Concept explainers
Interpretation:
The bond enthalpy has to be expressed in
Concept Introduction:
Bond Enthalpy:
The measure of stability of molecule is bond enthalpy. The change in enthalpy is related in breaking a specific bond of 1 mole of gaseous molecule. In solids and liquids bond enthalpies are affected by neighboring molecules. There is possibility to predict the enthalpy of reaction using the average bond enthalpies. Energy is always needed for the breaking of
The enthalpy of reaction in gas phase is given by,
Where,
BE= Bond enthalpy and
Want to see the full answer?
Check out a sample textbook solutionChapter 10 Solutions
EBK CHEMISTRY: ATOMS FIRST
- The equation for the fermentation of glucose to alcohol and carbon dioxide is: C6H12O6(aq) 2C2H5OH(aq) + 2CO2(g) The enthalpy change for the reaction is 67 kJ. Is this reaction exothermic or endothermic? Is energy, in the form of heat, absorbed or evolved as the reaction occurs?arrow_forwardThe enthalpy change for the reaction of hydrogen gas with fluorine gas (o produce hydrogen fluoride is 542 U for the equation as written: mg src=Images/HTML_99425-10-41QAP_image001.jpg alt="" align="top"/> l type='a'> What is the enthalpy change per mole of hydrogen fluoride produced? Is the reaction exothermic or endothermic as written? What would be the enthalpy change for the reverse of the given equation (that 1%, for the decomposition of HF into its constituent elements)?arrow_forwardA commercial process for preparing ethanol (ethyl alcohol), C2H5OH, consists of passing ethylene gas. C2H4, and steam over an acid catalyst (to speed up the reaction). The gas-phase reaction is Use bond enthalpies (Table 9.5) to estimate the enthalpy change for this reaction when 37.0 g of ethyl alcohol is produced.arrow_forward
- Hydrogen, H2, is prepared by steam reforming, in which hydrocarbons are reacted with steam. For CH4, CH4(g)+H2O(g)CO(g)+3H2(g) Calculate the enthalpy change H for this reaction, using standard enthalpies of formation.arrow_forwardFor the reactions of molecular hydrogen with fluorine and with chlorine: (a) Calculate the enthalpy change for breaking all the bonds in the reactants. (b) Calculate the enthalpy change for forming all the bonds in the products. (c) From the results in parts (a) and (b), calculate the enthalpy change for the reaction. (d) Which reaction is most exothermic?arrow_forwardEstimate H for the following reactions using bond energies given in Table 8.5. 3CH2=CH2(g) + 3H2(g) 3CH2CH3(g) The enthalpies of formation for C6H6(g) and C6H12 (g) are 82.9 and 90.3 kJ/mol. respectively. Calculate H for the two reactions using standard enthalpies of formation from Appendix 4. Account for any differences between the results obtained from the two methods.arrow_forward
- The first step in the preparation of lead from its ore (galena, PbS) consists of roasting the ore. PbS(s)+32O2(g)SO2(g)+PbO(s) Calculate the standard enthalpy change for this reaction, using enthalpies of formation (see Appendix C).arrow_forwardThe enthalpy change for the following reaction is 393.5 kJ. C(s,graphite)+O2(g)CO2(g) (a) Is energy released from or absorbed by the system in this reaction? (b) What quantities of reactants and products are assumed? (c) Predict the enthalpy change observed when 3.00 g carbon burns in an excess of oxygen.arrow_forwardBond Enthalpy When atoms of the hypothetical element X are placed together, they rapidly undergo reaction to form the X2 molecule: X(g)+X(g)X2(g) a Would you predict that this reaction is exothermic or endothermic? Explain. b Is the bond enthalpy of X2 a positive or a negative quantity? Why? c Suppose H for the reaction is 500 kJ/mol. Estimate the bond enthalpy of the X2 molecule. d Another hypothetical molecular compound, Y2(g), has a bond enthalpy of 750 kJ/mol, and the molecular compound XY(g) has a bond enthalpy of 1500 kJ/mol. Using bond enthalpy information, calculate H for the following reaction. X2(g)+Y2(g)2XY(g) e Given the following information, as well as the information previously presented, predict whether or not the hypothetical ionic compound AX is likely to form. In this compound, A forms the A+ cation, and X forms the X anion. Be sure to justify your answer. Reaction: A(g)+12X2(g)AX(s)The first ionization energy of A(g) is 400 kJ/mol. The electron affinity of X(g) is 525 kJ/mol. The lattice energy of AX(s) is 100 kJ/mol. f If you predicted that no ionic compound would form from the reaction in Part e, what minimum amount of AX(s) lattice energy might lead to compound formation?arrow_forward
- A 0.470-g sample of magnesium reacts with 200 g dilute HCl in a coffee-cup calorimeter to form MgCl2(aq) and H2(g). The temperature increases by 10.9 C as the magnesium reacts. Assume that the mixture has the same specific heat as water and a mass of 200 g. (a) Calculate the enthalpy change for the reaction. Is the process exothermic or endothermic? (b) Write the chemical equation and evaluate H.arrow_forward9.41 Under what conditions does the enthalpy change equal the heat of a process?arrow_forwardWhich of the enthalpies of combustion in Table 5.2 the table are also standard enthalpies of formation?arrow_forward
- Chemistry & Chemical ReactivityChemistryISBN:9781133949640Author:John C. Kotz, Paul M. Treichel, John Townsend, David TreichelPublisher:Cengage LearningGeneral Chemistry - Standalone book (MindTap Cour...ChemistryISBN:9781305580343Author:Steven D. Gammon, Ebbing, Darrell Ebbing, Steven D., Darrell; Gammon, Darrell Ebbing; Steven D. Gammon, Darrell D.; Gammon, Ebbing; Steven D. Gammon; DarrellPublisher:Cengage LearningChemistry: Principles and PracticeChemistryISBN:9780534420123Author:Daniel L. Reger, Scott R. Goode, David W. Ball, Edward MercerPublisher:Cengage Learning
- Chemistry & Chemical ReactivityChemistryISBN:9781337399074Author:John C. Kotz, Paul M. Treichel, John Townsend, David TreichelPublisher:Cengage LearningChemistryChemistryISBN:9781305957404Author:Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCostePublisher:Cengage LearningIntroductory Chemistry: A FoundationChemistryISBN:9781337399425Author:Steven S. Zumdahl, Donald J. DeCostePublisher:Cengage Learning