Chapter 18.11, Problem 23ATS

Complete each acid-base reaction and predict whether the position of equilibrium lies toward the left or toward the right. (a) CH3CCH+CH3CH2ONa+CH3CH3OH (b) CH3CCCH2CH2OH+Na+NH2NH3(l)

The PKa of p-nitrophenol is 7.15. Would you expect this to dissolve in a sodium bicarbonate solution? The PKa of 2,5-dinitrophenol is 5.15. Will it dissolve in bicarbonate solution?

I. Propose an efficient synthesis for the following transformation. OH -Ph Ph

1. How can we modify the reaction of phenol with Br2 and a Lewis acid catalyst to obtain only ortho-bromophenol instead of a mixture of ortho-bromophenol and para-bromophenol?

Which reagents would be best to achieve the following synthesis? Br A) 1) t-BuOK 2) BH₂-THF 3) H₂O2, NaOH B) 1) NaOEt 2) BH3-THF 3) H₂O2, NaOH LOH C) 1) NaOEt 2) Hg(OAc)2, H₂0 3) NaBH4 D) 1) 1-BuOK 2) Hg(OAc)2, H₂O 3) NaBH4

Choose the most correct set of reagents for the following reaction.

Identify products A and B from the given 1H NMR data. a.Treatment of CH2=CHCOCH3 with one equivalent of HCl forms compound A. A exhibits the following absorptions in its 1H NMR spectrum: 2.2 (singlet, 3 H), 3.05 (triplet, 2 H), and 3.6 (triplet, 2 H) ppm. What is the structure of A? b.Treatment of acetone [(CH3)2C=O] with dilute aqueous base forms B. Compound B exhibits four singlets in its 1H NMR spectrum at 1.3 (6 H), 2.2 (3 H), 2.5 (2 H), and 3.8 (1 H) ppm. What is the structure of B?

What is a suitable synthesis to complete the transformation below? Show all steps with reagents and products.

Write a stepwise reaction mechanism for the following sequence of reactions. No 1) O Ph CI 2) KCN/H,O CN N