Chapter 12.2, Problem 7ATS

i H OCH 3 Br step 1 Br-Br step 2 Br B D A C In step 2 of the reaction above, classify C and D as electrophile or nucleophile. HOCH 3 C is acting as the nucleophile, D is acting as the electrophile. Both C and D are acting as nucleophiles. Both C and D are acting as electrophiles. ● C is acting as the electrophile, D is acting as the nucleophile. Minimise global navigation

What is the major product of this reaction? 1 equiv HCI -80 °C 身

What is the major product of the following reaction? 1. KMNO4, "OH, boil 2. H₂0¹

The Keq for the reaction:  A + B ↔ AB is 4.32 What is the Keq for 2 A + 2 B ↔ 2 AB Keq = ?

What is the major product of the following reaction? OH CrO3 H,SO, CH,OH CHO COOH COOH сосн COOH COOH COOH

Ethyl butyrate, CH3CH2CH2CO2CH2CH3, is an artificial fruit flavor commonly used in the food industry for such flavors as orange and pineapple. Its fragrance and taste are often associated with fresh orange juice, and thus it is most commonly used as orange flavoring.It can be produced by the reaction of butanoic acid with ethanol in the presence of an acid catalyst (H+): CH3CH2CH2CO2H(l)+CH2CH3OH(l)H+⟶CH3CH2CH2CO2CH2CH3(l)+H2O(l). The chemist discovers a more efficient catalyst that can produce ethyl butyrate with a 78.0% yield. How many grams would be produced from 8.50 gof butanoic acid and excess ethanol? Express your answer in grams to three significant figures.

Ethyl butyrate, CH3CH2CH2CO2CH2CH3, is an artificial fruit flavor commonly used in the food industry for such flavors as orange and pineapple. Its fragrance and taste are often associated with fresh orange juice, and thus it is most commonly used as orange flavoring.It can be produced by the reaction of butanoic acid with ethanol in the presence of an acid catalyst (H+): CH3CH2CH2CO2H(l)+CH2CH3OH(l)H+⟶CH3CH2CH2CO2CH2CH3(l)+H2O(l) a) Given 7.70 g of butanoic acid and excess ethanol, how many grams of ethyl butyrate would be synthesized, assuming a complete 100% yield? b) A chemist ran the reaction and obtained 5.25 g of ethyl butyrate. What was the percent yield? c) The chemist discovers a more efficient catalyst that can produce ethyl butyrate with a 78.0% yield. How many grams would be produced from 7.70 g of butanoic acid and excess ethanol?

Ethyl butyrate, CH3CH2CH2CO2CH2CH3, is an artificial fruit flavor commonly used in the food industry for such flavors as orange and pineapple. Its fragrance and taste are often associated with fresh orange juice, and thus it is most commonly used as orange flavoring.It can be produced by the reaction of butanoic acid with ethanol in the presence of an acid catalyst (H+): CH3CH2CH2CO2H(l)+CH2CH3OH(l)H+⟶CH3CH2CH2CO2CH2CH3(l)+H2O(l) Given 8.50 g of butanoic acid and excess ethanol, how many grams of ethyl butyrate would be synthesized, assuming a complete 100%yield? Express your answer in grams to three significant figures.

Two other commonly used sulfonic acids are methanesulfonic acid (CH3SO3H) and triuoromethanesulfonic acid (CH3SO3H). Which has the weaker conjugate base? Which conjugate base is the better leaving group? Which of these acids has the higher pKa?