Answered: with an explaination, state whether you…

with an explaination, state whether you would expect the OH bond in water to be longer or shorter than the SH bond in hydrogen sulfide.

Chemistry: The Molecular Science

5th Edition

ISBN:9781285199047

Author:John W. Moore, Conrad L. Stanitski

Publisher:John W. Moore, Conrad L. Stanitski

Chapter19: The Chemistry Of The Main-group Elements

Section: Chapter Questions

Problem 71QRT

See similar textbooks

Related questions

Q: Below is a picture of the structure of water or H2O. Why do you think there is a “d+” or a positive…

A: In the polar molecule, one end occupies the partial positive charge while the other end occupies the…

Q: Arrange the following ionic COMPONS in order of increasing magnitude Lattice eney: Base, cas, Csl

A: Lattice Energy is the energy required to completely separate the one mole of the solid ionic…

Q: When comparing binary acids of the elements in the same row of the periodic table, acid strength…

A: In the periodic table the acidic strength increase on going from left to right.

Q: Why is there only a double bond between the oxygen and carbon but not the chlorine?

A: We have to answer why only a double bond is formed between the carbon and oxygen atoms but not…

Q: Which is the correct order of acidity of the following silicon halides? A. SIF4<SICI4<SiBr4<Sil4 B.…

A: Silicon halides are lewis acids. And the lewis acidity depends on the positive charge on central…

Q: Which is the sronger acid CCl3CH2COOH or CCl2FCH2COOH (explain or draw lewis structures)

A: Order of acidity in between two molecules can be either differentiated based on Resonance structure…

Q: Write the chemical name for BF3, Type of Bonding: Show Lewis Structure or Bonding in the solution…

Q: Calculate the [H3O+] when pOH = 5.43

A: The [H3O+] is to be calculated when pOH = 5.43.

Q: b) Diagram 9 shows the elements from a Period found in the periodic table 23.0 24.3 27.0 28.1 31.0…

A: Metals generally form basic oxides whereas non-metals form acidic oxides. Some metals form oxide…

Q: Predict whether the N—O bonds in NO 3 are stronger or weaker than the N—O bonds in NO+.?

A: The N—O bonds in NO3- are stronger or weaker than the N—O bonds in NO+ has to be given,

Q: Explain why difluorine monoxide is a polar molecule but carbon tetrafluoride is a non-polar…

A: Given molecules: difluorine monoxide (OF2) and carbon tetrafluoride (CF4). We have to explain why…

Q: Two possible Lewis electron-dot diagrams for fulminic acid,

A: Given Data: The bond energy of N-O bond is 201 kJ/mol. The bond energy of C=O bond is 745 kJ/mol.…

Q: Explain the chemical bonding between Ca and a atoms with the help of Lewis electron dot structure?

A: The chemical bonding between Ca and Cl atoms with the help of lewis electron dot structure has to be…

Q: 3. Give a and the for the Owing compound: a. Lithium sulfate b. KCIO3 c. Aluminum carbonate d. Al…

A: We will give name of the the compound

Q: Choose the MOST acidic hydrogen from the structure below. II III IV O II O IV

A: The most acidic hydrogen will be present at alpha position to the electron withdrawing group. The…

Q: Draw the Lewis-Acid base adduct with formal charges for the reaction of BH3 with THF

A: Acid and Base are classified according to Lewis theory Here we are required to draw the acid Base…

Q: Would you expect that an anion would be physically closerto the oxygen or to the hydrogens of water…

A: The interaction between an anion and a water molecule can be represented as -

Q: Draw Lewis structures of the peroxide ion and the oxygen molecule

A: The Lewis structures of peroxide ion is:

Q: What is the purpose of the sulfuric acid?

A: Purpose of sulphuric acid

Q: Each of the following properties shows a regular trend inGroup 1A(1). Predict whether each increases…

A: NOTE ; Since you've posted multiple sub-parts,we'll solve only first three sub-parts for you. To get…

Q: Calculate the number of total valence electrons and draw the Lewis structure for the hypothetical…

A: H -1e- At -7e- (7A group element Astatine) O - 12e- (each 6e- × 2) Total = 20e- (valence)

Q: Sketch and label 6-8 H2O molecules interacting in the liquid phase.

