. Assume that the mixture has the same specific heat as water and a mass of 200 g. (a) Calculate the enthalpy change for the reaction. Is the process exothermic or endothermic? (b) Write the chemical equation and evaluate H.arrow_forwardThe enthalpy change for the reaction of hydrogen gas with fluorine gas (o produce hydrogen fluoride is 542 U for the equation as written: mg src=Images/HTML_99425-10-41QAP_image001.jpg alt="" align="top"/> l type='a'> What is the enthalpy change per mole of hydrogen fluoride produced? Is the reaction exothermic or endothermic as written? What would be the enthalpy change for the reverse of the given equation (that 1%, for the decomposition of HF into its constituent elements)?arrow_forward
- The standard enthalpy of formation of solid barium oxide, BaO, is 553.5 kJ/mol, and the standard enthalpy of formation of barium peroxide, BaO2, is 634.3 kJ/mol. (a) Calculate the standard enthalpy change for the following reaction. Is the reaction exothermic or endothermic? 2 BaO2(s) 2 BaO(s) + O2(g) (b) Draw an energy level diagram that shows the relationship between the enthalpy change of the decomposition of BaO2, to BaO and O2, and the enthalpies of formation of BaO2(s) and BaO2(s).arrow_forward4.60 Why are fuel additives used?arrow_forwardn Section 10.7, two characteristics of enthalpy changes for reactions are listed. What are these characteristics? Explain why these characteristics are true.arrow_forward
- Determine whether the statements given below are true or false. Consider an endothermic process taking place in a beaker at room temperature. (a) Heat flows from the surroundings to the system. (b) The beaker is cold to the touch. (c) The pressure of the system decreases. (d) The value of q for the system is positive.arrow_forwardn Fig. 10.1, what kind of energy does ball A possess initially when at rest at the top of the hill? What kind of energies are involved as ball A moves down the hill? What kind of energy does ball A possess when it reaches the bottom of the hill and stops moving after hitting ball B? Where did the energy gained by ball B, allowing it to move up the hill, come from?arrow_forward
arrow_back_ios
arrow_forward_ios
Recommended textbooks for you
- Introductory Chemistry: A FoundationChemistryISBN:9781337399425Author:Steven S. Zumdahl, Donald J. DeCostePublisher:Cengage LearningLiving By Chemistry: First Edition TextbookChemistryISBN:9781559539418Author:Angelica StacyPublisher:MAC HIGHERChemistry by OpenStax (2015-05-04)ChemistryISBN:9781938168390Author:Klaus Theopold, Richard H Langley, Paul Flowers, William R. Robinson, Mark BlaserPublisher:OpenStax
- General Chemistry - Standalone book (MindTap Cour...ChemistryISBN:9781305580343Author:Steven D. Gammon, Ebbing, Darrell Ebbing, Steven D., Darrell; Gammon, Darrell Ebbing; Steven D. Gammon, Darrell D.; Gammon, Ebbing; Steven D. Gammon; DarrellPublisher:Cengage LearningChemistry for Engineering StudentsChemistryISBN:9781337398909Author:Lawrence S. Brown, Tom HolmePublisher:Cengage LearningWorld of Chemistry, 3rd editionChemistryISBN:9781133109655Author:Steven S. Zumdahl, Susan L. Zumdahl, Donald J. DeCostePublisher:Brooks / Cole / Cengage Learning
Introductory Chemistry: A Foundation
Chemistry
ISBN:9781337399425
Author:Steven S. Zumdahl, Donald J. DeCoste
Publisher:Cengage Learning
Living By Chemistry: First Edition Textbook
Chemistry
ISBN:9781559539418
Author:Angelica Stacy
Publisher:MAC HIGHER
Chemistry by OpenStax (2015-05-04)
Chemistry
ISBN:9781938168390
Author:Klaus Theopold, Richard H Langley, Paul Flowers, William R. Robinson, Mark Blaser
Publisher:OpenStax
General Chemistry - Standalone book (MindTap Cour...
Chemistry
ISBN:9781305580343
Author:Steven D. Gammon, Ebbing, Darrell Ebbing, Steven D., Darrell; Gammon, Darrell Ebbing; Steven D. Gammon, Darrell D.; Gammon, Ebbing; Steven D. Gammon; Darrell
Publisher:Cengage Learning
Chemistry for Engineering Students
Chemistry
ISBN:9781337398909
Author:Lawrence S. Brown, Tom Holme
Publisher:Cengage Learning
World of Chemistry, 3rd edition
Chemistry
ISBN:9781133109655
Author:Steven S. Zumdahl, Susan L. Zumdahl, Donald J. DeCoste
Publisher:Brooks / Cole / Cengage Learning
Calorimetry Concept, Examples and Thermochemistry | How to Pass Chemistry; Author: Melissa Maribel;https://www.youtube.com/watch?v=nSh29lUGj00;License: Standard YouTube License, CC-BY