You are given 2.80 mol of copper and 1.10 mol of oxygen. Find the limiting reactant, how much excess remains, and the theoretical yield. If you actually made 1.67 mol of Cuo, what is the percent yield? 2 Cu O2 -2 Cuo B A Limiting reactants is: Excess reactant left: Theoretical yield: Percent yield:

Part A Give the percent yield when 28.16 g of CO, are formed from the reaction of 4.000 moles of C3H18 with 4.000 moles of O2. 2 C3H18 + 25 O2→ 16 CO2 + 18 H20

Combining 0.376 mol Fe₂O3 with excess carbon produced 20.0 g Fe. Fe₂O3 + 3C2Fe + 3 CO What is the actual yield of iron in moles? actual yield: What is the theoretical yield of iron in moles? theoretical yield: What is the percent yield? percent yield: mol mol %

For the following reaction, 5.68 grams of chlorine gas are mixed with excess phosphorus (P4) . The reaction yields 5.34 grams of phosphorus trichloride .phosphorus (P4) ( s ) + chlorine ( g ) phosphorus trichloride ( l ) What is the theoretical yield of phosphorus trichloride ? grams What is the percent yield for this reaction ? %

8. The combustion of glucose is represented by the following balanced equation: C H12O +6 0 6 H0+ 6 CO2. The reaction uses 1 gram of both CgH12Og and O2. What is the percent yield if 0.45 g of H,0 is produced? O a. 0.31% b. 0.558% c. 100% O d. 80% AM9 Lit

Iron oxide reacts with carbon to produce elemental iron and carbon monoxide according the the equation shown below. Consider the reaction of 51.4 grams of Fe2O3 with 24.98 grams of C to produce 19.20 grams of Fe. Fe2O3(s)+3c(s)-------2Fe(s)+3CO(g) a. actual yield b. theoretical yield c. percent yield

In the reaction below, 7.0 mol of NO and 5.0 mol of O2 are reacted together. The reaction generates 3.0 mol of NO2. What is the percent yield for the reaction? 2NO (g) +O2 (g)2NO2 (g)

Combining 0.349 mol Fe,O, with excess carbon produced 17.9 g Fe. Fe, 0, + 3C 2 Fe + 3 CO What is the actual yield of iron in moles? actual yield: mol What is the theoretical yield of iron in moles?

Sodium and chlorine react to form sodium chloride:   What is the theoretical yield of sodium chloride for the reaction of 32.0 g Na with 107.2 g Cl2? A. 1.40 x 104 g NaCl B. 35.4 g NaCl C. 122 g NaCl D. 81.2 g NaCl

Mass of product (g) 3.516 Theoretical yield (g) Product percent yield