Q: 3) What is the [H'] when [OH]= 8.1 x 10°?

A: Given, [OH-] =8.1×10-5 Mwe are asked to calculate the [H+]

Q: substitute for each of those elements? The oxygen can be substituted by the sulfur. Hence, H,0 can…

A: For comparison we have to consider intermolecular forces , size and electronegativity in our…

Q: Write the formula of the compound more likely to form from: a) Cuprous ion and peroxide ion b)…

Q: With the aid of a diagram, describe the covalent bonds that an oxygen atom with atomic number 8 can…

A: When two or more elements have incomplete octet ,then if they share their valence electrons in such…

Q: Draw all of the Lewis structures of O22- which obey the octet rule and use this Lewis structure or…

A: We have to choose Correct statement.

Q: briefly explain why the oleic acid molecules organize themselves into a monolayer?

A: Oleic acid is a fatty acid with the molecular formula CH3(CH2)7CH=CH(CH2)7COOH.

Q: (e) The mobility of H+ ions is very high because of the small size and other reasons. The mobility…

A: A question based on electrolysis that is to be accomplished.

Q: To draw a lewis structure for the phosphate ion you must what?

A: Lewis structure represents the valence shell electrons in a compound. It shows the distribution of…

Q: Assuming that the effect of bond energy is more important than the effect of electronegativity, the…

A: Bond energy of HI is 295 kj per mole while bond energy of HCl is 428 kj per mole . having less bond…

Q: 2. Give the shape and the corresponding bond angle for a molecule of formula QX, where Q is an…

A: The three dimensional arrangement of atoms in a molecule is referred to as its molecular geometry.…

Q: Arrange the following in the order of the property indicated for each set–(a) F2, Cl2, Br2,…

Q: In the van der Waals equation which molecule would you expect to have the largest b value? PH3 SbH3…

Q: In what sense is acetylene a protonic acid? Explain why its reactions with ammoniacal cuprous…

A: Protonic acid is the compound or molecule that has the ability to produce H+ ions in the solution.…

Q: 12. Draw the Lewis Structures for each of the following molecules and ions by first clicking on the…

A: Since you asked multiple questions so as per Q&A guidelines of portal I solve first image…

Q: (e) The mobility of H+ ions is very high because of the small size and other reasons. The mobility…

A: Due to its small size, H+ can move quickly in the aqueous solution. However, its exceptional…

Q: (e) The mobility of H* ions is very high because of the small size and other reasons. The mobility…

A: Mobility is defined as the distance travelled by ion per second under potential gradient of 1 volt…

Q: Describe the bond formation between hydrogen and flourine. What type of chemical bond do they form…

A: Atoms are held together in a molecule because of some attractive and repulsive forces. These forces…

Q: Assuming that the effect of bond energy is more important than the effect of electronegativity, the…

A: An acid H-X is supposed to be more acidic if it can easily donate proton. The more the ease of…

Q: Sulfuric acid is prepared by oxidizing sulfur to sulfur dioxide and then to sulfur trioxide.…

Q: List the acids containing the group 7 elements HF, HCl, HBr and HIin order of increasing bond length…

A: The acids given are HF, HCl, HBr and HI.

Q: below

A: Na2S dissociates in water to it's ions

Q: Draw the lewis dot diagram and lewis structure of Nitric Acid (HNO3)

Q: answer these questions with NaOH *State two examples of another substance of the same type with the…

A: 1.) Sodium hydroxide (NaOH) has ionic bonding and the examples similar to it are- a. Magnesium…

Q: How does the acidity of the binary acid of an element vary as a function of the electronegativity of…

A: The most primitive definition of acid is that an acid is a chemical species that releases H+ ion in…

Q: Ql: Are the van der waals bonds chemical or physical bonds? Explain the formation mechanism of these…

Question

with an explaination, state whether you would expect the OH bond in water to be longer or shorter than the SH bond in hydrogen sulfide.

Expert Solution

This question has been solved!

Explore an expertly crafted, step-by-step solution for a thorough understanding of key concepts.

SEE SOLUTION Check out a sample Q&A here

Step 1

VIEW

Step 2

VIEW

Step by step

Solved in 2 steps

SEE SOLUTION Check out a sample Q&A here

Knowledge Booster

Learn more about

Need a deep-dive on the concept behind this application? Look no further. Learn more about this topic, chemistry and related others by exploring similar questions and additional content below.

Similar questions

In a hydrogen molecule, the two hydrogen atoms are held together by a single bond with a bond energy of 436 kJ/mol of hydrogen. In other words, to break the H-H bonds in one mole of molecular hydrogen requires the expenditure of 436 kJ of energy. Using the balanced chemical equation for the formation of water from oxygen and hydrogen (shown above), and interpreting the stoichiometric coefficients as mole amounts, how much energy must be expended in breaking the H-H bonds? kJ
What is the Lewis Structure for P4, its electron geometry, and molecular geometry?
Chlorine dioxide gas (ClO2) is used as a commercial bleachingagent. It bleaches materials by oxidizing them. In thecourse of these reactions, the ClO2 is itself reduced. (a)What is the Lewis structure for ClO2? (b) Why do you thinkthat ClO2 is reduced so readily? (c) When a ClO2 moleculegains an electron, the chlorite ion, ClO2-, forms. Draw theLewis structure for ClO2-. (d) Predict the O—Cl—O bondangle in the ClO2- ion. (e) One method of preparing ClO2is by the reaction of chlorine and sodium chlorite:Cl2(g) + 2 NaClO2(s)------>2 ClO2(g) + 2 NaCl(s)If you allow 15.0 g of NaClO2 to react with 2.00 L of chlorinegas at a pressure of 1.50 atm at 21 °C, how many gramsof ClO2 can be prepared?
Galium (Ga) is an element in group III with atomic number 31. By referring to the Periodic Table, answer the following questions. Explain how the atomic radius of gallium differs from aluminium. Explain how the electronegativity of gallium differs from aluminium. Explain how the electronegativity of gallium differs from germanium. Explain how the ionisation energy of gallium differs from germanium. Explain how the ionisation energy of gallium differs from indium.
Butanol has the chemical formula C4H9OH. d) In the molecule of butanol, there are C-C bonds, C-H bonds, a C-O bond and a O-H bond. Order these bonds from most to least polar e) On average, would you expect C-C to have longer or shorter bonds than C-H Briefly explain your answer. f) From the reaction 2.57 L of carbon dioxide was produced and captured. Calculate the number of molecules of carbon dioxide if the temperature was 25.0 C and the pressure 1. 01 × 105 Pa. g) The empirical and molecular formula for butanol is the same. Briefly explain why.
Assuming that the effect of bond energy is more important than the effect of electronegativity, the substance HI is expected to be a stronger acid than the substance HCl.
Answer the questions in the table below about the shape of the phosphorus pentabromide (PBr,) molecule. How many electron groups are around the central phosphorus atom? Note: one "electron group" means one lone pair, one single bond, one double bond, or one triple bond. What phrase best describes the arrangement of these electron groups around the central phosphorus atom? (You may need to use the scrollbar to see all the choices.) (choose one) Ar Explanation Check © 2021 McGraw Hill LLC. AlI Rights Reserved. Terms of Use Privacy Center | Accessibility
A student investigates the physical and chemical properties of various carbon-containing compounds. Thr complete Lewis electron-dot diagrams and boiling points for two compounds, Q and Z, are shown in the following table: B) Any C — H bond in compound Q is shorter than the S — H bond in compound Z. Explain the reason for this difference using principles of atomic structure.
Provide the Lewis structure and molecular geometry as predicted by VSEPR (with solution) of the following: (b) Sulfur tetrafluoride, SF4
Draw the Lewis structures for the phosphorus halides PCl3 and PCl5 . Describe their VSEPR shape.
Discuss the structure of NO, in terms of resonance and in terms of delocalized a bonding.
b) Diagram 9 shows the elements from a Period found in the periodic table 23.0 24.3 27.0 28.1 31.0 32.1 35.5 39.9 Na Mg Al Si P S CI Ar 11 12 13 14 15 16 17 18 Diagram 9 Based on the diagram above, (i) Suggest one metal that forms basic oxide and one metal that form amphoteric oxide when reacts with oxygen. (ii) Explain the trend of electronegativity across the period